From 460c52653ab0dcca6f19a4f492ed2c5e4e963ab0 Mon Sep 17 00:00:00 2001 From: toma Date: Wed, 25 Nov 2009 17:56:58 +0000 Subject: Copy the KDE 3.5 branch to branches/trinity for new KDE 3.5 features. BUG:215923 git-svn-id: svn://anonsvn.kde.org/home/kde/branches/trinity/kdepim@1054174 283d02a7-25f6-0310-bc7c-ecb5cbfe19da --- korn/AUTHORS | 4 + korn/ChangeLog | 38 + korn/KOrn.desktop | 78 ++ korn/Makefile.am | 124 ++ korn/account_input.cpp | 173 +++ korn/account_input.h | 310 +++++ korn/accountmanager.cpp | 268 ++++ korn/accountmanager.h | 155 +++ korn/boxcontainer.cpp | 83 ++ korn/boxcontainer.h | 103 ++ korn/boxcontaineritem.cpp | 443 +++++++ korn/boxcontaineritem.h | 236 ++++ korn/dcop_proto.cpp | 62 + korn/dcop_proto.h | 117 ++ korn/dcopdrop.cpp | 201 +++ korn/dcopdrop.h | 190 +++ korn/dcopdropif.cpp | 46 + korn/dcopdropif.h | 71 ++ korn/dockedcontainer.cpp | 37 + korn/dockedcontainer.h | 45 + korn/dockeditem.cpp | 92 ++ korn/dockeditem.h | 96 ++ korn/hi16-app-korn.png | Bin 0 -> 988 bytes korn/hi32-app-korn.png | Bin 0 -> 2689 bytes korn/hi48-app-korn.png | Bin 0 -> 4869 bytes korn/hvcontainer.cpp | 52 + korn/hvcontainer.h | 58 + korn/hvitem.cpp | 82 ++ korn/hvitem.h | 80 ++ korn/imap_proto.cpp | 101 ++ korn/imap_proto.h | 143 +++ korn/imaps_proto.h | 40 + korn/intid.cpp | 25 + korn/intid.h | 52 + korn/kconf_update/Makefile.am | 12 + korn/kconf_update/korn-3-4-config_change.cpp | 261 ++++ korn/kconf_update/korn-3-4-config_change.upd | 3 + korn/kconf_update/korn-3-5-metadata-update.pl | 43 + korn/kconf_update/korn-3-5-ssl-update.pl | 39 + korn/kconf_update/korn-3-5-update.upd | 10 + korn/keditlistboxman.cpp | 301 +++++ korn/keditlistboxman.h | 147 +++ korn/kio.cpp | 561 ++++++++ korn/kio.h | 207 +++ korn/kio_count.cpp | 330 +++++ korn/kio_count.h | 81 ++ korn/kio_delete.cpp | 201 +++ korn/kio_delete.h | 69 + korn/kio_proto.cpp | 81 ++ korn/kio_proto.h | 157 +++ korn/kio_read.cpp | 97 ++ korn/kio_read.h | 60 + korn/kio_single_subject.cpp | 155 +++ korn/kio_single_subject.h | 68 + korn/kio_subjects.cpp | 176 +++ korn/kio_subjects.h | 74 ++ korn/kmail_proto.cpp | 246 ++++ korn/kmail_proto.h | 122 ++ korn/kornaccountcfg.ui | 249 ++++ korn/kornaccountcfgimpl.cpp | 232 ++++ korn/kornaccountcfgimpl.h | 69 + korn/kornapp.cpp | 21 + korn/kornapp.h | 43 + korn/kornboxcfg.ui | 1698 +++++++++++++++++++++++++ korn/kornboxcfgimpl.cpp | 372 ++++++ korn/kornboxcfgimpl.h | 93 ++ korn/korncfg.ui | 176 +++ korn/korncfgimpl.cpp | 253 ++++ korn/korncfgimpl.h | 61 + korn/kornshell.cpp | 155 +++ korn/kornshell.h | 57 + korn/label.h | 43 + korn/maildir_proto.h | 56 + korn/maildlg.cpp | 109 ++ korn/maildlg.h | 82 ++ korn/maildrop.cpp | 250 ++++ korn/maildrop.h | 456 +++++++ korn/mailid.cpp | 5 + korn/mailid.h | 33 + korn/mailsubject.cpp | 189 +++ korn/mailsubject.h | 187 +++ korn/main.cpp | 53 + korn/mbox_proto.cpp | 47 + korn/mbox_proto.h | 58 + korn/nntp_proto.cpp | 57 + korn/nntp_proto.h | 52 + korn/password.cpp | 247 ++++ korn/password.h | 168 +++ korn/polldrop.cpp | 90 ++ korn/polldrop.h | 69 + korn/pop3_proto.cpp | 102 ++ korn/pop3_proto.h | 58 + korn/pop3s_proto.h | 40 + korn/process_proto.cpp | 47 + korn/process_proto.h | 48 + korn/progress_dialog.ui | 120 ++ korn/progress_dialog.ui.h | 67 + korn/protocol.h | 63 + korn/protocols.cpp | 87 ++ korn/protocols.h | 46 + korn/qmail_proto.cpp | 49 + korn/qmail_proto.h | 58 + korn/sortedmailsubject.cpp | 33 + korn/sortedmailsubject.h | 40 + korn/stringid.cpp | 38 + korn/stringid.h | 46 + korn/subjectsdlg.cpp | 535 ++++++++ korn/subjectsdlg.h | 202 +++ korn/systemtray.cpp | 42 + korn/systemtray.h | 58 + korn/uninstall.desktop | 2 + korn/utils.h | 5 + 112 files changed, 14622 insertions(+) create mode 100644 korn/AUTHORS create mode 100644 korn/ChangeLog create mode 100644 korn/KOrn.desktop create mode 100644 korn/Makefile.am create mode 100644 korn/account_input.cpp create mode 100644 korn/account_input.h create mode 100644 korn/accountmanager.cpp create mode 100644 korn/accountmanager.h create mode 100644 korn/boxcontainer.cpp create mode 100644 korn/boxcontainer.h create mode 100644 korn/boxcontaineritem.cpp create mode 100644 korn/boxcontaineritem.h create mode 100644 korn/dcop_proto.cpp create mode 100644 korn/dcop_proto.h create mode 100644 korn/dcopdrop.cpp create mode 100644 korn/dcopdrop.h create mode 100644 korn/dcopdropif.cpp create mode 100644 korn/dcopdropif.h create mode 100644 korn/dockedcontainer.cpp create mode 100644 korn/dockedcontainer.h create mode 100644 korn/dockeditem.cpp create mode 100644 korn/dockeditem.h create mode 100644 korn/hi16-app-korn.png create mode 100644 korn/hi32-app-korn.png create mode 100644 korn/hi48-app-korn.png create mode 100644 korn/hvcontainer.cpp create mode 100644 korn/hvcontainer.h create mode 100644 korn/hvitem.cpp create mode 100644 korn/hvitem.h create mode 100644 korn/imap_proto.cpp create mode 100644 korn/imap_proto.h create mode 100644 korn/imaps_proto.h create mode 100644 korn/intid.cpp create mode 100644 korn/intid.h create mode 100644 korn/kconf_update/Makefile.am create mode 100644 korn/kconf_update/korn-3-4-config_change.cpp create mode 100644 korn/kconf_update/korn-3-4-config_change.upd create mode 100644 korn/kconf_update/korn-3-5-metadata-update.pl create mode 100644 korn/kconf_update/korn-3-5-ssl-update.pl create mode 100644 korn/kconf_update/korn-3-5-update.upd create mode 100644 korn/keditlistboxman.cpp create mode 100644 korn/keditlistboxman.h create mode 100644 korn/kio.cpp create mode 100644 korn/kio.h create mode 100644 korn/kio_count.cpp create mode 100644 korn/kio_count.h create mode 100644 korn/kio_delete.cpp create mode 100644 korn/kio_delete.h create mode 100644 korn/kio_proto.cpp create mode 100644 korn/kio_proto.h create mode 100644 korn/kio_read.cpp create mode 100644 korn/kio_read.h create mode 100644 korn/kio_single_subject.cpp create mode 100644 korn/kio_single_subject.h create mode 100644 korn/kio_subjects.cpp create mode 100644 korn/kio_subjects.h create mode 100644 korn/kmail_proto.cpp create mode 100644 korn/kmail_proto.h create mode 100644 korn/kornaccountcfg.ui create mode 100644 korn/kornaccountcfgimpl.cpp create mode 100644 korn/kornaccountcfgimpl.h create mode 100644 korn/kornapp.cpp create mode 100644 korn/kornapp.h create mode 100644 korn/kornboxcfg.ui create mode 100644 korn/kornboxcfgimpl.cpp create mode 100644 korn/kornboxcfgimpl.h create mode 100644 korn/korncfg.ui create mode 100644 korn/korncfgimpl.cpp create mode 100644 korn/korncfgimpl.h create mode 100644 korn/kornshell.cpp create mode 100644 korn/kornshell.h create mode 100644 korn/label.h create mode 100644 korn/maildir_proto.h create mode 100644 korn/maildlg.cpp create mode 100644 korn/maildlg.h create mode 100644 korn/maildrop.cpp create mode 100644 korn/maildrop.h create mode 100644 korn/mailid.cpp create mode 100644 korn/mailid.h create mode 100644 korn/mailsubject.cpp create mode 100644 korn/mailsubject.h create mode 100644 korn/main.cpp create mode 100644 korn/mbox_proto.cpp create mode 100644 korn/mbox_proto.h create mode 100644 korn/nntp_proto.cpp create mode 100644 korn/nntp_proto.h create mode 100644 korn/password.cpp create mode 100644 korn/password.h create mode 100644 korn/polldrop.cpp create mode 100644 korn/polldrop.h create mode 100644 korn/pop3_proto.cpp create mode 100644 korn/pop3_proto.h create mode 100644 korn/pop3s_proto.h create mode 100644 korn/process_proto.cpp create mode 100644 korn/process_proto.h create mode 100644 korn/progress_dialog.ui create mode 100644 korn/progress_dialog.ui.h create mode 100644 korn/protocol.h create mode 100644 korn/protocols.cpp create mode 100644 korn/protocols.h create mode 100644 korn/qmail_proto.cpp create mode 100644 korn/qmail_proto.h create mode 100644 korn/sortedmailsubject.cpp create mode 100644 korn/sortedmailsubject.h create mode 100644 korn/stringid.cpp create mode 100644 korn/stringid.h create mode 100644 korn/subjectsdlg.cpp create mode 100644 korn/subjectsdlg.h create mode 100644 korn/systemtray.cpp create mode 100644 korn/systemtray.h create mode 100644 korn/uninstall.desktop create mode 100644 korn/utils.h (limited to 'korn') diff --git a/korn/AUTHORS b/korn/AUTHORS new file mode 100644 index 00000000..2bc55ebb --- /dev/null +++ b/korn/AUTHORS @@ -0,0 +1,4 @@ +Author: Sirtaj Singh Kang +Hatchet jobs: Cristian Tibirna +IMAP: Kurt Granoth +More hatchet jobs: Rik Hemsley diff --git a/korn/ChangeLog b/korn/ChangeLog new file mode 100644 index 00000000..d22d617a --- /dev/null +++ b/korn/ChangeLog @@ -0,0 +1,38 @@ +2000-06-14 Rik Hemsley + * More porting to KDE/Qt 2. Shitloads to do, took all day :( + * Compiles cleanly with -DQT_NO_ASCII_CAST -DQT_NO_CAST_ASCII + -DQT_CLEAN_NAMESPACE + * Used an inline function called 'fu()' to convert all (const) char * to + QString. It calles QString::fromUtf8(), hence 'f(from)u(tf8)'. + +2000-06-12 Rik Hemsley + * Minor icon fix. + * Fixes to kornbutt. + +2000-06-12 Rik Hemsley + * Fixed enabling of buttons and initial selection in optdlg. + * Converted C-style casts to C++-style, and checked retvals + of dynamic_casts. Currently only assert() used, but that's + better than crashing. + * Fixed layout of polldlg. + * Split 'General' cfg widget into two, 'View' and 'Commands' + * Added some keyboard accelerators. + * Still need to connect config stuff up properly... + +2000-06-09 Rik Hemsley + * Converted the dialogs to use KDialogBase etc. + * Changed 'Options' to 'Display' and moved to second place in + main config dialog. + +1999-06-23 Cristian Tibirna + + * temporarily take care of korn (with Taj's blessing) + * fix most of the layouts (/me being too stupid to fix Taj's nice + custom layout classes, I switched completely to pure QLayouts) + * fixed most of the i18n + * made FileDialogs start with the current path by default (instead no + path, used before) + * changed some UI details a it (repetitive "Box" word etc.) + * added the Cancel button to the main QTabDialog of Setup... + NOTICE: kornII always functioned correctly. My changes are only makeup + diff --git a/korn/KOrn.desktop b/korn/KOrn.desktop new file mode 100644 index 00000000..50f088ad --- /dev/null +++ b/korn/KOrn.desktop @@ -0,0 +1,78 @@ +[Desktop Entry] +GenericName=Mail Alert +GenericName[af]=Pos inkennis stel +GenericName[ar]=منبه للبريد الألكتروني +GenericName[bg]=Аларма за е-поща +GenericName[bs]=Obavještavanje o pristigloj pošti +GenericName[ca]=Alerta per al correu +GenericName[cs]=Upozornění na poštu +GenericName[cy]=Rhybudd Ebost +GenericName[da]=Meddelelse om post +GenericName[de]=Mail-Benachrichtigung +GenericName[el]=Ειδοποίηση για mail +GenericName[eo]=Retpoŝtavertilo +GenericName[es]=Aviso de correo +GenericName[et]=E-kirjade teadustaja +GenericName[eu]=Mail abisua +GenericName[fa]=هشدارنامه +GenericName[fi]=Saapuneen sähköpostin ilmoitus +GenericName[fr]=Surveillance du courrier électronique +GenericName[fy]=E-postnotifikaasje +GenericName[ga]=Fógairt Ríomhphoist +GenericName[gl]=Alerta de Correo-e +GenericName[hi]=डाक सतर्क +GenericName[hr]=Upozorenje na nove poruke +GenericName[hu]=Levélfigyelő +GenericName[is]=Póst áminning +GenericName[it]=Programma per controllare la posta +GenericName[ja]=メールの通知 +GenericName[ka]=საფოსტო სიგნალი +GenericName[kk]=Пошта келген туралы хабарлау +GenericName[km]=សញ្ញា​ជូនដំណឹងសំបុត្រ +GenericName[lt]=Pašto pranešėjas +GenericName[lv]=Pasta Brīdinājums +GenericName[mk]=Известување за е-пошта +GenericName[ms]=Celik Mel +GenericName[mt]=Twissija tal-imejl +GenericName[nb]=E-post-varsling +GenericName[nds]=Nettpost-Benarichten +GenericName[ne]=सावधानी पत्र +GenericName[nl]=E-mailnotificatie +GenericName[nn]=E-postvarsling +GenericName[pl]=Program powiadamiający o poczcie +GenericName[pt]=Alerta de E-mail +GenericName[pt_BR]=Alerta de E-mail +GenericName[ro]=Alertare e-mail nou +GenericName[ru]=Уведомление о приходе почты +GenericName[rw]=Iburira ry'Ubutumwa +GenericName[sk]=Upozornenie na mail +GenericName[sl]=Obvestilo o pošti +GenericName[sr]=Провера поште +GenericName[sr@Latn]=Provera pošte +GenericName[sv]=E-postvarning +GenericName[ta]=அஞ்சல் அறிவிப்பு +GenericName[tg]=Маълумоти қабулшавии почта +GenericName[th]=แจ้งเตือนจดหมาย +GenericName[tr]=Midi Uyarısı +GenericName[uk]=Нагадування пошти +GenericName[uz]=Yangi xat haqida xabar beruvchi +GenericName[uz@cyrillic]=Янги хат ҳақида хабар берувчи +GenericName[ven]=U sedzesa poso +GenericName[xh]=Umposi Wokulumkisa +GenericName[zh_CN]=邮件警告 +GenericName[zh_TW]=信件警告 +GenericName[zu]=Umposi Ohlomile +Exec=korn -caption "%c" %i %m %f +Icon=korn +Path= +DocPath=korn/index.html +Type=Application +Terminal=false +Name=Korn +Name[eo]=Korno +Name[hi]=कॉर्न +Name[ne]=कर्न +Name[ta]=கார்ன் +Name[zh_TW]=Korn 信件通知 +X-DCOP-ServiceType=Unique +Categories=Qt;KDE;Network;X-KDE-More;Office;Email; diff --git a/korn/Makefile.am b/korn/Makefile.am new file mode 100644 index 00000000..13d908df --- /dev/null +++ b/korn/Makefile.am @@ -0,0 +1,124 @@ +KDE_CXXFLAGS = $(USE_RTTI) + +INCLUDES = -I$(top_srcdir)/libkmime \ + $(all_includes) +#INCLUDES = -I$(top_srcdir)/mimelib -I$(top_srcdir)/libkmime $(all_includes) +AM_LDFLAGS = $(all_libraries) $(KDE_RPATH) + +METASOURCES = AUTO + +bin_PROGRAMS = korn +korn_LDADD = $(LIB_KIO) $(top_builddir)/libkmime/libkmime.la +#korn_LDADD = $(top_builddir)/mimelib/libmimelib.la $(LIB_KFILE) $(LIBSOCKET) $(top_builddir)/libkmime/libkmime.la + +korn_SOURCES = \ + accountmanager.cpp \ + account_input.cpp \ + boxcontainer.cpp \ + boxcontaineritem.cpp boxcontaineritem.skel \ + dcopdrop.cpp \ + dcopdropif.cpp dcopdropif.skel \ + dcop_proto.cpp \ + dockedcontainer.cpp \ + dockeditem.cpp \ + hvcontainer.cpp \ + hvitem.cpp \ + keditlistboxman.cpp \ + nntp_proto.cpp \ + maildrop.cpp \ + main.cpp \ + polldrop.cpp \ + protocols.cpp \ + kornshell.cpp \ + subjectsdlg.cpp \ + maildlg.cpp \ + mailid.cpp \ + mailsubject.cpp \ + mbox_proto.cpp \ + imap_proto.cpp \ + intid.cpp \ + stringid.cpp \ + kornapp.cpp \ + kio.cpp \ + kio_count.cpp \ + kio_proto.cpp \ + kio_subjects.cpp \ + kio_single_subject.cpp \ + kio_read.cpp \ + kio_delete.cpp \ + kmail_proto.cpp \ + sortedmailsubject.cpp \ + korncfgimpl.cpp \ + kornaccountcfgimpl.cpp \ + kornboxcfgimpl.cpp \ + kornaccountcfg.ui \ + kornboxcfg.ui \ + korncfg.ui \ + password.cpp \ + pop3_proto.cpp \ + systemtray.cpp \ + process_proto.cpp \ + progress_dialog.ui \ + qmail_proto.cpp + +noinst_HEADERS = \ + accountmanager.h \ + account_input.h \ + boxcontainer.h \ + boxcontaineritem.h \ + dcop_proto.h \ + dcopdrop.h \ + dcopdropif.h \ + dockeditem.h \ + hvcontainer.h \ + hvitem.h \ + keditlistboxman.h \ + kmail_proto.h \ + kornaccountcfgimpl.h \ + kornboxcfg.h \ + kornboxcfgimpl.h \ + korncfg.h \ + korncfgimpl.h \ + maildrop.h \ + progress_dialog.ui.h \ + protocols.h \ + kornshell.h \ + subjectsdlg.h \ + maildlg.h \ + mailid.h \ + mailsubject.h \ + mbox_proto.h \ + intid.h \ + stringid.h \ + kornapp.h \ + kio.h \ + kio_count.h \ + kio_subjects.h \ + kio_single_subject.h \ + kio_read.h \ + kio_delete.h \ + sortedmailsubject.h \ + imap_proto.h \ + imaps_proto.h \ + kio_proto.h \ + maildir_proto.h \ + nntp_proto.h \ + pop3_proto.h \ + pop3s_proto.h \ + password.h \ + process_proto.h \ + qmail_proto.h \ + systemtray.h + +srcdoc: + kdoc -p -u "/~ssk/src/korn/" -n korn -d /home/ssk/web/src/korn *.h \ + -lqt -lkdeui -lkdecore + +messages: rc.cpp + $(XGETTEXT) *.h *.cpp -o $(podir)/korn.pot + +KDE_ICON = korn + +xdg_apps_DATA = KOrn.desktop + +SUBDIRS = kconf_update diff --git a/korn/account_input.cpp b/korn/account_input.cpp new file mode 100644 index 00000000..363e0475 --- /dev/null +++ b/korn/account_input.cpp @@ -0,0 +1,173 @@ +/* + * Copyright (C) 2005, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + + +#include "account_input.h" + +#include +#include + +#include +#include +#include +#include +#include +#include + +AccountInput::AccountInput( const QString& configName ) + : _configName( new QString( configName ) ) +{ +} + +AccountInput::~AccountInput() +{ + delete _configName; +} + +QString AccountInput::configName() const +{ + return *_configName; +} + +TextInput::TextInput( QWidget *parent, const QString& title, Type type, const QString& defaul, const QString& configName ) + : AccountInput( configName ) +{ + _left = new QLabel( title, parent, "label" ); + _right = new KLineEdit( "", parent, "edit" ); + switch( type ) + { + case text: + break; + case password: + _right->setEchoMode( QLineEdit::Password ); + break; + } + setValue( defaul ); +} + +TextInput::TextInput( QWidget *parent, const QString& title, int min, int max, const QString& defaul, const QString& configName ) + : AccountInput( configName ) +{ + _left = new QLabel( title, parent, "label" ); + _right = new KLineEdit( "", parent, "edit" ); + _right->setValidator( new QIntValidator( min, max, _right, "validator" ) ); + setValue( defaul ); +} + +TextInput::~TextInput() +{ + delete _left; + delete _right; +} + +QString TextInput::value() const +{ + return _right->text(); +} + +void TextInput::setValue( const QString& value ) +{ + return _right->setText( value ); +} + +URLInput::URLInput( QWidget *parent, const QString& title, const QString& defaul, const QString& configName ) + : AccountInput( configName ) +{ + _left = new QLabel( title, parent, "label" ); + _right = new KURLRequester( "", parent, "kurledit" ); + setValue( defaul ); +} + +URLInput::~URLInput() +{ + delete _left; + delete _right; +} + +QString URLInput::value() const +{ + return _right->url(); +} + +void URLInput::setValue( const QString& value ) +{ + _right->setURL( value ); +} + +ComboInput::ComboInput( QWidget *parent, const QString& title, const QMap& list, + const QString& defaul, const QString& configName ) + : AccountInput( configName ) + , _list( new QMap< QString, QString >( list ) ) +{ + _left = new QLabel( title, parent, "label" ); + _right = new QComboBox( false, parent, "combo" ); + _right->insertStringList( QStringList( _list->values() ) ); + setValue( defaul ); +} + +ComboInput::~ComboInput() +{ + delete _left; + delete _right; +} + +QString ComboInput::value() const +{ + if( _right->currentItem() >= 0 ) + return _list->keys()[ _right->currentItem() ]; + else + return ""; +} + +void ComboInput::setValue( const QString& value ) +{ + if( _list->contains( value ) ) + _right->setCurrentItem( _list->keys().findIndex( value ) ); + else + _right->setCurrentItem( -1 ); +} + +CheckboxInput::CheckboxInput( QWidget *parent, const QString& title, const QString& defaul, const QString& configName ) + : AccountInput( configName ) +{ + _right = new QCheckBox( title, parent, "checkbox" ); + setValue( defaul ); +} + +CheckboxInput::~CheckboxInput() +{ + delete _right; +} + +QString CheckboxInput::value() const +{ + if( _right->isChecked() ) + return "true"; + else + return "false"; +} + +void CheckboxInput::setValue( const QString& value ) +{ + if( value == "true" ) + _right->setChecked( true ); + else if( value == "false" ) + _right->setChecked( false ); + //Elsewise: do nothing +} + diff --git a/korn/account_input.h b/korn/account_input.h new file mode 100644 index 00000000..80f98903 --- /dev/null +++ b/korn/account_input.h @@ -0,0 +1,310 @@ +/* +* Copyright (C) 2005, Mart Kelder (mart.kde@hccnet.nl) +* +* This program is free software; you can redistribute it and/or modify +* it under the terms of the GNU General Public License as published by +* the Free Software Foundation; either version 2 of the License, or +* (at your option) any later version. +* +* This program is distributed in the hope that it will be useful, +* but WITHOUT ANY WARRANTY; without even the implied warranty of +* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +* GNU General Public License for more details. +* +* You should have received a copy of the GNU General Public License +* along with this program; if not, write to the Free Software +* Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + + +#ifndef MK_ACCOUNT_INPUT +#define MK_ACCOUNT_INPUT + +class QWidget; +class QString; +class QStringList; + +class QLabel; +class KLineEdit; +class KURLRequester; +class QComboBox; +class QCheckBox; + +#include + +/** + * This classe contains methods to use in the creation of the protocol configuration box. + * The subclasses of this classes define the methods. + */ +class AccountInput +{ +public: + /** + * Constructor. + * + * @param configName The name as the information is stored in the configuration-file. + */ + AccountInput( const QString& configName ); + /** + * Destructor + */ + virtual ~AccountInput(); + + /** + * Implementations should return the left widget. In the configuration, it is + * possible to make a left label and a right input box. + * @return The pointer to the widget. + */ + virtual QWidget* leftWidget() = 0; + /** + * Implementations should return the right widget. In the configuration, it is + * possible to make a left label and a right input box. + * @return The pointer to the widget. + */ + virtual QWidget* rightWidget() = 0; + + /** + * This function return the config name. This is used for stored an retrieving information. + * + * @return The configName as used for this config field. + */ + QString configName() const; + + /** + * Return the value of the configuration object. In most cases, this is the value the user typed in. + * This information will be stored in the configuration file. + * + * @return The value of the object + */ + virtual QString value() const = 0; + + /** + * Implementation should edit there widget such that value() would return the parameter. + * + * @param value The value that the object must get. + */ + virtual void setValue( const QString& value ) = 0; +protected: + QString *_configName; +}; + +/** + * This class implement a simple text input. + * The left widget is a label, the right widget is a KLineEdit. + * The value of this object is determined by the value of the KLineEdit. + */ +class TextInput : public AccountInput +{ +public: + /** + * Enum for specifing the type. + * text means a normal LineEdit, + * password means that *-sings are used instead of characters. + */ + enum Type { text, password }; + + /** + * Constructor + * + * @param parent The parent widget + * @param title The title that appears on the screen + * @param type The type of TextEdit which is used + * @param defaul The default value of this object + * @param configName The name it has in the configuration box. + */ + TextInput( QWidget *parent, const QString& title, Type type, const QString& defaul, const QString& configName ); + /** + * Constructor. Use this one if you want to ensure a number is inserted. + * + * @param parent The parent widget + * @param title The title that appears on the screen + * @param min The minimum value that can be inserted + * @param max The maximum value that can be inserted + * @param defaul The default value of this object + * @param configName The name it has in the configuration box. + */ + TextInput( QWidget *parent, const QString& title, int min, int max, const QString& defaul, const QString& configName ); + /** + * Destructor + */ + virtual ~TextInput(); + + /** + * Returns a pointer to the label. + * @return A pointer to the label + */ + virtual QWidget* leftWidget() { return (QWidget*)_left; } + /** + * Returns a pointer to the KLineEdit. + * @return A pointer to the KLineEdit + */ + virtual QWidget* rightWidget() { return (QWidget*)_right; } + + /** + * The value of the lineedit. + * @return The value of the lineedit. + */ + virtual QString value() const; + /** + * This function sets the text of the edit box. + * @param value The value to appear in the lineedit box. + */ + virtual void setValue( const QString& value ); +private: + QLabel *_left; + KLineEdit *_right; +}; + +/** + * This class implements a URL AccountInput. It can be used to request a file. + */ +class URLInput : public AccountInput +{ +public: + /** + * Constructor + * @param parent The parent of this object + * @param title The title of the label next to the URL. + * @param defaul The default value + * @param configName The name of the configuration entry + */ + URLInput( QWidget *parent, const QString& title, const QString& defaul, const QString& configName ); + /** + * Destructor + */ + virtual ~URLInput(); + + /** + * This return a pointer to the label of this object + * @return A pointer to the label of this object + */ + virtual QWidget* leftWidget() { return (QWidget*)_left; } + /** + * This return a pointer to the KURLRequestor of this object + * @return A pointer to the KURLRequestor of this object + */ + virtual QWidget* rightWidget() { return (QWidget*)_right; } + + /** + * This function returns the url as given in the KURLRequestor + * @return The currently selected url + */ + virtual QString value() const; + /** + * Sets the currently selected url + * @param value The url to be set. + */ + virtual void setValue( const QString& ); + +private: + QLabel *_left; + KURLRequester *_right; +}; + +/** + * This is an imput for a combobox. + */ +class ComboInput : public AccountInput +{ +public: + /** + * Constructor + * + * @param parent The parent of the widgets which are created + * @param title The title next to the combo box + * @param list A mapping which maps a value in the configuration to a (translated) entry in the + * combo box. + * @param default The default value of the combo box. + * @param configName The name in which the option is saved. + */ + ComboInput( QWidget *parent, const QString& title, const QMap& list, + const QString& defaul, const QString& configName ); + /** + * Destructor + */ + virtual ~ComboInput(); + + /** + * The left widget (a label with the title on it) + * @return A pointer to the label of this object. + */ + virtual QWidget* leftWidget() { return (QWidget*)_left; } + /** + * The right widget (the combo box itselfs) + * @return A pointer to the combo box of this object + */ + virtual QWidget* rightWidget() { return (QWidget*)_right; } + + /** + * Return the value of the currently selected item + * @return The value of the currently selected item + */ + virtual QString value() const; + + /** + * This function sets the combo box to an item which has @p value as value. + * + * @param value The value to be searched + */ + virtual void setValue( const QString& value ); +private: + QLabel *_left; + QComboBox *_right; + QMap< QString, QString > *_list; + +}; + +/** + * This is an object for creating a text-box. + * If has no left widget, as the title is stored in the checkbox itselfs. + */ +class CheckboxInput : public AccountInput +{ +public: + /** + * Constructor + * + * @param parent The parent for the objects which are created + * @param title The title of the checkbox + * @param defaul The default value ("true" for checked, "false" otherwise") + * @param configName The name of the configuration entry of this object + */ + CheckboxInput( QWidget *parent, const QString& title, const QString& defaul, const QString& configName ); + /** + * Destructor + */ + virtual ~CheckboxInput(); + + /** + * Return a 0-pointer as this object doesn't have a left widget. + * + * @return 0 + */ + virtual QWidget* leftWidget() { return 0; } + /** + * This function returns the checkbox. + * @return A pointer to the checkbox. + */ + virtual QWidget* rightWidget() { return (QWidget*)_right; } + + /** + * This gives the value of the checkbox: "true" if checked, "false" otherwise. + * + * @return "true" if the checkbox is checked, "false" otherwise. + */ + virtual QString value() const; + /** + * This function can change the state of the checkbox. + * It can check or uncheck it. + * + * @param value If this parameter is "true", the checkbox gets checked, + * if it is "false", the checkbox get unchecked. + */ + virtual void setValue( const QString& value ); + +private: + QCheckBox *_right; +}; + +#endif + diff --git a/korn/accountmanager.cpp b/korn/accountmanager.cpp new file mode 100644 index 00000000..d8c482e4 --- /dev/null +++ b/korn/accountmanager.cpp @@ -0,0 +1,268 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "accountmanager.h" + +#include "dcopdrop.h" +#include "kio.h" +#include "maildrop.h" +#include "password.h" +#include "protocol.h" +#include "protocols.h" +#include "subjectsdlg.h" + +#include +#include +#include + +#include + +KornSubjectsDlg* AccountManager::_subjectsDlg = 0; + +AccountManager::AccountManager( QObject * parent, const char * name ) + : QObject( parent, name ), + _kioList( new QPtrList< KMailDrop > ), + _dcopList( new QPtrList< DCOPDrop > ), + _dropInfo( new QMap< KMailDrop*, Dropinfo* > ) +{ + _kioList->setAutoDelete( true ); + _dcopList->setAutoDelete( true ); +} + +AccountManager::~AccountManager() +{ + delete _kioList; + delete _dcopList; + delete _dropInfo; +} + +void AccountManager::readConfig( KConfig* config, const int index ) +{ + KConfigGroup *masterGroup = new KConfigGroup( config, QString( "korn-%1" ).arg( index ) ); + QStringList dcop = masterGroup->readListEntry( "dcop", ',' ); + KConfigGroup *accountGroup; + int counter = 0; + + while( config->hasGroup( QString( "korn-%1-%2" ).arg( index ).arg( counter ) ) ) + { + accountGroup = new KConfigGroup( config, QString( "korn-%1-%2" ).arg( index ).arg( counter ) ); + + const Protocol *proto = Protocols::getProto( accountGroup->readEntry( "protocol" ) ); + if( !proto ) + { + kdWarning() << "Protocol werd niet gevonden" << endl; + ++counter; + continue; + } + QMap< QString, QString > *configmap = proto->createConfig( accountGroup, + KOrnPassword::readKOrnPassword( index, counter, *accountGroup ) ); + KMailDrop *kiodrop = proto->createMaildrop( accountGroup ); + const Protocol *nproto = proto->getProtocol( accountGroup ); + Dropinfo *info = new Dropinfo; + + if( !kiodrop || !configmap || !nproto ) + { + //Error occured when reading for config + ++counter; + delete info; + continue; + } + + //TODO: connect some stuff + connect( kiodrop, SIGNAL( changed( int, KMailDrop* ) ), this, SLOT( slotChanged( int, KMailDrop* ) ) ); + connect( kiodrop, SIGNAL( showPassivePopup( QPtrList< KornMailSubject >*, int, bool, const QString& ) ), + this, SLOT( slotShowPassivePopup( QPtrList< KornMailSubject >*, int, bool, const QString& ) ) ); + connect( kiodrop, SIGNAL( showPassivePopup( const QString&, const QString& ) ), + this, SLOT( slotShowPassivePopup( const QString&, const QString& ) ) ); + connect( kiodrop, SIGNAL( validChanged( bool ) ), this, SLOT( slotValidChanged( bool ) ) ); + + kiodrop->readGeneralConfigGroup( *masterGroup ); + if( !kiodrop->readConfigGroup( *accountGroup ) || !kiodrop->readConfigGroup( *configmap, nproto ) ) + { + ++counter; + delete info; + continue; + } + + kiodrop->startMonitor(); + + _kioList->append( kiodrop ); + + info->index = counter; + info->reset = accountGroup->readNumEntry( "reset", 0 ); + info->msgnr = info->reset; + info->newMessages = false; + + _dropInfo->insert( kiodrop, info ); + + ++counter; + } + + QStringList::Iterator it; + for( it = dcop.begin(); it != dcop.end(); ++it ) + { + DCOPDrop *dcopdrop = new DCOPDrop; + Dropinfo *info = new Dropinfo; + + connect( dcopdrop, SIGNAL( changed( int, KMailDrop* ) ), this, SLOT( slotChanged( int, KMailDrop* ) ) ); + connect( dcopdrop, SIGNAL( showPassivePopup( QPtrList< KornMailSubject >*, int, bool, const QString& ) ), + this, SLOT( slotShowPassivePopup( QPtrList< KornMailSubject >*, int, bool, const QString& ) ) ); + + dcopdrop->readConfigGroup( *masterGroup ); + dcopdrop->setDCOPName( *it ); + + _dcopList->append( dcopdrop ); + + info->index = 0; + info->reset = 0; + info->msgnr = 0; + info->newMessages = false; + + _dropInfo->insert( dcopdrop, info ); + } + + setCount( totalMessages(), hasNewMessages() ); +} + +void AccountManager::writeConfig( KConfig* config, const int index ) +{ + QMap< KMailDrop*, Dropinfo* >::Iterator it; + for( it = _dropInfo->begin(); it != _dropInfo->end(); ++it ) + { + config->setGroup( QString( "korn-%1-%2" ).arg( index ).arg( it.data()->index ) ); + config->writeEntry( "reset", it.data()->reset ); + } +} + +QString AccountManager::getTooltip() const +{ + QStringList result; + QMap< KMailDrop*, Dropinfo* >::Iterator it; + for( it = _dropInfo->begin(); it != _dropInfo->end(); ++it ) + if( it.key()->valid() ) + result.append( QString( "%1: %2" ).arg( it.key()->realName() ).arg( it.data()->msgnr - it.data()->reset )); + else + result.append( QString( "%1: invalid" ).arg( it.key()->realName() ) ); + result.sort(); + return result.join( QChar( '\n' ) ); +} + +void AccountManager::doRecheck() +{ + KMailDrop *item; + for( item = _kioList->first(); item; item = _kioList->next() ) + item->forceRecheck(); +} + +void AccountManager::doReset() +{ + QMap< KMailDrop*, Dropinfo* >::Iterator it; + for( it = _dropInfo->begin(); it != _dropInfo->end(); ++it ) + { + it.data()->reset = it.data()->msgnr; + it.data()->newMessages = false; + } + + setCount( 0, false ); +} + +void AccountManager::doView() +{ + QMap< KMailDrop*, Dropinfo* >::Iterator it; + + if( !_subjectsDlg ) + _subjectsDlg = new KornSubjectsDlg(); + + _subjectsDlg->clear(); + + for( it = _dropInfo->begin(); it != _dropInfo->end(); ++it ) + _subjectsDlg->addMailBox( it.key() ); + + _subjectsDlg->loadMessages(); +} + +void AccountManager::doStartTimer() +{ + KMailDrop *item; + + for( item = _kioList->first(); item; item = _kioList->next() ) + item->startMonitor(); +} + +void AccountManager::doStopTimer() +{ + KMailDrop *item; + + for( item = _kioList->first(); item; item = _kioList->next() ) + item->stopMonitor(); +} + +int AccountManager::totalMessages() +{ + int result = 0; + + QMap< KMailDrop*, Dropinfo* >::Iterator it; + for( it = _dropInfo->begin(); it != _dropInfo->end(); ++it ) + //if( it.date()->msgnr - it.date()->reset > 0 ) + result += it.data()->msgnr - it.data()->reset; + + return result; +} + +bool AccountManager::hasNewMessages() +{ + QMap< KMailDrop*, Dropinfo* >::Iterator it; + for( it = _dropInfo->begin(); it != _dropInfo->end(); ++it ) + if( it.data()->newMessages ) + return true; + + return false; +} + +void AccountManager::playSound( const QString& file ) +{ + KAudioPlayer::play( file ); +} + +void AccountManager::slotChanged( int count, KMailDrop* mailDrop ) +{ + Dropinfo *info = _dropInfo->find( mailDrop ).data(); + info->newMessages = count > info->msgnr || ( count == info->msgnr && info->newMessages ); + + if( count > info->msgnr ) + { + if( !mailDrop->soundFile().isEmpty() ) + playSound( mailDrop->soundFile() ); + if( !mailDrop->newMailCmd().isEmpty() ) + runCommand( mailDrop->newMailCmd() ); + } + + info->msgnr = count; + if( info->msgnr - info->reset < 0 ) + info->reset = 0; + + setCount( totalMessages(), hasNewMessages() && totalMessages() > 0 ); + setTooltip( getTooltip() ); +} + +void AccountManager::slotValidChanged( bool ) +{ + setTooltip( getTooltip() ); +} + +#include "accountmanager.moc" diff --git a/korn/accountmanager.h b/korn/accountmanager.h new file mode 100644 index 00000000..958e5b57 --- /dev/null +++ b/korn/accountmanager.h @@ -0,0 +1,155 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_ACCOUNTMANAGER_H +#define MK_ACCOUNTMANAGER_H + +#include + +class DCOPDrop; +class KornSubjectsDlg; +class KKioDrop; +class KMailDrop; + +class KConfig; + +template< class T > class QPtrList; +template< class T, class W > class QMap; + + +/** + * This class manage the different accounts. + * + * This class reads the config and makes the accounts, + * and it communicate with the boxes. + */ +class AccountManager : public QObject +{ Q_OBJECT +public: + /** + * Constructor, parameters are directed to QObject. + */ + AccountManager( QObject * parent = 0, const char * name = 0 ); + + /** + * Destructor + */ + ~AccountManager(); + + /** + * This function is used to read the config. + * + * @param config The KConfig instance to the configuration + * @param index The index of the box. As there are different boxes, + * every box have it's own index. This number is used to get the + * right config-information out of the config parameter. + */ + virtual void readConfig( KConfig* config, const int index ); + + /** + * This write the configuration into a file. Things that must be right is + * for example the reset number. The configuration isn't saved through this + * method; configurations are saved in the configurations classes. + * + * @param config The KConfig instance to which the configuration is written. + * @param index The index of the box. + */ + virtual void writeConfig( KConfig* config, const int index ); + + /** + * This method makes a QString which can be used for a tooltip. + * In it, all accounts are summed and the number of new messages of + * every account is added. + * + * @return A string that can be used for the Tooltip of the box. + */ + QString getTooltip() const; +protected: + /** + * This function is called when the number of emails has changed. + * Boxes must override this method and update the information. + * + * @param numberOfNewMessages The number of unread messages. + * @param newMessages Are there any new messages (important for displaying it)? + */ + virtual void setCount( int numberOfNewMessages, bool newMessages ) = 0; + + /** + * This functions sets a new Tooltip. Boxes must override this method + * @param tooltip The tooltip to be set. + */ + virtual void setTooltip( const QString& tooltip ) = 0; + + /** + * This funtion is called if @p command have to be executed. + * For example, if new email has arrived, and the user setuped KOrn + * to execute a command. Boxes must override this function. + */ + virtual void runCommand( const QString& command ) = 0; + + /** + * This function can be called by classes that inherit this class. + * If this function is called, all account which are part of this + * box are rechecked. + */ + void doRecheck(); + + /** + * If this method is called, the number of new messages of all of its account + * is resetted. + */ + void doReset(); + + /** + * If this function is called, a windows with shows the message headers will popup. + */ + void doView(); + + /** + * These functions are called if the user wants to start or stop the account being triggered. + */ + void doStartTimer(); + void doStopTimer(); + +private: + struct Dropinfo + { + int index; + int msgnr; + bool newMessages; + int reset; + }; + + QPtrList< KMailDrop > *_kioList; + QPtrList< DCOPDrop > *_dcopList; + + QMap< KMailDrop*, Dropinfo* > *_dropInfo; + + static KornSubjectsDlg *_subjectsDlg; + +private: + int totalMessages(); + bool hasNewMessages(); + void playSound( const QString& ); +private slots: + void slotChanged( int, KMailDrop* ); + void slotValidChanged( bool ); +}; + +#endif //MK_ACCOUNTMANAGER_H + diff --git a/korn/boxcontainer.cpp b/korn/boxcontainer.cpp new file mode 100644 index 00000000..e245004c --- /dev/null +++ b/korn/boxcontainer.cpp @@ -0,0 +1,83 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "boxcontainer.h" +#include "boxcontaineritem.h" + +#include +#include + +#include + +BoxContainer::BoxContainer( QObject * parent, const char * name ) + : QObject( parent, name ), + _items( new QPtrList< BoxContainerItem > ) +{ + _items->setAutoDelete( true ); +} + +BoxContainer::~BoxContainer() +{ + delete _items; +} + +void BoxContainer::readConfig( KConfig* config ) +{ + int counter = 0; + while( config->hasGroup( QString( "korn-%1" ).arg( counter ) ) ) + { + config->setGroup( QString( "korn-%1" ).arg( counter ) ); + BoxContainerItem *item = newBoxInstance(); + item->readConfig( config, counter ); + addItem( item ); + ++counter; + } +} + +void BoxContainer::writeConfig( KConfig *config ) +{ + int index = 0; + + BoxContainerItem *item; + for ( item = _items->first(); item; item = _items->next() ) + { + item->writeConfig( config, index ); + ++index; + } + +} + +void BoxContainer::showBox() +{ + BoxContainerItem *item; + for( item = _items->first(); item; item = _items->next() ) + item->showBox(); +} + +void BoxContainer::slotShowConfiguration() +{ + emit showConfiguration(); +} + +void BoxContainer::addItem( BoxContainerItem* item ) +{ + connect( item, SIGNAL( showConfiguration() ), this, SLOT( slotShowConfiguration() ) ); + _items->append( item ); +} + +#include "boxcontainer.moc" diff --git a/korn/boxcontainer.h b/korn/boxcontainer.h new file mode 100644 index 00000000..800fab78 --- /dev/null +++ b/korn/boxcontainer.h @@ -0,0 +1,103 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_BOXCONTAINER_H +#define MK_BOXCONTAINER_H + +#include + +class BoxContainerItem; + +template< class T > class QPtrList; + +class KConfig; + +/** + * This class is the base for all BoxContainers. A BoxContainer is a place + * where BoxContainerItems can be placed. BoxContainerItems are the boxes you see. + */ +class BoxContainer : public QObject +{ Q_OBJECT +public: + /** + * Constructor: everything is passed to QObject. + * + * @param parent The parent of this object + * @param name The name of this object + */ + BoxContainer( QObject *parent = 0, const char * name = 0 ); + /** + * Destructor + */ + ~BoxContainer(); + + /** + * This method reads the config from a certain KConfig instance. + * + * @param config The KConfig-instance to read the config from. + */ + void readConfig( KConfig* config ); + + /** + * This method writes the config to a certain KConfig instance. + * + * @param config The KConfig-instance to write the config to. + */ + void writeConfig( KConfig *config ); + + /** + * Shows all childs and itself + */ + virtual void showBox(); +public slots: + /** + * This slot is triggered if the configuration window has to be shown. + * This call is passed through. + */ + void slotShowConfiguration(); + +protected: + /** + * This methos adds a child to the list. + * + * @param item The item to be added. + */ + virtual void addItem( BoxContainerItem* item ); + + /** + * This method creates a new BoxContainerItem instance of the same + * type as the BoxContainer. + * + * @return A new instance to a BoxContainerItem of the same type. + */ + virtual BoxContainerItem* newBoxInstance() const = 0; + + /** + * The list of BoxContainerItems. + */ + QPtrList< BoxContainerItem > *_items; + +signals: + /** + * This signal is used to pass the slotShowConfiguration call through + */ + void showConfiguration(); +}; + +#endif //MK_BOXCONTAINER_H + diff --git a/korn/boxcontaineritem.cpp b/korn/boxcontaineritem.cpp new file mode 100644 index 00000000..fec7ab41 --- /dev/null +++ b/korn/boxcontaineritem.cpp @@ -0,0 +1,443 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "boxcontaineritem.h" + +#include "mailsubject.h" + +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + +BoxContainerItem::BoxContainerItem( QObject * parent, const char * name ) + : AccountManager( parent, name ), + DCOPObject(), + _command( new QString ) +{ + short i; + + for( i = 0; i < 2; ++i ) + { + _icons[ i ] = 0; + _anims[ i ] = 0; + _fgColour[ i ] = 0; + _bgColour[ i ] = 0; + _fonts[ i ] = 0; + } + + for( i = 0; i < 3; ++i ) + { + _recheckSettings[ i ] = false; + _resetSettings[ i ] = false; + _viewSettings[ i ] = false; + _runSettings[ i ] = false; + _popupSettings[ i ] = false; + } +} + +BoxContainerItem::~BoxContainerItem() +{ + delete _command; +} + +void BoxContainerItem::readConfig( KConfig* config, const int index ) +{ + //Read information about how the thing have to look like + config->setGroup( QString( "korn-%1" ).arg( index ) ); + if( config->readBoolEntry( "hasnormalicon", false ) ) + _icons[ 0 ] = new QString( config->readEntry( "normalicon", "" ) ); + else + _icons[ 0 ] = 0; + if( config->readBoolEntry( "hasnewicon", false ) ) + _icons[ 1 ] = new QString( config->readEntry( "newicon", "" ) ); + else + _icons[ 1 ] = 0; + + if( config->readBoolEntry( "hasnormalanim", false ) ) + _anims[ 0 ] = new QString( config->readEntry( "normalanim", "" ) ); + else + _anims[ 0 ] = 0; + if( config->readBoolEntry( "hasnewanim", false ) ) + _anims[ 1 ] = new QString( config->readEntry( "newanim", "" ) ); + else + _anims[ 1 ] = 0; + + if( config->readBoolEntry( "hasnormalfgcolour", false ) ) + _fgColour[ 0 ] = new QColor( config->readColorEntry( "normalfgcolour" ) ); + else + _fgColour[ 0 ] = 0; + if( config->readBoolEntry( "hasnewfgcolour", false ) ) + _fgColour[ 1 ] = new QColor( config->readColorEntry( "newfgcolour" ) ); + else + _fgColour[ 1 ] = 0; + + if( config->readBoolEntry( "hasnormalbgcolour", false ) ) + _bgColour[ 0 ] = new QColor( config->readColorEntry( "normalbgcolour" ) ); + else + _bgColour[ 0 ] = 0; + if( config->readBoolEntry( "hasnewbgcolour", false ) ) + _bgColour[ 1 ] = new QColor( config->readColorEntry( "newbgcolour" ) ); + else + _bgColour[ 1 ] = 0; + if( config->readBoolEntry( "hasnormalfont", false ) ) + _fonts[ 0 ] = new QFont( config->readFontEntry( "normalfont" ) ); + else + _fonts[ 0 ] = 0; + if( config->readBoolEntry( "hasnewfont", false ) ) + _fonts[ 1 ] = new QFont( config->readFontEntry( "newfont" ) ); + else + _fonts[ 1 ] = 0; + + //Read information about the mappings. + _recheckSettings[ 0 ] = config->readBoolEntry( "leftrecheck", true ); + _recheckSettings[ 1 ] = config->readBoolEntry( "middlerecheck", false ); + _recheckSettings[ 2 ] = config->readBoolEntry( "rightrecheck", false ); + + _resetSettings[ 0 ] = config->readBoolEntry( "leftreset", false ); + _resetSettings[ 1 ] = config->readBoolEntry( "middlereset", false ); + _resetSettings[ 2 ] = config->readBoolEntry( "rightreset", false ); + + _viewSettings[ 0 ] = config->readBoolEntry( "leftview", false ); + _viewSettings[ 1 ] = config->readBoolEntry( "middleview", false ); + _viewSettings[ 2 ] = config->readBoolEntry( "rightview", false ); + + _runSettings[ 0 ] = config->readBoolEntry( "leftrun", false ); + _runSettings[ 1 ] = config->readBoolEntry( "middlerun", false ); + _runSettings[ 2 ] = config->readBoolEntry( "rightrun", false ); + + _popupSettings[ 0 ] = config->readBoolEntry( "leftpopup", false ); + _popupSettings[ 1 ] = config->readBoolEntry( "middlepopup", false ); + _popupSettings[ 2 ] = config->readBoolEntry( "rightpopup", true ); + + //Read the command + *_command = config->readEntry( "command", "" ); + + //Sets the object ID for the DCOP-object + this->setObjId( config->readEntry( "name", "" ).utf8() ); + + //Read the settings of the reimplemented class. + //It is important to read this after the box-settings, because the + //setCount-function is called in AccountManager::readConfig + AccountManager::readConfig( config, index ); +} + +void BoxContainerItem::runCommand( const QString& cmd ) +{ + KProcess *process = new KProcess; + process->setUseShell( true ); + *process << cmd; + connect( process, SIGNAL( processExited (KProcess *) ), this, SLOT( processExited( KProcess * ) ) ); + process->start(); +} + +void BoxContainerItem::mouseButtonPressed( Qt::ButtonState state ) +{ + int button; + if( state & Qt::LeftButton ) + button = 0; + else if( state & Qt::RightButton ) + button = 2; + else if( state & Qt::MidButton ) + button = 1; + else + return; //Invalid mouse button + + if( _recheckSettings[ button ] ) + doRecheck(); + if( _resetSettings[ button ] ) + doReset(); + if( _viewSettings[ button ] ) + doView(); + if( _runSettings[ button ] ) + runCommand(); + if( _popupSettings[ button ] ) + doPopup(); +} + +void BoxContainerItem::fillKPopupMenu( KPopupMenu* popupMenu, KActionCollection* actions ) const +{ + /*popupMenu->insertItem( i18n( "&Configure" ), this, SLOT( slotConfigure() ) ); + popupMenu->insertItem( i18n( "&Recheck" ), this, SLOT( slotRecheck() ) ); + popupMenu->insertItem( i18n( "R&eset Counter" ), this, SLOT( slotReset() ) ); + popupMenu->insertItem( i18n( "&View Emails" ), this, SLOT( slotView() ) ); + popupMenu->insertItem( i18n( "R&un Command" ), this, SLOT( slotRunCommand() ) );*/ + + (new KAction( i18n("&Configure"), KShortcut(), this, SLOT( slotConfigure() ), actions ))->plug( popupMenu ); + (new KAction( i18n("&Recheck"), KShortcut(), this, SLOT( slotRecheck() ), actions ))->plug( popupMenu ); + (new KAction( i18n("R&eset Counter"), KShortcut(), this, SLOT( slotReset() ), actions ))->plug( popupMenu ); + (new KAction( i18n("&View Emails"), KShortcut(), this, SLOT( slotView() ), actions ))->plug( popupMenu ); + (new KAction( i18n("R&un Command"), KShortcut(), this, SLOT( slotRunCommand() ), actions ))->plug( popupMenu ); + popupMenu->insertSeparator(); + KStdAction::help( this, SLOT( help() ), actions )->plug( popupMenu ); + KStdAction::reportBug( this, SLOT( reportBug() ), actions )->plug( popupMenu ); + KStdAction::aboutApp( this, SLOT( about() ), actions )->plug( popupMenu ); +} + +void BoxContainerItem::showPassivePopup( QWidget* parent, QPtrList< KornMailSubject >* list, int total, + const QString &accountName, bool date ) +{ + KPassivePopup *popup = new KPassivePopup( parent, "Passive popup" ); + + QVBox *mainvlayout = popup->standardView( i18n( "KOrn - %1/%2 (total: %3)" ).arg( objId() ).arg( accountName ) + .arg( total ), "", QPixmap(), 0 ); + QGrid *mainglayout = new QGrid( date ? 3 : 2 ,mainvlayout, "Grid-Layout" ); + + QLabel *title = new QLabel( i18n("From"), mainglayout, "from_label" ); + QFont font = title->font(); + font.setBold( true ); + title->setFont( font ); + + title = new QLabel( i18n("Subject"), mainglayout, "subject_label" ); + font = title->font(); + font.setBold( true ); + title->setFont( font ); + + if( date ) + { + title = new QLabel( i18n("Date"), mainglayout, "date_label" ); + font = title->font(); + font.setBold( true ); + title->setFont( font ); + } + + for( KornMailSubject* subject = list->first(); subject; subject = list->next() ) + { + new QLabel( subject->getSender(), mainglayout, "from-value" ); + new QLabel( subject->getSubject(), mainglayout, "subject-value" ); + if( date ) + { + QDateTime tijd; + tijd.setTime_t( subject->getDate() ); + new QLabel( tijd.toString(), mainglayout, "date-value" ); + } + } + + popup->setAutoDelete( true ); //Now, now care for deleting these pointers. + + popup->setView( mainvlayout ); + + popup->show(); //Display it +} + +void BoxContainerItem::drawLabel( QLabel *label, const int count, const bool newMessages ) +{ + //This would fail if bool have fome other values. + short index = newMessages ? 1 : 0; + + bool hasAnim = _anims[ index ] && !_anims[ index ]->isEmpty(); + bool hasIcon = _icons[ index ] && !_icons[ index ]->isEmpty(); + bool hasBg = _bgColour[ index ] && _bgColour[ index ]->isValid(); + bool hasFg = _fgColour[ index ] && _fgColour[ index ]->isValid(); + + QPixmap pixmap; + + label->setText( "" ); + //QToolTip::add( label, this->getTooltip() ); + + if( hasAnim ) + { //An animation can't have a foreground-colour and can't have a icon. + setAnimIcon( label, *_anims[ index ] ); + + hasFg = false; + hasIcon = false; + } + + if( hasIcon ) + pixmap = KGlobal::iconLoader()->loadIcon( *_icons[ index ], KIcon::Desktop, KIcon::SizeSmallMedium ); + + if( hasIcon && hasFg ) + { + if( hasBg ) + { + label->setPixmap( calcComplexPixmap( pixmap, *_fgColour[ index ], _fonts[ index ], count ) ); + label->setBackgroundMode( Qt::FixedColor ); + label->setPaletteBackgroundColor( *_bgColour[ index ] ); + } else + { + label->setPixmap( calcComplexPixmap( pixmap, *_fgColour[ index ], _fonts[ index ], count ) ); + } + return; + } + + if( hasBg ) + { + label->setBackgroundMode( Qt::FixedColor ); + label->setPaletteBackgroundColor( *_bgColour[ index ] ); + } else + { + label->setBackgroundMode( Qt::X11ParentRelative ); + } + + if( hasIcon ) + { + label->setPixmap( pixmap ); + } + + if( hasFg ) + { + if( _fonts[ index ] ) + label->setFont( *_fonts[ index ] ); + label->setPaletteForegroundColor( *_fgColour[ index ] ); + label->setAlignment( Qt::AlignHCenter | Qt::AlignVCenter ); + label->setText( QString::number( count ) ); + } + + if( hasFg || hasBg || hasIcon || hasAnim ) + label->show(); + else + label->hide(); +} + +//This function makes a pixmap which is based on icon, but has a number painted on it. +QPixmap BoxContainerItem::calcComplexPixmap( const QPixmap &icon, const QColor& fgColour, const QFont* font, const int count ) +{ + QPixmap result( icon ); + QPixmap numberPixmap( icon.size() ); + QImage iconImage( icon.convertToImage() ); + QImage numberImage; + QRgb *rgbline; + QPainter p; + + //Make a transparent number; first make a white number on a black background. + //This pixmap also is the base alpha-channel, the foreground colour is added later. + numberPixmap.fill( Qt::black ); + p.begin( &numberPixmap, false ); + p.setPen( Qt::white ); + if( font ) + p.setFont( *font ); + p.drawText( icon.rect(), Qt::AlignCenter, QString::number( count ) ); + p.end(); + + //Convert to image and add the alpha channel. + numberImage = numberPixmap.convertToImage(); + if( numberImage.depth() != 32 ) //Make sure depth is 32 (and thus can have an alpha channel) + numberImage = numberImage.convertDepth( 32 ); + numberImage.setAlphaBuffer( true ); //Enable alpha channel + for( int xx = 0; xx < numberImage.height(); ++xx ) + { + rgbline = (QRgb*)numberImage.scanLine( xx ); + + for( int yy = 0; yy < numberImage.width(); ++yy ) + { + //Set colour and alpha channel + rgbline[ yy ] = qRgba( fgColour.red(), fgColour.green(), fgColour.blue(), qRed( rgbline[ yy ] ) ); + } + } + + //Merge icon and number and convert to result. + KIconEffect::overlay( iconImage, numberImage ); + result.convertFromImage( iconImage ); + + return result; +} + +void BoxContainerItem::setAnimIcon( QLabel* label, const QString& anim ) +{ + label->setAlignment( Qt::AlignHCenter | Qt::AlignVCenter ); + label->setMovie( QMovie( anim ) ); + label->show(); +} + +void BoxContainerItem::recheck() +{ + doRecheck(); +} + +void BoxContainerItem::reset() +{ + doReset(); +} + +void BoxContainerItem::view() +{ + doView(); +} + +void BoxContainerItem::runCommand()//Possible_unsafe? +{ + if( _command->isEmpty() ) + return; //Don't execute an empty command + runCommand( *_command ); +} + +void BoxContainerItem::help() +{ + kapp->invokeHelp(); +} + +void BoxContainerItem::reportBug() +{ + KBugReport bug( 0, true ); + bug.exec(); //modal: it doesn't recheck anymore +} + +void BoxContainerItem::about() +{ + KAboutApplication about( 0, "KOrn About", true ); + about.exec(); //modal: it doesn't recheck anymore +} + +void BoxContainerItem::popup() +{ + doPopup(); +} + +void BoxContainerItem::showConfig() +{ + emit showConfiguration(); +} + +void BoxContainerItem::startTimer() +{ + doStartTimer(); +} + +void BoxContainerItem::stopTimer() +{ + doStopTimer(); +} + +void BoxContainerItem::processExited( KProcess* proc ) +{ + delete proc; +} + +#include "boxcontaineritem.moc" diff --git a/korn/boxcontaineritem.h b/korn/boxcontaineritem.h new file mode 100644 index 00000000..46f85da5 --- /dev/null +++ b/korn/boxcontaineritem.h @@ -0,0 +1,236 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_BOXCONTAINERITEM_H +#define MK_BOXCONTAINERITEM_H + +#include "accountmanager.h" +#include + +class KornMailSubject; + +class KActionCollection; +class KConfig; +class KPopupMenu; +class KProcess; + +class QColor; +class QLabel; +//template< class T > class QPtrList; +class QString; + +/** + * This class provide a base for an item. This item should be + * shown in a BoxContainer, and represent one number somewhere. + * This also is the DCOP-interface for such a box. + * @author Mart Kelder + */ +class BoxContainerItem : public AccountManager, public DCOPObject +{ Q_OBJECT + K_DCOP +public: + /** + * Standaard QObject-constuctor + * This constructor implements the default arguments for any QObject. + * Note that is does not give a name to DCOPObject; that name + * is set in the readConfig-function. + * @param parent The parent of this object, See Object::QObject + * @param name The name of this object, See QObject::QObject + * @see BoxContainerItem::readConfig + */ + BoxContainerItem( QObject * parent = 0, const char * name = 0 ); + + /** + * The default destructor. This only removes _command-pointer. + */ + ~BoxContainerItem(); + + /** + * If this function should call a "show"-function of its widget. + */ + virtual void showBox() = 0; + + /** + * This function reads the config. It stores the readed values in the class. + * It also sets the DCOPObject-name. + * @param config The KConfigGroup-object which contains the configuration of this box. + * @param index The index of the box used in the config-file + */ + virtual void readConfig( KConfig* config, const int index ); + +public slots: + /** + * This functions sets the number to be displayed. It should be reimplemented. + * @param count The number of new messages waiting + * @param newMessages Are there any new messages added? + */ + virtual void setCount( const int count, const bool newMessages ) = 0; + + /** + * This functions execute a given command + * + * @param cmd The command to be executed. + */ + virtual void runCommand( const QString& cmd ); + + /** + * This function displays the (kde) help dialog + */ + void help(); + /** + * This function calls a bug report dialog + */ + void reportBug(); + /** + * This function calls the about dialog + */ + void about(); + + /** + * This functions should be called if a mouse-button has been pressed. + * This handles the connected events of it. + * + * @param button The button that was pressed, See Qt::ButtonState + */ + void mouseButtonPressed( Qt::ButtonState button ); +protected: + /** + * This function filles a KPopupMenu-reference. The target is + * to set in all implementations the same KPopupMenu-content. + * Because some implementations (DockedItem) got a KPopupMenu + * by itself, this only changes a KPopupMenu instance. + * @param menu The menu to be changed. + * @param actions The actions to which the items should be added. + */ + void fillKPopupMenu( KPopupMenu* menu, KActionCollection* actions ) const; + + /** + * This displays the passive popup. + * + * @param parent The Winget of the visual widget + * @param list List with the first (five) subjects + * @param total The total numbers of unread mail + * @param accountName The name of the account it belongs to + * @param date Should the date be displayed? + */ + void showPassivePopup( QWidget* parent, QPtrList< KornMailSubject >* list, int total, const QString& accountName, bool date ); + + //this functions should be reimplemented + /** + * This function is called when the implementation of the class + * should display the popup-menu. + */ + virtual void doPopup() = 0; + + /** + * This function draws a specified configuration into a label + * @param label The label to be filled + * @param count the number of new messages + * @param newMessages are the messages new? + */ + void drawLabel( QLabel *label, const int count, const bool newMessages ); + +private: + /** + * This function helps to make a pixmap + * @param icon The icon to be set in + * @param fgColour the colour of the foreground + * @param font the font; 0 is default font. + * @param count the number of messages + */ + static QPixmap calcComplexPixmap( const QPixmap &icon, const QColor& fgColour, const QFont* font, const int count ); + + /** + * This functions sets a movie to a specified label + * @param label The label to set the movie in + * @param anim The path to the animation + */ + void setAnimIcon( QLabel* label, const QString& anim ); + +private slots: + void slotRecheck() { recheck(); } + void slotReset() { reset(); } + void slotView() { view(); } + void slotRunCommand() { runCommand(); } + void slotPopup() { popup(); } + void slotConfigure() { showConfig(); } +public: +k_dcop: + /** + * This call immediately checked all accounts of this box. + */ + void recheck(); + /** + * This call reset the number of unread messages to 0. + */ + void reset(); + /** + * This call popup's a window with the headers of the new messages. + */ + void view(); + /** + * This program executes the command as setup'ed. + */ + void runCommand(); //Possible_unsafe? + /** + * This function lets the popup-menu's be displayed. + */ + void popup(); + + /** + * This function lets the user edit the configuration + */ + void showConfig(); + + /** + * With these DCOP-calls, a user can start and stop the accounts. + */ + void startTimer(); + void stopTimer(); +signals: + /** + * This signal is emitted when the user whants to configure something. + */ + void showConfiguration(); + + +private slots: + /** + * This slot is called when a KProcess-instance needs to be deleted:) + * @param proc The instance of the instance which must be deleted. + */ + void processExited( KProcess* proc ); + +protected: + //This settings are stored here because every implementation needs them. + QString *_icons[ 2 ]; + QString *_anims[ 2 ]; + QColor *_fgColour[ 2 ]; + QColor *_bgColour[ 2 ]; + QFont *_fonts[ 2 ]; + +private: + QString *_command; + bool _recheckSettings[ 3 ]; + bool _resetSettings[ 3 ]; + bool _viewSettings[ 3 ]; + bool _runSettings[ 3 ]; + bool _popupSettings[ 3 ]; +}; + +#endif //MK_BOXCONTAINERITEM_H diff --git a/korn/dcop_proto.cpp b/korn/dcop_proto.cpp new file mode 100644 index 00000000..a5896b8f --- /dev/null +++ b/korn/dcop_proto.cpp @@ -0,0 +1,62 @@ +/* + * Copyright (C) 2005, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + + +#include "dcop_proto.h" + +#include "account_input.h" +#include "dcopdrop.h" + +#include +#include + +#include +#include +#include + +KMailDrop* DCOP_Protocol::createMaildrop( KConfigGroup* ) const +{ + return new DCOPDrop(); +} + +QMap< QString, QString > * DCOP_Protocol::createConfig( KConfigGroup* config, const QString& ) const +{ + QMap< QString, QString > *result = new QMap< QString, QString >; + + result->insert( "dcopname", config->readEntry( "dcopname", "korn_dcop" ) ); + + return result; +} + +void DCOP_Protocol::configFillGroupBoxes( QStringList* groupBoxes ) const +{ + groupBoxes->append( "DCOP" ); +} + +void DCOP_Protocol::configFields( QPtrVector< QWidget >* vector, const QObject*, QPtrList< AccountInput >* result ) const +{ + result->append( new TextInput( (QWidget*)vector->at( 0 ), i18n( "DCOP name" ), TextInput::text, "korn_dcop", "dcopname" ) ); +} + +void DCOP_Protocol::readEntries( QMap< QString, QString >* ) const +{ +} + +void DCOP_Protocol::writeEntries( QMap< QString, QString >* ) const +{ +} diff --git a/korn/dcop_proto.h b/korn/dcop_proto.h new file mode 100644 index 00000000..cb92b8bf --- /dev/null +++ b/korn/dcop_proto.h @@ -0,0 +1,117 @@ +/* +* Copyright (C) 2005, Mart Kelder (mart.kde@hccnet.nl) +* +* This program is free software; you can redistribute it and/or modify +* it under the terms of the GNU General Public License as published by +* the Free Software Foundation; either version 2 of the License, or +* (at your option) any later version. +* +* This program is distributed in the hope that it will be useful, +* but WITHOUT ANY WARRANTY; without even the implied warranty of +* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +* GNU General Public License for more details. +* +* You should have received a copy of the GNU General Public License +* along with this program; if not, write to the Free Software +* Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + + +#ifndef DCOP_PROTO_H +#define DCOP_PROTO_H + +#include "protocol.h" + +class AccountInput; +class KConfigGroup; +class KIO_Protocol; +class KMailDrop; +class Protocol; + +class QGroupBox; +class QObject; +class QStringList; +class QWidget; + +template< class T> class QPtrList; +template< class T> class QPtrVector; +template< class T, class S> class QMap; + +#include + +/** + * This class implements a DCOP-protocol. + * DCOP can be used to add messages to a box, or delete created dcop-messages. + * This can be usefull in scripts. + */ +class DCOP_Protocol : public Protocol +{ +public: + /** + * Constructor + */ + DCOP_Protocol() {} + /** + * Destructor + */ + virtual ~DCOP_Protocol() {} + + /** + * This function returns a Protocol pointer given a configuration. + * This function always returns itselfs, as the configuration never uses another protocol. + */ + virtual const Protocol* getProtocol( KConfigGroup* ) const { return this; } + /** + * This function creates the maildrop used to count dcop-messages. + * @param config The configuration + */ + virtual KMailDrop* createMaildrop( KConfigGroup* config ) const; + /** + * The function converts the information of the configuration file into a mapping. + * + * @param config The configuration instance to be mapped + * @return The keys and values of the configuration in a mapping + */ + virtual QMap< QString, QString > * createConfig( KConfigGroup* config, const QString& passwd ) const; + /** + * This return the name of this protocol. It is always "dcop". + * @return The name of this protocol: "dcop" + */ + virtual QString configName() const { return "dcop"; } + + /** + * This function sets into the list the groupboxes. + * + * @param list A (empty) list, which is filled with the names of group-boxes. + */ + virtual void configFillGroupBoxes( QStringList* list ) const; + /** + * This function filles the configuration field of this protocol. + * It is used to construct the configuration dialog. + * + * @param vector A vector with groupboxes. + * @param obj The pointer to the configDialog to connect signals to. + * @param result A list with AccountInput which is used to reconstruct the configuration. + */ + virtual void configFields( QPtrVector< QWidget >* vector, const QObject* obj, QPtrList< AccountInput >* result ) const; + /** + * This function can edit some configuaration option before reading them. + */ + virtual void readEntries( QMap< QString, QString >* ) const; + /** + * This function can edit some configuaration option before writing them. + */ + virtual void writeEntries( QMap< QString, QString >* ) const; + + //Functions that return a derived class. + //This way, no explicit cast is needed + /** + * This function returns a cast to a KIO_Protocol. Because this isn't a KIO_Protocol, + * it returns 0. + * + * @return 0 + */ + virtual const KIO_Protocol* getKIOProtocol() const { return 0; } +}; + +#endif diff --git a/korn/dcopdrop.cpp b/korn/dcopdrop.cpp new file mode 100644 index 00000000..906f268d --- /dev/null +++ b/korn/dcopdrop.cpp @@ -0,0 +1,201 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "dcopdrop.h" + +#include "dcopdropif.h" +#include "intid.h" +#include "mailid.h" +#include "mailsubject.h" + +#include +#include + +#include +#include +#include +#include + +DCOPDrop::DCOPDrop() + : KMailDrop(), + _isRunning( false ), + _msgList( new QMap< int, KornMailSubject* > ), + _name( new QString( "" ) ), + _counter( 1 ), + _interface( 0 ) +{ +} + +DCOPDrop::~DCOPDrop() +{ + eraseList(); + delete _interface; + delete _msgList; + delete _name; +} + +void DCOPDrop::recheck() +{ + emit changed( _msgList->count(), this ); + emit rechecked(); +} + +bool DCOPDrop::startMonitor() +{ + _isRunning = true; + return true; +} + +bool DCOPDrop::stopMonitor() +{ + _isRunning = false; + return true; +} + +bool DCOPDrop::readConfigGroup( const KConfigGroup &cfg ) +{ + return KMailDrop::readConfigGroup( cfg ); +} + +bool DCOPDrop::readConfigGroup( const QMap< QString, QString > &map, const Protocol * ) +{ + if( !map.contains( "dcopname" ) ) + //The mapping MUST contain dcopname. + kdDebug() << "mapping is niet compleet" << endl; + + this->setDCOPName( *map.find( "dcopname" ) ); + + return true; +} + +bool DCOPDrop::writeConfigGroup( KConfigBase& cfg ) const +{ + KMailDrop::writeConfigGroup( cfg ); + + KMailDrop::writeConfigGroup( cfg ); + + cfg.writeEntry( "dcopname", *_name ); + return true; +} + +QString DCOPDrop::type() const +{ + return QString( "dcop" ); +} + +QValueVector< KornMailSubject >* DCOPDrop::doReadSubjects( bool * ) +{ + emit readSubjectsTotalSteps( 1 ); + + /* + * This way, the function is really asynchrone. + * So, the return value arraves before any data arrives. + */ + QTimer::singleShot( 1, this, SLOT( doReadSubjectsASync( void ) ) ); + + /* + * A empty QValueVector is made here. + * After that, the size is expanded to the expected number of subjects. + * This way, reallocation of memmory is minimized, and thus more efficient. + */ + QValueVector *vector = new QValueVector( ); + vector->reserve( _msgList->count() ); + return vector; +} + +bool DCOPDrop::deleteMails( QPtrList * ids, bool * ) +{ + emit deleteMailsTotalSteps( 1 ); + + for( const KornMailId *it = ids->first(); it; it = ids->next() ) + { + const KornIntId* id = dynamic_cast< const KornIntId* >( it ); + if( _msgList->contains( id->getId() ) ) + _msgList->erase( id->getId() ); + } + + emit deleteMailsProgress( 1 ); + emit deleteMailsReady( true ); + + return true; +} + +void DCOPDrop::eraseList( void ) +{ + QMap::iterator it; + for( it = _msgList->begin(); it != _msgList->end(); ++it ) + delete it.data(); + _msgList->clear(); +} + +void DCOPDrop::doReadSubjectsASync( void ) +{ + QMap::iterator it; + for( it = _msgList->begin(); it != _msgList->end(); ++it ) + emit readSubject( new KornMailSubject( *it.data() ) ); + emit readSubjectsProgress( 1 ); + emit readSubjectsReady( true ); +} + +int DCOPDrop::addMessage( const QString& subject, const QString& message ) +{ + KornIntId *id = new KornIntId( _counter ); + KornMailSubject *mailsubject = new KornMailSubject( id, this ); + ++_counter; + + mailsubject->setSubject( subject ); + mailsubject->setSender( QString( "DCOP: %1" ).arg( *_name ) ); + mailsubject->setHeader( message, true ); + mailsubject->setSize( message.length() ); + mailsubject->setDate( QDateTime::currentDateTime().toTime_t() ); + + _msgList->insert( id->getId(), mailsubject ); + + emit changed( _msgList->count(), this ); + + return _counter - 1; +} + +bool DCOPDrop::removeMessage( int id ) +{ + if( ! _msgList->contains( id ) ) + return false; + + delete (*_msgList)[ id ]; + _msgList->erase( id ); + + emit changed( _msgList->count(), this ); + + return true; +} + +QString DCOPDrop::DCOPName() const +{ + return *_name; +} + +void DCOPDrop::setDCOPName( const QString& name) +{ + *_name = name; + if( _interface ) + _interface->changeName( name ); + else + _interface = new DCOPDropInterface( this, name.utf8() ); +} + +#include "dcopdrop.moc" diff --git a/korn/dcopdrop.h b/korn/dcopdrop.h new file mode 100644 index 00000000..91bc8f98 --- /dev/null +++ b/korn/dcopdrop.h @@ -0,0 +1,190 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef DCOPDROP_H +#define DCOPDROP_H + +#include "maildrop.h" + +#include + +class DCOPDropInterface; +//class KDropCfgDialog; +class KornMailId; +class KornMailSubject; + +class KConfigBase; + +template class QMap; +class QString; + +/** + * This class implements a KMailDrop for DCOP-objects. + * This class handles all new messages which are comming in through DCOP. + */ +class DCOPDrop : public KMailDrop +{ Q_OBJECT +public: + /** + * Constructor: no parameters + */ + DCOPDrop(); + /** + * Destructor + */ + virtual ~DCOPDrop(); + + /** + * A DCOPDrop cannot produce error messages, so it always returns true. + * + * @return true is the box is valid + */ + virtual bool valid() { return true; } + /** + * This forces the drop to recheck. It is inpossible to recheck dcop, + * so this function does nothing. + */ + virtual void recheck(); + /** + * This function starts the monitor, however, this drop is always running, + * and doesn't need to be started. + * The return value is always true. + * + * @return true + */ + virtual bool startMonitor(); + /** + * This function starts the monitor, however, this drop is always running, + * and doesn't need to be started. + * The return value is always true. + * + * @return true + */ + virtual bool stopMonitor(); + /** + * Return true is the monitor has been started before. + * @return true is it is 'running'. + */ + virtual bool running() { return _isRunning; } + + //virtual void addConfigPage( KDropCfgDialog* ) ; + /** + * This function gives a new instance of a DCOPDrop. + * + * @return A new instance of a DCOPDrop. + */ + virtual KMailDrop* clone() const { return new DCOPDrop; } + + /** + * This function reeds the config which are shipped which the group. + * + * @param config The configuration group which contains the info for this account. + * @return The same value as KMailDrop::readConfigGroup( config ) returns. + */ + virtual bool readConfigGroup( const KConfigGroup& config ); + /** + * This function also reeds the configurion, but from a mapping. + * + * @param map The mapping containing the configuration. + * @param protocol The protocol which comes with the mapping. + * + * @return true is all information is retrieved succesfully. + */ + virtual bool readConfigGroup( const QMap< QString, QString > & map, const Protocol * protocol ); + /** + * This function writes the information to a config group. + * + * @param config The configuration to write true + * @return true if no error occured. + */ + virtual bool writeConfigGroup( KConfigBase& config ) const; + /** + * This returns the type of the box, in this case allways "dcop". + * + * @return "dcop" + */ + virtual QString type() const; + + /** + * This function should return true if it uses a synchrone comminucation. + * It doens't, so it returns false. + * + * @return false + */ + virtual bool synchrone() const { return false; } + + /** + * Return true if it is possible to read the subjects of new email. + * + * @return true + */ + virtual bool canReadSubjects() { return true; } + /** + * This function does reads the subjects. + * @param stop A variable which isn't used: only used for synchrone actions + * @return A QValueVector which KornMailSubject* instance for every new mail. + */ + virtual QValueVector< KornMailSubject >* doReadSubjects( bool *stop ); + + /** + * This function should return true if it is possible to delete emails. + * This is possible, so it always return true. + * + * @return true + */ + virtual bool canDeleteMails() { return true; } + /** + * This function deletes the email. + * + * @param ids The id's of the email which must be deleted. + * @param stop Not used: only for synchrone opererations. + * @return true if deleting was succesfull + */ + virtual bool deleteMails( QPtrList * ids, bool * stop ); + + /** + * This function returns true if it is possible to read emails. + * The emails are only given at once as a whole, so reading is impossible. + * + * @return false + */ + virtual bool canReadMail() { return false; } + + +private: + bool _isRunning; + QMap< int, KornMailSubject* > *_msgList; + QString *_name; + int _counter; + DCOPDropInterface *_interface; + + void eraseList( void ); + +private slots: + void doReadSubjectsASync( void ); + +public: //accessed by DCOPDropInterface + int addMessage( const QString& subject, const QString& message ); + bool removeMessage( int id ); + + //accessed by DCOPDropCfg + QString DCOPName() const; + void setDCOPName( const QString& ); +}; + +#endif diff --git a/korn/dcopdropif.cpp b/korn/dcopdropif.cpp new file mode 100644 index 00000000..70916145 --- /dev/null +++ b/korn/dcopdropif.cpp @@ -0,0 +1,46 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "dcopdropif.h" + +#include "dcopdrop.h" + +DCOPDropInterface::DCOPDropInterface( DCOPDrop* drop, const char* name ) + : DCOPObject( name ), + _drop( drop ) +{ +} + +DCOPDropInterface::~DCOPDropInterface() +{ +} + +void DCOPDropInterface::changeName( const QString& name ) +{ + this->setObjId( name.utf8() ); +} + +int DCOPDropInterface::addMessage( const QString& subject, const QString& message ) +{ + return _drop->addMessage( subject, message ); +} + +bool DCOPDropInterface::removeMessage( int id ) +{ + return _drop->removeMessage( id ); +} diff --git a/korn/dcopdropif.h b/korn/dcopdropif.h new file mode 100644 index 00000000..a041ab05 --- /dev/null +++ b/korn/dcopdropif.h @@ -0,0 +1,71 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef DCOPDROPIF_H +#define DCOPDROPIF_H + +#include + +class DCOPDrop; + +/** + * This DCOP-interface for the DCOPdrop. + */ +class DCOPDropInterface : virtual public DCOPObject +{ +K_DCOP +public: + /** + * Constructor + * @param drop The parent DCOPDrop + * @param name The name of the dcop-object + */ + DCOPDropInterface( DCOPDrop* drop, const char* name ); + /** + * Destructor + */ + ~DCOPDropInterface(); + + /** + * This function is used to change the dcop-name + * + * @param name The new name of this dcop interface. + */ + void changeName( const QString& name ); +k_dcop: + /** + * This function adds a message to list of new messages. + * + * @param subject The subject of the message + * @param message The body of the message + * @return The id which this message got + */ + int addMessage( const QString& subject, const QString& message ); + /** + * This function removes a message from the list of new messages. + * + * @param id The id of the message to be deleted. The id can be obtained in + * the "addMessage" dcop call. + */ + bool removeMessage( int id ); + +private: + DCOPDrop *_drop; +}; + +#endif diff --git a/korn/dockedcontainer.cpp b/korn/dockedcontainer.cpp new file mode 100644 index 00000000..e820c12c --- /dev/null +++ b/korn/dockedcontainer.cpp @@ -0,0 +1,37 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "dockedcontainer.h" + +#include "dockeditem.h" + +DockedContainer::DockedContainer( QObject * parent, const char * name ) + : BoxContainer( parent, name ) +{ +} + +DockedContainer::~DockedContainer() +{ +} + +BoxContainerItem* DockedContainer::newBoxInstance() const +{ + return new DockedItem( 0, "foobar" ); +} + +#include "dockedcontainer.moc" diff --git a/korn/dockedcontainer.h b/korn/dockedcontainer.h new file mode 100644 index 00000000..96216f16 --- /dev/null +++ b/korn/dockedcontainer.h @@ -0,0 +1,45 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_DOCKEDCONTAINER_H +#define MK_DOCKEDCONTAINER_H + +#include "boxcontainer.h" + +class BoxContainerItem; + +/** + * This class is a implementation of a BoxContainer and does almost nothing. + * The only thing it does is creating DocketItems. + */ +class DockedContainer : public BoxContainer +{ Q_OBJECT +public: + DockedContainer( QObject * parent = 0, const char * name = 0 ); + ~DockedContainer(); + +protected: + //virtual void addItem( BoxContainerItem* ); //Overiding not neccesairy + + /** + * @return A new instance to a DocketItem. + */ + virtual BoxContainerItem* newBoxInstance() const; +}; + +#endif //MK_DOCKEDCONTAINER_H diff --git a/korn/dockeditem.cpp b/korn/dockeditem.cpp new file mode 100644 index 00000000..2ec57a4f --- /dev/null +++ b/korn/dockeditem.cpp @@ -0,0 +1,92 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "dockeditem.h" + +#include "systemtray.h" + +#include +#include +#include +#include +#include +#include +#include +#include + +#include +#include +#include +#include +#include +#include + +DockedItem::DockedItem( QWidget * parent, const char * name ) + : BoxContainerItem( parent, name ), + _systemtray( new SystemTray( parent, "System tray" ) ) +{ + this->fillKPopupMenu( _systemtray->contextMenu(), _systemtray->actionCollection() ); + + connect( _systemtray, SIGNAL( quitSelected() ), kapp, SLOT( quit() ) ); + connect( _systemtray, SIGNAL( mouseButtonPressed( Qt::ButtonState ) ), + this, SLOT( mouseButtonPressed( Qt::ButtonState ) ) ); +} + +DockedItem::~DockedItem() +{ + delete _systemtray; +} + +void DockedItem::showBox() +{ + _systemtray->show(); +} + +void DockedItem::readConfig( KConfig* config, const int index ) +{ + BoxContainerItem::readConfig( config, index ); + + //No additional information to be loaded. +} + +void DockedItem::setCount( const int count, const bool newMessages ) +{ + drawLabel( _systemtray, count, newMessages ); +} + +void DockedItem::setTooltip( const QString& tooltip ) +{ + QToolTip::add( _systemtray, tooltip ); +} + +void DockedItem::slotShowPassivePopup( QPtrList< KornMailSubject >* list, int total, bool date, const QString& name ) +{ + showPassivePopup( _systemtray, list, total, name, date ); +} + +void DockedItem::slotShowPassivePopup( const QString& message, const QString& name ) +{ + KPassivePopup::message( i18n( "Korn - %1/%2" ).arg( objId() ).arg( name ), message, _systemtray, "Passive error message" ); +} + +void DockedItem::doPopup() +{ + _systemtray->contextMenu()->popup( QCursor::pos() ); +} + +#include "dockeditem.moc" diff --git a/korn/dockeditem.h b/korn/dockeditem.h new file mode 100644 index 00000000..152fbb2c --- /dev/null +++ b/korn/dockeditem.h @@ -0,0 +1,96 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_DOCKEDITEM_H +#define MK_DOCKEDITEM_H + +#include "boxcontaineritem.h" + +class SystemTray; + +class KConfig; + +class QPixmap; + +/** + * This class is an implementation of a BoxContainerItem for the + * systemtray view. If also is a KSystemTray reimplementation. + * + * @see BoxContainerItem + * @author Mart Kelder + */ +class DockedItem : public BoxContainerItem +{ Q_OBJECT +public: + /** + * This contructor gives all it parameters to its parents. + * @param parant The parent window + * @param name The name of the QObject's parents. + */ + DockedItem( QWidget * parent = 0, const char * name = 0 ); + /** + * Empty destructor; does nothing at the moment + */ + ~DockedItem(); + + /** + * This functions shows the element in the systay. + */ + virtual void showBox(); + + /** + * This functions reads the config. It used the parent + * version for the main things, but it is possible to + * add some configurations over here. + * @param config The KConfig-instance which contains the settings of this tray-item. + * @param index The index of the box in the configuration file + */ + virtual void readConfig( KConfig* config, const int index ); + +public slots: + /** + * This functions sets the number of messages to be displayed, and warns if there are new messages waiting. + * @param count The number of messages waiting + * @param newMessages if true than the settings for displaying new messages will be used. + */ + virtual void setCount( const int count, const bool newMessages ) ; + + /** + * This function sets the tooltip @p string to a box. + * @param string The tooltip to be added. + */ + virtual void setTooltip( const QString& string ); + + void slotShowPassivePopup( QPtrList< KornMailSubject >* list, int total, bool date, const QString& ); + + void slotShowPassivePopup( const QString& error, const QString& ); + +protected: + /** + * This function popup's the KPopupMenu inmideately. + */ + virtual void doPopup(); + +private: + void setAnimIcon( const QString& anim ); + +private: + SystemTray *_systemtray; +}; + +#endif //MK_DOCKEDITEM_H diff --git a/korn/hi16-app-korn.png b/korn/hi16-app-korn.png new file mode 100644 index 00000000..be996e8e Binary files /dev/null and b/korn/hi16-app-korn.png differ diff --git a/korn/hi32-app-korn.png b/korn/hi32-app-korn.png new file mode 100644 index 00000000..46461d25 Binary files /dev/null and b/korn/hi32-app-korn.png differ diff --git a/korn/hi48-app-korn.png b/korn/hi48-app-korn.png new file mode 100644 index 00000000..07fc1498 Binary files /dev/null and b/korn/hi48-app-korn.png differ diff --git a/korn/hvcontainer.cpp b/korn/hvcontainer.cpp new file mode 100644 index 00000000..f0268ba3 --- /dev/null +++ b/korn/hvcontainer.cpp @@ -0,0 +1,52 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "hvcontainer.h" + +#include "hvitem.h" + +#include + +#include + +HVContainer::HVContainer( Qt::Orientation orientation, QObject * parent, const char * name ) + : BoxContainer( parent, name ), + box( 0 ) +{ + if( orientation == Qt::Horizontal ) + box = new QHBox( 0, "hbox" ); + else + box = new QVBox( 0, "vbox" ); +} + +HVContainer::~HVContainer() +{ + delete box; +} + +void HVContainer::showBox() +{ + box->show(); +} + +BoxContainerItem* HVContainer::newBoxInstance() const +{ + return new HVItem( box, "horizontal/vertical item" ); +} + +#include "hvcontainer.moc" diff --git a/korn/hvcontainer.h b/korn/hvcontainer.h new file mode 100644 index 00000000..9bae17b2 --- /dev/null +++ b/korn/hvcontainer.h @@ -0,0 +1,58 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_HVCONTAINER_H +#define MK_HVCONTAINER_H + +#include "boxcontainer.h" + +class BoxContainerItem; + +class QHBox; + +/** + * This is a BoxContainer for both Horizontal and Vertical displays. + */ + +class HVContainer : public BoxContainer +{ Q_OBJECT +public: + /** + * Constructor: all elements are passed to BoxContainer, except orientation. + * + * @param orientation The orientation of the box: it is a vertical or horizontal box? + */ + HVContainer( Qt::Orientation orientation, QObject * parent = 0 , const char * name = 0 ); + ~HVContainer(); + + /** + * This functions calls show() to the box + */ + virtual void showBox(); +protected: + /** + * This function returns a new instance of the container. + * + * @return A new instance of this container. + */ + virtual BoxContainerItem* newBoxInstance() const; +private: + QHBox *box; +}; + +#endif //MK_HVCONTAINER_H diff --git a/korn/hvitem.cpp b/korn/hvitem.cpp new file mode 100644 index 00000000..e8cc2483 --- /dev/null +++ b/korn/hvitem.cpp @@ -0,0 +1,82 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "hvitem.h" + +#include "label.h" + +#include +#include +#include +#include +#include +#include + +#include +#include + +HVItem::HVItem( QWidget *parent, const char *name ) + : BoxContainerItem( 0, name ), + _label( new Label( parent, "label" ) ), + _popup( new KPopupMenu( _label, "popupmenu" ) ), + _actions( new KActionCollection( _popup, "actions" ) ) +{ + _popup->insertTitle( kapp->miniIcon(), kapp->caption() ); + this->fillKPopupMenu( _popup, _actions ); + _popup->insertSeparator(); + KStdAction::quit( kapp, SLOT( quit() ), _actions )->plug( _popup ); + + connect( _label, SIGNAL( mouseButtonPressed( Qt::ButtonState ) ), this, SLOT( mouseButtonPressed( Qt::ButtonState ) ) ); +} + +HVItem::~HVItem() +{ + //Let everything be deleted by his parents. +} + +void HVItem::showBox() +{ + _label->show(); +} + +void HVItem::setCount( const int count, const bool newMessages ) +{ + drawLabel( _label, count, newMessages ); +} + +void HVItem::setTooltip( const QString& string ) +{ + QToolTip::add( _label, string ); +} + +void HVItem::slotShowPassivePopup( QPtrList< KornMailSubject >* list, int total, bool date, const QString& name ) +{ + showPassivePopup( _label, list, total, name, date ); +} + +void HVItem::slotShowPassivePopup( const QString& errorMessage, const QString& name ) +{ + KPassivePopup::message( QString( "korn-%1-%2" ).arg( objId() ).arg( name ), errorMessage, _label, "Passive error message" ); +} + +void HVItem::doPopup() +{ + _popup->popup( QCursor::pos() ); +} + +#include "hvitem.moc" diff --git a/korn/hvitem.h b/korn/hvitem.h new file mode 100644 index 00000000..ced99eb4 --- /dev/null +++ b/korn/hvitem.h @@ -0,0 +1,80 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_HVITEM_H +#define MK_HVITEM_H + +#include + +class KActionCollection; +class KPopupMenu; + +class Label; + +/** + * Item for a horizontal or vertical displayed window. + */ +class HVItem : public BoxContainerItem +{ Q_OBJECT +public: + HVItem( QWidget *parent = 0, const char *name = 0 ); + ~HVItem(); + + /** + * This function calles show() to the label. + */ + virtual void showBox(); + +public slots: + /** + * Sets the number of new messages. + * + * @param count The number of unread messages. + * @param newMessages Are there any new messages? + */ + void setCount( const int count, const bool newMessages ); + + /** + * This function sets the tooltip @p string to a box. + * @param string The tooltip to be added. + */ + virtual void setTooltip( const QString& string ); + + /** + * This slot triggered when the passive popup is to be shown. It is transported + * to BoxContainerItem, but so it is possible to change the arguments. + */ + void slotShowPassivePopup( QPtrList< KornMailSubject >* list, int total, bool date, const QString& ); + + /** + * This slot triggered when the passive popup is to be shown. It is transported + * to BoxContainerItem, but so it is possible to change the arguments. + */ + void slotShowPassivePopup( const QString& errorMessage, const QString& name ); + + /** + * Trigered if the popup-menu is to be shown + */ + virtual void doPopup(); +private: + Label *_label; + KPopupMenu *_popup; + KActionCollection *_actions; +}; + +#endif //MK_HVITEM_H diff --git a/korn/imap_proto.cpp b/korn/imap_proto.cpp new file mode 100644 index 00000000..d0be6436 --- /dev/null +++ b/korn/imap_proto.cpp @@ -0,0 +1,101 @@ +/* + * Copyright (C) 2005, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + + +#include "imap_proto.h" + +#include "account_input.h" + +#include +#include +#include +#include +#include + +void Imap_Protocol::configFillGroupBoxes( QStringList* groupBoxes ) const +{ + groupBoxes->append( "Server" ); + groupBoxes->append( "Identity" ); +} + +void Imap_Protocol::configFields( QPtrVector< QWidget >* vector, const QObject* configDialog, QPtrList< AccountInput > * result ) const +{ + QMap< QString, QString > encrList; + encrList.insert( "ssl", i18n( "SSL" ) ); + encrList.insert( "tls=auto", i18n( "TLS if possible" ) ); + encrList.insert( "tls=on", i18n( "Always TLS" ) ); + encrList.insert( "tls=off", i18n( "Never TLS" ) ); + + QMap< QString, QString > authList; + authList.insert( "auth=*", i18n( "Default" ) ); + authList.insert( "auth=LOGIN", i18n( "LOGIN" ) ); //Note: LOGIN is an authentication method + authList.insert( "auth=ANONTMOUS", i18n( "Anonymous" ) ); //Note: ANONYMOUS is an authentication method + authList.insert( "auth=CRAM-MD5", i18n( "CRAM-MD5" ) ); //Note: CRAM-MD5 is an authentication method + + result->append( new TextInput( (QWidget*)vector->at( 0 ), i18n( "Server" ), TextInput::text, "", "server" ) ); + result->append( new TextInput( (QWidget*)vector->at( 0 ), i18n( "Port" ), 0, 65535, "143", "port" ) ); + result->append( new ComboInput( (QWidget*)vector->at( 0 ), i18n( "Encryption" ), encrList, "tls=auto", "encryption" ) ); + QObject::connect( (QObject*)result->last()->rightWidget(), SIGNAL( activated( int) ), + configDialog, SLOT( slotSSLChanged() ) ); + + result->append( new TextInput( (QWidget*)vector->at( 1 ), i18n( "Username" ), TextInput::text, "", "username" ) ); + result->append( new TextInput( (QWidget*)vector->at( 1 ), i18n( "Mailbox" ), TextInput::text, "INBOX", "mailbox" ) ); + result->append( new TextInput( (QWidget*)vector->at( 1 ), i18n( "Password" ), TextInput::password, "", "password" ) ); + result->append( new CheckboxInput( (QWidget*)vector->at( 1 ), i18n( "Save password" ), "true", "savepassword" ) ); + QObject::connect( (QObject*)result->last()->rightWidget(), SIGNAL( toggled( bool ) ), + (QObject*)result->prev()->rightWidget(), SLOT( setEnabled( bool ) ) ); + result->last()->setValue( "false" ); + result->append( new ComboInput( (QWidget*)vector->at( 1 ), i18n( "Authentication" ), authList, "auth=*", "auth" ) ); +} + +void Imap_Protocol::readEntries( QMap< QString, QString >* map, QMap< QString, QString > *metadata ) const +{ + if( map->contains( "ssl" ) && *map->find( "ssl" ) == "true" ) + map->insert( "encryption", "ssl" ); + if( metadata->contains( "tls" ) ) + map->insert( "encryption", QString( "tls=%1" ).arg( *metadata->find( "tls" ) ) ); + if( metadata->contains( "auth" ) ) + map->insert( "auth", QString( "auth=%1" ).arg( *metadata->find( "auth" ) ) ); +} + +void Imap_Protocol::writeEntries( QMap< QString, QString >* map ) const +{ + QString metadata; + if( map->contains( "encryption" ) ) + { + if( *map->find( "encryption" ) == "ssl" ) + map->insert( "ssl", "true" ); + else + { + map->insert( "ssl", "false" ); + metadata += *map->find( "encryption" ); + } + map->erase( "encryption" ); + } + + if( map->contains( "auth" ) ) + { + if( !metadata.isEmpty() ) + metadata += ","; + metadata += *map->find( "auth" ); + map->erase( "auth" ); + } + + map->insert( "metadata", metadata ); +} + diff --git a/korn/imap_proto.h b/korn/imap_proto.h new file mode 100644 index 00000000..c4dfc896 --- /dev/null +++ b/korn/imap_proto.h @@ -0,0 +1,143 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_IMAP_PROTO_H +#define MK_IMAP_PROTO_H + +#include "kio_proto.h" +#include + +/* + * With deleting and IMAP4 is a small problem: messages don't looks as deleted, as they + * apear with their full body. By deletion, kio_imap marks the message with FLAGS.SILENT as \DELETED. + * If there is a commit-function, it should be installed in this file. + */ + +/** + * This class define the way a imap-protocol works. + * It implements function of KIO_Protocol to make the kio-modules work with it, + * as well as function of Protocol, to configure it. + */ +class Imap_Protocol : public KIO_Protocol +{ +public: + /** + * Constructor + */ + Imap_Protocol() {} + /** + * Destructor + */ + virtual ~Imap_Protocol() {} + + /** + * This function should return true if the protocol is connection-based. + * imap is, so this return "true". + * + * @return true + */ + virtual bool connectionBased() const { return true; } + + /** + * This gives the two names for a kioslave: imaps if ssl is selected, imap if not. + * + * @param ssl true if ssl is selected. + * @return "imaps" if ssl is true, "imap" otherwise + */ + virtual QString protocol( bool ssl ) const { return ssl ? "imaps" : "imap"; } + /** + * This name of this protocol: it goed in the configuration under this name. + * + * @return The name of this protocol: "imap" + */ + virtual QString configName() const { return "imap"; } + /** + * true, because it is possible to read subjects with imap. + * + * @return true + */ + virtual bool canReadSubjects() const { return true; } + /** + * false, because deleting imap-mails doesn't work that well. See the commen above this class: + * metadata expunge=auto doesn't work. + * + * @return false + */ + virtual bool canDeleteMail() const { return false; } //See comment above class: metadata expunge=auto doesn't work. + /** + * true, because it is possible to read the whole message. + * + * @return true + */ + virtual bool canReadMail() const { return true; } + + /** + * This function returns the default port. This depends whether ssl is used or not. + * If ssl is used, it return 993, elsewise 143. + * + * @param ssl Is ssl used? + * @return 993 if ssl is true, false otherwise. + */ + virtual unsigned short defaultPort( bool ssl ) const { return ssl ? 993 : 143; } + + virtual QStringList authList() const { return QStringList::split( '|', "*|LOGIN|ANONYMOUS|CRAM-MD5", false); } + //Could not test did, my server don't support other authentication methods. + + /** + * These function change the kurl and the metadata. + * In this case, "unseen" is added to the query to only list unlees kurls. + * These function are called in kio_*.cpp + */ + virtual void recheckKURL ( KURL &kurl, KIO::MetaData & ) const { kurl.setQuery( "unseen" ); } + virtual void readSubjectKURL( KURL &kurl, KIO::MetaData & ) const { kurl.setPath( kurl.path() + ";section=ENVELOPE" ); } + virtual void deleteMailConnectKURL( KURL &, KIO::MetaData & metadata ) const { metadata.insert( "expunge", "auto" ); } + + /** + * This functions gives a list of names of groupboxes which are to be set in the configuration. + * In this case, two elements are added: "Server" and "Identity". + * + * @param list A list to add the name of groupboxes in. + */ + virtual void configFillGroupBoxes( QStringList* list ) const; + /** + * This function adds elements to the groupbox. + * + * @param vector The vector containing the groupBoxes + * @param object The object to connect signals to + * @param ptrlist A list with object which is filled in this function. The list must already be created. + */ + virtual void configFields( QPtrVector< QWidget >* vector, const QObject* object, QPtrList< AccountInput >* ptrlist ) const; + /** + * This function is used to change the configuration. + * In the case, the metadata-key is splitted out, and put in the @p metadata parameter. + * + * @param map The mapping containing the configuration. This object can change in this function. + * @param metadata An empty mapping at the begin, a mapping containing metadata at the end. + */ + virtual void readEntries( QMap< QString, QString >* map, QMap< QString, QString >* metadata ) const; + /** + * This function edits writeEntry. It merge things back to a metadata-key and adds this + * key to the configuration. + * + * @param map The mapping which contains the information to be written to a configuarion file. + * the contents of this mapping can change in this function. + */ + virtual void writeEntries( QMap< QString, QString >* map ) const; +}; + +#endif diff --git a/korn/imaps_proto.h b/korn/imaps_proto.h new file mode 100644 index 00000000..06b4920b --- /dev/null +++ b/korn/imaps_proto.h @@ -0,0 +1,40 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_IMAPS_PROTO_H +#define MK_IMAPS_PROTO_H + +#include "kio_proto.h" + +//Looks very simular to Imap_Protocol, so I inheritanced it. + +class Imaps_Protocol : public Imap_Protocol +{ +public: + Imaps_Protocol() {} + virtual ~Imaps_Protocol() {} + + virtual KIO_Protocol * clone() const { return new Imaps_Protocol; } + + virtual QString protocol() const { return "imaps"; } + virtual QString configName() const { return "imaps"; } + + virtual unsigned short defaultPort() const { return 993; } +}; + +#endif diff --git a/korn/intid.cpp b/korn/intid.cpp new file mode 100644 index 00000000..060f9c96 --- /dev/null +++ b/korn/intid.cpp @@ -0,0 +1,25 @@ +#include "intid.h" + +#include + +KornIntId::KornIntId(int id) : _id(id) +{ +} + +KornIntId::KornIntId(const KornIntId& src) : KornMailId(), _id(src._id) +{ +} + +KornIntId::~KornIntId() +{ +} + +QString KornIntId::toString() const +{ + return QString("KornIntId, Id: ") + QString::number(_id); +} + +KornMailId * KornIntId::clone() const +{ + return new KornIntId(*this); +} diff --git a/korn/intid.h b/korn/intid.h new file mode 100644 index 00000000..ab4b4d3c --- /dev/null +++ b/korn/intid.h @@ -0,0 +1,52 @@ +#ifndef IntId_h +#define IntId_h + +#include "mailid.h" + +/** + * Mail ID for mailboxes, which identify their mails by an integer number + */ +class KornIntId : public KornMailId +{ + /** + * the mail id + */ + int _id; +public: + /** + * KornIntId Destructor + */ + virtual ~KornIntId(); + + /** + * KornIntId Constructor + * @param id: mail id + */ + KornIntId(int id); + + /** + * KornIntId Copy Constructor + * @param src: KornIntId to copy from + */ + KornIntId(const KornIntId& src); + + /** + * Return the mail id + * @return the mail id + */ + int getId() const {return _id;} + + /** + * Return a string representation of this (for debugging purposes only) + * @return a string representation + */ + virtual QString toString() const; + + /** + * Create an exact copy of this. + * @return the cloned object + */ + virtual KornMailId * clone() const; +}; + +#endif diff --git a/korn/kconf_update/Makefile.am b/korn/kconf_update/Makefile.am new file mode 100644 index 00000000..87b23ad8 --- /dev/null +++ b/korn/kconf_update/Makefile.am @@ -0,0 +1,12 @@ +INCLUDES=$(all_includes) + +update_DATA = korn-3-4-config_change.upd korn-3-5-update.upd +update_SCRIPTS = korn-3-5-ssl-update.pl korn-3-5-metadata-update.pl +updatedir = $(kde_datadir)/kconf_update + +kconf_PROGRAMS = korn-3-4-config_change +kconfdir = $(libdir)/kconf_update_bin + +korn_3_4_config_change_SOURCES = korn-3-4-config_change.cpp +korn_3_4_config_change_LDFLAGS = $(all_libraries) $(KDE_RPATH) +korn_3_4_config_change_LDADD = $(LIB_QT) diff --git a/korn/kconf_update/korn-3-4-config_change.cpp b/korn/kconf_update/korn-3-4-config_change.cpp new file mode 100644 index 00000000..f8afa1ff --- /dev/null +++ b/korn/kconf_update/korn-3-4-config_change.cpp @@ -0,0 +1,261 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include +#include +#include +#include +#include + +#include + +QString decodeString( const QString &password ) +{ + unsigned int i, val; + unsigned int len = password.length(); + QString result=""; + for ( i=0; i < len; i++ ) + { + val = password[i].latin1() - ' '; + val = (255-' ') - val; + result += (char)(val + ' '); + } + return result; +} + +void printToprint( QTextStream &out, QMap &to_printed, const QString type ) +{ + out << "printToprint( " << type << " )" << endl; + + if( type == "mbox" ) + { + out << "mailbox=" << to_printed[ "file" ] << endl; + } + else if( type == "qmail" ) + { + out << "mailbox=" << to_printed[ "maildir" ] << endl; + } + else if( type == "pop3" ) + { + out << "host=" << to_printed[ "host" ] << endl; + out << "port=" << to_printed[ "port" ] << endl; + out << "username=" << to_printed[ "user" ] << endl; + if( to_printed[ "APOP" ] == "true" ) + out << "auth=APOP" << endl; + else + out << "auth=" << endl; + } + else if( type == "imap4" ) + { + out << "host=" << to_printed[ "host" ] << endl; + out << "port=" << to_printed[ "port" ] << endl; + out << "username=" << to_printed[ "user" ] << endl; + out << "mailbox=" << to_printed[ "mailbox" ] << endl; + } + else if( type == "nntp" ) + { + out << "host=" << to_printed[ "host" ] << endl; + out << "port=" << to_printed[ "port" ] << endl; + out << "mailbox=" << to_printed[ "group" ] << endl; + } + else if( type == "process" ) + { + out << "mailbox=" << to_printed[ "command" ] << endl; + } + else if( type == "kio" ) + { + out << "host=" << to_printed[ "host" ] << endl; + out << "port=" << to_printed[ "port" ] << endl; + out << "username=" << to_printed[ "username" ] << endl; + out << "mailbox=" << to_printed[ "mailbox" ] << endl; + out << "password=" << decodeString( to_printed[ "password" ] ) << endl; + } + + if( type == "pop3" || type == "imap4" ) + { + out << "password=" << to_printed[ "pass" ] << endl; + if( to_printed[ "pass" ].isEmpty() ) + out << "savepassword=false" << endl; + else + out << "savepassword=true" << endl; + } + + if( to_printed[ "resetcounter" ] != "-1" ) + out << "reset=" << to_printed[ "resetcounter" ] << endl; + else + out << "reset=0" << endl; + out << "interval=" << to_printed[ "poll" ] << endl; +} + +int main( int, char** ) +{ + QString line = QString::null; + QString currentGroup1 = QString::null; + QString currentGroup2 = QString::null; + QString type = QString::null; + QString password = QString::null; + QRegExp interesting_group( "^\\[box-(\\d+)\\]" ); + QRegExp key_value( "^(\\w*)=(.*)$" ); + QValueList tobe_deleted; + int numboxes = -1; + bool isKey = false; + + QTextStream in( stdin, IO_ReadOnly ); + QTextStream out( stdout, IO_WriteOnly ); + + in.setEncoding( QTextStream::UnicodeUTF8 ); + out.setEncoding( QTextStream::UnicodeUTF8 ); + + QMap mapping1; + QValueList mapping2; + QMap to_printed; + + mapping1.insert( "caption", "name" ); + mapping1.insert( "onclick", "command" ); + mapping1.insert( "onnewmail", "newcommand" ); + mapping1.insert( "soundfile", "sound" ); + mapping1.insert( "passive_popup", "passivepopup" ); + mapping1.insert( "passive_data", "passivedata" ); + mapping1.insert( "reset", "reset" ); + mapping1.insert( "fgcolour", "normalfgcolour" ); + mapping1.insert( "bgcolour", "normalbgcolour" ); + mapping1.insert( "newmailfgcolour", "newfgcolour" ); + mapping1.insert( "newmailbgcolour", "newbgcolour" ); + mapping1.insert( "icon", "normalicon" ); + mapping1.insert( "newmailicon", "newicon" ); + + mapping2.append( "file" ); + mapping2.append( "maildir" ); + mapping2.append( "host" ); + mapping2.append( "port" ); + mapping2.append( "user" ); + mapping2.append( "APOP" ); + mapping2.append( "mailbox" ); + mapping2.append( "group" ); + mapping2.append( "command" ); + mapping2.append( "protocol" ); + mapping2.append( "pass" ); + mapping2.append( "password" ); + mapping2.append( "resetcounter" ); + mapping2.append( "poll" ); + + while( !in.atEnd() ) + { + line = in.readLine(); + + isKey = key_value.search( line ) >= 0; + + if( line.left( 1 ) == "[" ) + { + if( !currentGroup1.isNull() ) + { + out << currentGroup2 << endl; + printToprint( out, to_printed, type ); + } + + currentGroup1 = QString::null; + } + + if( interesting_group.search( line ) >= 0 ) + { + if( numboxes > -1 && interesting_group.cap( 1 ).toInt() < numboxes ) + { + currentGroup1 = QString( "[korn-%1]" ).arg( interesting_group.cap( 1 ) ); + currentGroup2 = QString( "[korn-%1-0]" ).arg( interesting_group.cap( 1 ) ); + } + tobe_deleted.append( line ); + continue; + } + else if( isKey && key_value.cap( 1 ) == "numboxes" ) + { + numboxes = key_value.cap( 2 ).toInt(); + continue; + } + else if( currentGroup1.isNull() || !isKey ) + continue; + if( mapping1.contains( key_value.cap( 1 ) ) ) + { + out << currentGroup1 << endl; + out << mapping1[ key_value.cap( 1 ) ] << "=" << key_value.cap( 2 ) << endl; + if( key_value.cap( 1 ) == "caption" ) + { + out << currentGroup2 << endl; + out << "name=" << key_value.cap( 2 ) << endl; + } + } + else if( mapping2.contains( key_value.cap( 1 ) ) ) + { + to_printed.insert( key_value.cap( 1 ), key_value.cap( 2 ) ); + } + else if( key_value.cap( 1 ) == "type" && key_value.cap( 2 ) != "kio" ) + { + out << currentGroup2 << endl; + if( key_value.cap( 2 ) == "imap4" ) + out << "protocol=imap" << endl; + else + out << "protocol=" << key_value.cap( 2 ) << endl; + type = key_value.cap( 2 ); + + } + else if( key_value.cap( 1 ) == "type" && key_value.cap( 2 ) == "kio" ) + { + type = "kio"; + } + else if( key_value.cap( 1 ) == "displaystyle" ) + { + out << currentGroup1 << endl; + if( key_value.cap( 2 ) == "2" ) + { + out << "hasnormalfgcolour=false" << endl; + out << "hasnormalbgcolour=false" << endl; + out << "hasnewfgcolour=false" << endl; + out << "hasnewbgcolour=false" << endl; + out << "hasnormalicon=true" << endl; + out << "hasnormalanim=false" << endl; + out << "hasnewicon=true" << endl; + out << "hasnewanim=false" << endl; + } + else + { + out << "hasnormalfgcolour=true" << endl; + out << "hasnormalbgcolour=true" << endl; + out << "hasnewfgcolour=true" << endl; + out << "hasnewbgcolour=true" << endl; + out << "hasnormalicon=false" << endl; + out << "hasnormalanim=false" << endl; + out << "hasnewicon=false" << endl; + out << "hasnewanim=false" << endl; + } + } + } + + if( !currentGroup1.isNull() ) + { + out << currentGroup2 << endl; + printToprint( out, to_printed, type ); + } + + QValueList::Iterator it1 = tobe_deleted.begin(); + QValueList::Iterator it1_end = tobe_deleted.end(); + + for( ; it1 != it1_end; ++it1 ) + out << "# DELETEGROUP " << *it1 << endl; + + return 0; +} + diff --git a/korn/kconf_update/korn-3-4-config_change.upd b/korn/kconf_update/korn-3-4-config_change.upd new file mode 100644 index 00000000..530304fa --- /dev/null +++ b/korn/kconf_update/korn-3-4-config_change.upd @@ -0,0 +1,3 @@ +Id=korn_kde_3_4_config_change +File=kornrc +Script=korn-3-4-config_change diff --git a/korn/kconf_update/korn-3-5-metadata-update.pl b/korn/kconf_update/korn-3-5-metadata-update.pl new file mode 100644 index 00000000..95723c4e --- /dev/null +++ b/korn/kconf_update/korn-3-5-metadata-update.pl @@ -0,0 +1,43 @@ +my $input; +my $group; +my $auth = ""; +my $tls = ""; +my $metadata = ""; + +while( $input = ) +{ + chop $input; + if( $input =~ /^\[.*\]$/ ) + { + if( $metadata ) + { + print "[$group]\n"; + print "metadata=$metadata\n"; + $metadata=""; + } + + if( $input =~ /^\[(korn-(\d+)-\d+)\]$/ ) + { + $group = $1; + } + else + { + $group = ""; + } + $auth=""; + $tls=""; + } + + if( $input =~ /^auth\=(.*)/ ) + { + $metadata=$tls ? "auth=$1,tls=$tls" : "auth=$1"; + $auth=$1; + print "# DELETE [$group]auth\n"; + } + elsif( $input =~ /^tls\=(.*)/ ) + { + $metadata=$auth ? "auth=$auth,tls=$1" : "tls=$1"; + $tls=$1; + print "# DELETE [$tls]tls\n"; + } +} diff --git a/korn/kconf_update/korn-3-5-ssl-update.pl b/korn/kconf_update/korn-3-5-ssl-update.pl new file mode 100644 index 00000000..b44ce10f --- /dev/null +++ b/korn/kconf_update/korn-3-5-ssl-update.pl @@ -0,0 +1,39 @@ +my $input; +my $group; +my $protocol; + +while( $input = ) +{ + chop $input; + if( $input =~ /^\[.*\]$/ ) + { + if( $input =~ /^\[(korn-(\d+)-\d+)\]$/ ) + { + $group = $1; + } + else + { + $group = ""; + } + } + + if( $input =~ /^protocol\=(.*)/ ) + { + $protocol=$1; + print "[$group]\n"; + if( $protocol eq "imaps" ) + { + print "protocol=imap\n"; + print "ssl=true\n"; + } + elsif( $protocol eq "pop3s" ) + { + print "protocol=pop3\n"; + print "ssl=true\n"; + } + else + { + print "ssl=false\n"; + } + } +} diff --git a/korn/kconf_update/korn-3-5-update.upd b/korn/kconf_update/korn-3-5-update.upd new file mode 100644 index 00000000..d954d782 --- /dev/null +++ b/korn/kconf_update/korn-3-5-update.upd @@ -0,0 +1,10 @@ +Id=korn-3-5-ssl-update +File=kornrc +Options=overwrite +Script=korn-3-5-ssl-update.pl,perl + +Id=korn-3-5-metadata-update +File=kornrc +Options=overwrite +Script=korn-3-5-metadata-update.pl,perl + diff --git a/korn/keditlistboxman.cpp b/korn/keditlistboxman.cpp new file mode 100644 index 00000000..43cce831 --- /dev/null +++ b/korn/keditlistboxman.cpp @@ -0,0 +1,301 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "keditlistboxman.h" + +#include +#include + +#include +#include + +KEditListBoxManager::KEditListBoxManager( QWidget *parent, const char *name, + bool checkAtEntering, int buttons ) + : KEditListBox( parent, name, checkAtEntering, buttons ), + _config( 0 ), + _groupName( 0 ), + _subGroupName( 0 ), + _prevCount( 0 ) +{ + init(); +} + +KEditListBoxManager::KEditListBoxManager( const QString& title, QWidget *parent, + const char *name, bool checkAtEntering, + int buttons) + : KEditListBox( title, parent, name, checkAtEntering, buttons ), + _config( 0 ), + _groupName( 0 ), + _subGroupName( 0 ), + _prevCount( 0 ) +{ + init(); +} + +KEditListBoxManager::KEditListBoxManager( const QString& title, + const KEditListBox::CustomEditor &customEditor, + QWidget *parent, const char *name, + bool checkAtEntering, int buttons ) + : KEditListBox( title, customEditor, parent, name, checkAtEntering, buttons ), + _config( 0 ), + _groupName( 0 ), + _subGroupName( 0 ), + _prevCount( 0 ) +{ + init(); +} + +KEditListBoxManager::~KEditListBoxManager() +{ + delete _groupName; +} + +void KEditListBoxManager::setConfig( KConfig* config ) +{ + _config = config; + if( _groupName ) + readNames(); +} + +void KEditListBoxManager::setGroupName( const QString& name ) +{ + if( _groupName ) + *_groupName = name; + else + _groupName = new QString( name ); + + if( _config ) + readNames(); +} + +void KEditListBoxManager::setSubGroupName( const QString& name ) +{ + if( _subGroupName ) + *_subGroupName = name; + else + _subGroupName = new QString( name ); + + if( _config && _groupName ) + readNames(); +} + +void KEditListBoxManager::init() +{ + connect( this, SIGNAL( changed() ), this, SLOT( slotChanged() ) ); + connect( this, SIGNAL( added( const QString& ) ), this, SLOT( slotAdded( const QString& ) ) ); + connect( this, SIGNAL( removed( const QString& ) ), this, SLOT( slotRemoved( const QString& ) ) ); + + connect( this->listBox(), SIGNAL( doubleClicked( QListBoxItem * ) ), this, SLOT( slotActivated( QListBoxItem * ) ) ); + connect( this->listBox(), SIGNAL( returnPressed( QListBoxItem * ) ), this, SLOT( slotActivated( QListBoxItem * ) ) ); +} + +void KEditListBoxManager::readNames() +{ + int number = 0; + + this->clear(); + while( _config->hasGroup( _groupName->arg( number ) ) ) + { + _config->setGroup( _groupName->arg( number ) ); + this->insertItem( _config->readEntry( "name", QString::null ) ); + ++number; + } + + _prevCount = this->count(); +} + +void KEditListBoxManager::slotChanged() +{ + /* Three thing could be hapened: + * 1. the text is changed; + * 2. the item has moved up; + * 3. the item has moved down. + */ + + //_prevCount is invariant under all of these operation + //if _prevCount is changed, is wasn't one of those operations. + + if( _prevCount != this->count() ) + return; + + if( !_config || !_groupName ) + return; + + //First check if the item was moved up + + _config->setGroup( _groupName->arg( this->currentItem() ) ); + + if( this->currentItem() > 0 && this->text( this->currentItem() - 1 ) == _config->readEntry( "name", QString::null ) ) + changeItem( this->currentItem() - 1, this->currentItem() ); //moved down + else if( this->currentItem() < this->count() - 1 && + this->text( this->currentItem() + 1 ) == _config->readEntry( "name", QString::null ) ) + changeItem( this->currentItem(), this->currentItem() + 1 ); //moved up + else if( this->currentText() != _config->readEntry( "name", QString::null ) ) + changedText(); //changed +} + +void KEditListBoxManager::slotAdded( const QString& name ) +{ + //Update _prevCount + _prevCount = this->count(); + + if( !_config || !_groupName ) + return; + + int number = 0; + while( _config->hasGroup( _groupName->arg( number ) ) ) + ++number; + + _config->setGroup( _groupName->arg( number ) ); + _config->writeEntry( "name", name ); + + emit setDefaults( name, number, _config ); +} + +void KEditListBoxManager::slotRemoved( const QString& name ) +{ + //Update prevCount + _prevCount = this->count(); + + if( !_config || !_groupName ) + return; + + //First: search the item number. + int number = 0; + int subnumber = 0; + while( true ) + { + if( !_config->hasGroup( _groupName->arg( number ) ) ) + { + number = -1; //not found + break; + } + _config->setGroup( _groupName->arg( number ) ); + if( name == _config->readEntry( "name", QString::null ) ) + break; //found + + ++number; //Try next group + } + + if( number < 0 ) //failure + return; //do nothing + + _config->deleteGroup( _groupName->arg( number ), true, false ); + emit elementDeleted( number ); + while( _subGroupName && _config->hasGroup( _subGroupName->arg( number ).arg( subnumber ) ) ) + { + _config->deleteGroup( _subGroupName->arg( number ).arg( subnumber ) ); + ++subnumber; + } + + //rotate groups + while( _config->hasGroup( _groupName->arg( number + 1 ) ) ) + { + moveItem( number + 1, number ); + + ++number; + } +} + +void KEditListBoxManager::slotActivated( QListBoxItem* item ) +{ + if( item ) + emit activated( item->text() ); +} + +void KEditListBoxManager::moveItem( int src, int dest ) +{ + QMap *srcList = new QMap; + QMap::iterator it; + int subnumber = 0; + + *srcList = _config->entryMap( _groupName->arg( src ) ); + _config->deleteGroup( _groupName->arg( src ) ); + + _config->setGroup( _groupName->arg( dest ) ); + for( it = srcList->begin(); it != srcList->end(); ++it ) + _config->writeEntry( it.key(), it.data() ); + + while( _subGroupName && _config->hasGroup( _subGroupName->arg( src ).arg( subnumber ) ) ) + { + _config->deleteGroup( _subGroupName->arg( dest ).arg( subnumber ) ); + _config->setGroup( _subGroupName->arg( dest ).arg( subnumber ) ); + for( it = srcList->begin(); it != srcList->end(); ++it ) + _config->writeEntry( it.key(), it.data() ); + + ++subnumber; + } + + emit elementsSwapped( src, dest ); + + delete srcList; +} + +void KEditListBoxManager::changeItem( int first, int last ) +{ + QMap *firstList = new QMap; + QMap *lastList = new QMap; + QMap::iterator it; + int subnumber = 0; + + *firstList = _config->entryMap( _groupName->arg( first ) ); + *lastList = _config->entryMap( _groupName->arg( last ) ); + _config->deleteGroup( _groupName->arg( first ) ); + _config->deleteGroup( _groupName->arg( last ) ); + + _config->setGroup( _groupName->arg( last ) ); + for( it = firstList->begin(); it != firstList->end(); ++it ) + _config->writeEntry( it.key(), it.data() ); + + _config->setGroup( _groupName->arg( first ) ); + for( it = lastList->begin(); it != lastList->end(); ++it ) + _config->writeEntry( it.key(), it.data() ); + + while( _subGroupName && ( + _config->hasGroup( _subGroupName->arg( first ).arg( subnumber ) ) || + _config->hasGroup( _subGroupName->arg( last ).arg( subnumber ) ) ) ) + { + *firstList = _config->entryMap( _subGroupName->arg( first ).arg( subnumber ) ); + *lastList = _config->entryMap( _subGroupName->arg( last ).arg( subnumber ) ); + _config->deleteGroup( _subGroupName->arg( first ).arg( subnumber ) ); + _config->deleteGroup( _subGroupName->arg( last ).arg( subnumber ) ); + + _config->setGroup( _subGroupName->arg( last ).arg( subnumber ) ); + for( it = firstList->begin(); it != firstList->end(); ++it ) + _config->writeEntry( it.key(), it.data() ); + + _config->setGroup( _subGroupName->arg( first ).arg( subnumber ) ); + for( it = lastList->begin(); it != lastList->end(); ++it ) + _config->writeEntry( it.key(), it.data() ); + + ++subnumber; + } + + emit elementsSwapped( first, last ); + + delete firstList; + delete lastList; +} + +void KEditListBoxManager::changedText() +{ + _config->setGroup( _groupName->arg( this->currentItem() ) ); + _config->writeEntry( "name", this->currentText() ); +} + +#include "keditlistboxman.moc" diff --git a/korn/keditlistboxman.h b/korn/keditlistboxman.h new file mode 100644 index 00000000..6792ee81 --- /dev/null +++ b/korn/keditlistboxman.h @@ -0,0 +1,147 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_KEDITLISTBOXMAN_H +#define MK_KEDITLISTBOXMAN_H + +#include + +class KConfig; + +class QString; +class QWidget; + +/** + * This class is a extention on KEditListBox. + * It also handles the configuration. + * @author Mart Kelder (mart.kde@hccnet.nl) + */ +class KEditListBoxManager : public KEditListBox +{ Q_OBJECT +public: + /** + * Constructor: @see KEditListBoxManager::KEditListBoxManager( const QString&, QWidget, const char * name, bool, int ) + */ + KEditListBoxManager( QWidget *parent = 0, const char *name = 0, + bool checkAtEntering=true, int buttons = All ); + + /** + * The save as above, but with other options for KEditListBox. + */ + KEditListBoxManager( const QString& title, QWidget *parent = 0, + const char *name = 0, bool checkAtEntering=true, + int buttons = All ); + + /** + * The save as above, but with other options for KEditListBox. + */ + KEditListBoxManager( const QString& title, + const KEditListBox::CustomEditor &customEditor, + QWidget *parent = 0, const char *name = 0, + bool checkAtEntering = true, int buttons = All ); + + /** + * Destructor + */ + ~KEditListBoxManager(); + + + /** + * Set the KConfig object (required before doing something + * @param config The KConfig-object + */ + void setConfig( KConfig* config ); + /** + * Sets the groupName. groupName should contain at least one %1. + * It is used for makeing groupnames. + * @param name The groupname + */ + void setGroupName( const QString& name ); + + /** + * Sets the subGroupName. subGroupName should contain %1 and %2. + * It is used to execute operations on a group and its subgroups. + * @param name The groupname + */ + void setSubGroupName( const QString& name ); +private: + /** + * This functions is called from and only from the constructor to prevent writing the + * same code for all constructors + */ + void init(); + + /** + * This function reads the names out the config. + */ + void readNames(); +private: + KConfig *_config; //Stores the KConfig-object + QString *_groupName; //Stores the groupName string. + QString *_subGroupName; + int _prevCount; + +private slots: + //These comes directly from the KEditListBox itselfs. + void slotChanged(); + void slotAdded( const QString& ); + void slotRemoved( const QString& ); + + void slotActivated( QListBoxItem* ); +private: + /** + * This private method moves an item. It is called from slotChanged(). + * @param src The number of the source-group. + * @param dest The number of the destanation-group + */ + void moveItem( int src, int dest ); + + /** + * This private functions switch to groups: first^=last; last^=first; first^=last + * @param first the first number of a group. + * @param last the second number of a group (and the last number). + */ + void changeItem( int first, int last ); + + /** + * This function is called if the user change the name of the group + */ + void changedText(); + +signals: + /** + * This signal is emitted when somebody selects an item + * @param text The text of the newly selected item. + */ + void activated( const QString& text ); + + /** + * This signal is emitted when defaults have to be set. + * @param name The name of the object: this is filled in the KEditListBox; + * @param config The configuration in which the config have to be parsed. + * @param index The number of the item. + * this config is already in the right group. + */ + void setDefaults( const QString& name, const int index, KConfig* config ); + + void elementsSwapped( int, int ); + void elementDeleted( int ); + +}; + +#endif //MK_KEDITLISTBOXMAN_H diff --git a/korn/kio.cpp b/korn/kio.cpp new file mode 100644 index 00000000..4677c81c --- /dev/null +++ b/korn/kio.cpp @@ -0,0 +1,561 @@ +/* + * Copyright (C) Sirtaj Singh Kang + * Copyright (C) Kurt Granroth + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +/* + * kio.cpp -- Implementation of class KKIODrop. + * It is copyied from imap.cpp, with was writed by: + * Author: Kurt Granroth + * Version: $Id$ + * Changed by: + * Mart Kelder , 2004 + */ + +#include "kio.h" +#include "kio_count.h" +#include "kio_subjects.h" +#include "kio_read.h" +#include "kio_delete.h" +#include "protocol.h" +#include "protocols.h" +#include "stringid.h" +#include"utils.h" +//#include"kiocfg.h" +//#include"dropdlg.h" +#include "mailsubject.h" + +#include +#include +#include +#include +#include + +#include +#include +#include +#include + +#include +#include +#include +#include + +//Headers of protocols +#include"kio_proto.h" +//#include"pop3_proto.h" +//#include"pop3s_proto.h" +//#include"imap_proto.h" +//#include"imaps_proto.h" +//#include"nntp_proto.h" +//#include"maildir_proto.h" +//#include"qmail_proto.h" +//#include"process_proto.h" +#include"mbox_proto.h" + +/* + * The 'process' maildrop is a lot different than the other protocols: + * it haven't a kioslave and could not result in file list. To prevent + * trowing it away, that functionality is hacked in this file. + */ + +KKioDrop::KKioDrop() + : KPollableDrop(), + _kurl( 0 ), + _metadata( 0 ), + _valid(false), + _protocol( 0 ), + _ssl(false), + _count( 0 ), + _subjects( 0 ), + _read( 0 ), + _readSubjectsTotalSteps( 0 ), + _deleteMailsTotalSteps( 0 ), + _process( 0 ), + _mailurls( 0 ) +{ + _kurl = new KURL; + _metadata = new KIO::MetaData; + + //Initialising protocol; if no protocol is set before first use, it will use the first protocol + _protocol = Protocols::firstProtocol()->getKIOProtocol(); //The first protocol is the default + _kurl->setPort( _protocol->defaultPort( _ssl ) ); + + //Creating children and connect them to the outside world; this class passes the messages for them... + //This class handles all the counting. + _count = new KIO_Count( this, "kio_count" ); + + //This class is responsible for providing the available subjects + _subjects = new KIO_Subjects( this, "kio_subjects" ); + + //This class is used when a full message has to be read. + _read = new KIO_Read( this, "kio_read" ); + + //This class can delete mails. + _delete = new KIO_Delete( this, "kio_delete" ); + + _mailurls = new QValueList; +} + +KKioDrop::KKioDrop( KConfigGroup* ) + : KPollableDrop(), + _kurl( 0 ), + _metadata( 0 ), + _valid(false), + _protocol( 0 ), + _ssl(false), + _count( 0 ), + _subjects( 0 ), + _read( 0 ), + _readSubjectsTotalSteps( 0 ), + _deleteMailsTotalSteps( 0 ), + _process( 0 ), + _mailurls( 0 ) +{ + _kurl = new KURL; + _metadata = new KIO::MetaData; + + //Initialising protocol; if no protocol is set before first use, it will use the first protocol + _protocol = Protocols::firstProtocol()->getKIOProtocol(); //The first protocol is the default + _kurl->setPort( _protocol->defaultPort( _ssl ) ); + + //Creating children and connect them to the outside world; this class passes the messages for them... + //This class handles all the counting. + _count = new KIO_Count( this, "kio_count" ); + + //This class is responsible for providing the available subjects + _subjects = new KIO_Subjects( this, "kio_subjects" ); + + //This class is used when a full message has to be read. + _read = new KIO_Read( this, "kio_read" ); + + //This class can delete mails. + _delete = new KIO_Delete( this, "kio_delete" ); + + _mailurls = new QValueList; + + //readConfigGroup( *config ); +} + +void KKioDrop::setKioServer( const QString & proto, const QString & server, int port ) +{ + //Settings default for last vars; could not inline because KIO::MetaData-object is not defined in header. + setKioServer( proto, server, port, KIO::MetaData(), false, true ); +} + +void KKioDrop::setKioServer(const QString & proto, const QString & server, int port, const KIO::MetaData metadata, bool ssl, + bool setProtocol ) +{ + QString auth; + + if( port == -1 ) + port = _protocol->defaultPort( ssl ); + + if( setProtocol ) //false if _protocol already made + { + _protocol = Protocols::getProto( proto )->getKIOProtocol(); + + if( ! _protocol ) + _protocol = Protocols::firstProtocol()->getKIOProtocol(); + } + + _kurl->setProtocol( _protocol->protocol( ssl ) ); + _kurl->setHost ( server ); + _kurl->setPort ( port ); + _ssl = ssl; + + //Checking for authentication-settings. + //if( _metadata->contains("auth") ) + //{ + // auth = (*_metadata)["auth"]; + // *_metadata = metadata; + // if( ! _metadata->contains("auth") ) + // (*_metadata)["auth"] = auth; + //} else + *_metadata = metadata; + + _count->stopActiveCount(); +} + +void KKioDrop::setUser(const QString & user, const QString & password, + const QString & mailbox, const QString & auth ) +{ + _kurl->setUser( user ); + _password = password ; + _kurl->setPass( _password ); + _kurl->setPath( mailbox ); + if( ! auth.isEmpty() && auth != "Plain" ) + (*_metadata)["auth"] = auth; + else if( _metadata->contains( "auth" ) ) + _metadata->erase( "auth" ); + + _valid = _kurl->isValid(); + emit validChanged( valid() ); + + if( ! _valid ) + kdWarning() << i18n( "url is not valid" ) << endl; + + _count->stopActiveCount(); +} + +QString KKioDrop::protocol() const +{ + return _protocol->configName(); +} + +QString KKioDrop::server() const +{ + return _kurl->host(); +} +int KKioDrop::port() const +{ + return _kurl->port(); +} + +QString KKioDrop::user() const +{ + return _kurl->user(); +} +QString KKioDrop::password() const +{ + return _password ; +} +QString KKioDrop::mailbox() const +{ + return _kurl->path(); +} +QString KKioDrop::auth() const +{ + return ( _metadata->contains("auth")?(*_metadata)["auth"]:"" ); +} + +void KKioDrop::recheck() +{ + if( _protocol->configName() == "process" ) //Process isn't pollable + { + emit rechecked(); + return; + } + + _count->count( this ); + + return; +} + +void KKioDrop::forceRecheck() +{ + if( _protocol->configName() == "process" ) + return; + + _count->stopActiveCount(); + _count->count( this ); + + return; +} + +bool KKioDrop::valid() +{ + return _valid && _count->valid() && _subjects->valid(); +} + +KKioDrop::~KKioDrop() +{ + delete _count; + delete _subjects; + delete _kurl; + delete _metadata; + delete _mailurls; +} + +bool KKioDrop::canReadSubjects( ) +{ + return (_protocol!=0?_protocol->canReadSubjects():false); +} + +QValueVector * KKioDrop::doReadSubjects(bool * ) +{ + _subjects->doReadSubjects( this ); + + /* + * A empty QValueVector is made here. + * After that, the size is expanded to the expected number of subjects. + * This way, reallocation of memmory is minimized, and thus more efficient. + */ + QValueVector *vector = new QValueVector( ); + vector->reserve( _mailurls->count() ); + return vector; +} + +bool KKioDrop::canReadMail( ) +{ + return (_protocol!=0?_protocol->canReadMail():false); +} + +bool KKioDrop::deleteMails(QPtrList * ids, bool * /*stop*/) +{ + _delete->deleteMails( ids, this ); + return _delete->valid(); +} + +bool KKioDrop::canDeleteMails () +{ + return (_protocol!=0?_protocol->canDeleteMail():false); +} + +QString KKioDrop::readMail(const KornMailId * item, bool * ) +{ + _read->readMail( item, this ); + + return ""; +} + +KMailDrop* KKioDrop::clone() const +{ + KKioDrop *clone = new KKioDrop; + + *clone = *this; + + return clone; +} + +bool KKioDrop::readConfigGroup( const QMap< QString, QString > &map, const Protocol* protocol ) +{ + QString val, val2; + + if( !map.contains( "server" ) || !map.contains( "port" ) || !map.contains( "ssl" ) || !map.contains( "username" ) || + !map.contains( "mailbox" ) || !map.contains( "password" ) || !map.contains( "metadata" ) || !map.contains( "name" ) ) + { + kdWarning() << "Bug: map niet compleet" << endl; + return false; + } + + this->setName( (*map.find( "name" )).utf8() ); + + _protocol = protocol->getKIOProtocol(); + if( !_protocol ) + _protocol = Protocols::firstProtocol()->getKIOProtocol(); + + val = *map.find( "server" ); + setKioServer( val2, val, (*map.find( "port" )).toInt(), KIO::MetaData(), *map.find( "ssl" ) == "true", false ); + + _kurl->setUser( *map.find( "username" ) ); + _kurl->setPath( *map.find( "mailbox" ) ); + + _kurl->setPass( *map.find( "password" ) ); + + QStringList list = QStringList::split( ',', *map.find( "metadata" ) ); + QStringList::Iterator it; + for( it = list.begin(); it != list.end(); ++it ) + { + int split = (*it).find( "=" ); + if( split > 0 ) + _metadata->insert( (*it).left( split ), (*it).right( (*it).length() - split - 1 ) ); + } + + _valid = true; + emitValidChanged(); + + return true; +} + +bool KKioDrop::writeConfigGroup( KConfigBase& cfg ) const +{ + KPollableDrop::writeConfigGroup( cfg ); + /*QString p; + + if( _kurl->hasPass() ) { + p = _kurl->pass(); + //encrypt ( p ); + } + + cfg.writeEntry(fu(ProtoConfigKey), _protocol->configName() ); + if( ( _protocol->fields() | _protocol->urlFields() ) & KIO_Protocol::server ) + cfg.writeEntry(fu(HostConfigKey), _kurl->host() ); + if( ( _protocol->fields() | _protocol->urlFields() ) & KIO_Protocol::port ) + cfg.writeEntry(fu(PortConfigKey), _kurl->port() ); + if( ( _protocol->fields() | _protocol->urlFields() ) & KIO_Protocol::username ) + cfg.writeEntry(fu(UserConfigKey), _kurl->user() ); + if( ( _protocol->fields() | _protocol->urlFields() ) & KIO_Protocol::mailbox ) + cfg.writeEntry(fu(MailboxConfigKey), _kurl->path() ); + if( ( _protocol->fields() | _protocol->urlFields() ) & KIO_Protocol::password ) + cfg.writeEntry(fu(PassConfigKey), p ); + if( ( _protocol->fields() | _protocol->urlFields() ) & KIO_Protocol::auth ) + cfg.writeEntry(fu(AuthConfigKey), auth() ); + */ + return true; +} + +KKioDrop& KKioDrop::operator = ( const KKioDrop& other ) +{ + *_kurl=*other._kurl; + setFreq( other.freq() ); + + if( other._protocol ) + _protocol = other._protocol->getKIOProtocol(); + _ssl = other._ssl; + + return *this; +} + +//Public slots +void KKioDrop::readSubjectsCanceled() +{ + _subjects->cancelled(); +} + +void KKioDrop::readMailCanceled() +{ + _read->canceled( ); +} + +void KKioDrop::deleteMailsCanceled() +{ + _delete->canceled( ); +} + +//Private slots for displaying connection errors +void KKioDrop::slotConnectionError( int number, const QString& arg ) +{ + kdError() << KIO::buildErrorString( number, arg ) << endl; +// if( passivePopup() ) + emitShowPassivePopup( KIO::buildErrorString( number, arg ) ); +} + +void KKioDrop::slotConnectionWarning( const QString& msg ) +{ + kdWarning() << msg << endl; +} + +void KKioDrop::slotConnectionInfoMessage( const QString& msg ) +{ + kdDebug() << msg << endl; //Display only in debug modes +} + +//Private slots + +//The next functions are needed for process maildrops. +bool KKioDrop::startProcess() +{ //code copyied from edrop.cpp + + if( _protocol->configName() != "process" ) + return true; + + if( _process != 0 ) { + return false; + } + + // debug( "proc start: %s", _command.data() ); + + _process = new KProcess; + _process->setUseShell( true ); + + // only reading stdin yet + + connect( _process,SIGNAL(receivedStdout( KProcess *, char *, int)), + this, SLOT(receivedStdout( KProcess *,char *,int)) ); + connect( _process, SIGNAL(processExited(KProcess*)), + this, SLOT(processExit(KProcess*)) ); + *_process << _kurl->path(); + _process->start( KProcess::NotifyOnExit, KProcess::Stdout ); + + return true; +} + +bool KKioDrop::stopProcess() +{ //code copied from edrop.cpp + if( _protocol->configName() != "process" ) + return true; + + if( _process != 0 ) { + // debug( "proc stop" ); + _process->kill( SIGHUP ); + delete _process; + _process = 0; + } + + return true; +} + +void KKioDrop::receivedStdout( KProcess *proc, char * buffer, int /*len*/ ) +{ + assert(static_cast(proc) == static_cast(_process)); + + //Original code + /*char *buf = new char[ len + 1 ]; + memcpy( buf, buffer, len ); + buf[ len ] = '\0'; + + char *ptr = buf, *start = buf; + int num = 0; + + while( *ptr ) { + // find number + while( *ptr && !isdigit( *ptr ) ) { + ptr++; + } + start = ptr; + if( *ptr == 0 ) { + break; + } + + // find end + while( *ptr && isdigit( *ptr ) ) { + ptr++; + } + + // atoi number + char back = *ptr; + *ptr = 0; + num = atoi( start ); + *ptr = back; + } + + emit changed( num ); + delete [] buf;*/ + + //Alternatieve code + QString buf = buffer; + QRegExp regexp( "^(.*\\D+|\\D*)(\\d+)\\D*$" ); + + if( regexp.search( buf ) == 0 ) + { //Number found + emit changed( regexp.cap( 2 ).toInt(), this ); + } + + +} + +void KKioDrop::processExit(KProcess* proc) +{ + assert(static_cast(proc) == static_cast(_process)); + + _process = 0; + +// debug( "proc exited" ); +} + +const char *KKioDrop::ProtoConfigKey = "protocol"; +const char *KKioDrop::HostConfigKey = "server"; +const char *KKioDrop::PortConfigKey = "port"; +const char *KKioDrop::UserConfigKey = "username"; +const char *KKioDrop::PassConfigKey = "password"; +const char *KKioDrop::MailboxConfigKey = "mailbox"; +const char *KKioDrop::SavePassConfigKey = "savepass"; +const char *KKioDrop::MetadataConfigKey = "metadata"; + +#include "kio.moc" diff --git a/korn/kio.h b/korn/kio.h new file mode 100644 index 00000000..8ffde2f4 --- /dev/null +++ b/korn/kio.h @@ -0,0 +1,207 @@ +/* + * Copyright (C) Kurt Granroth + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +/* + * kio.h -- Declaration of class KKIODrop. + */ +#ifndef KEG_KIODROP_H +#define KEG_KIODROP_H + +#include "polldrop.h" + +class QWidget; +class KDropDialog; +class KornMailSubject; +class KProcess; +class KIO_Count; +class KIO_Protocol; +class KIO_Subjects; +class KIO_Read; +class KIO_Delete; +class KConfigGroup; +class KURL; +template class QPtrList; +template class QValueList; +namespace KIO { class Job; class MetaData; class Slave; class TransferJob; } + +/** + * Polling monitor for IMAP4 maildrops. + * @author Kurt Granroth (granroth@kde.org) + * Changes to poll with KIO + * @author Mart Kelder (mart.kde@hccnet.nl) + * $version $Id$ + */ +class KKioDrop : public KPollableDrop +{ + Q_OBJECT +private: + KURL *_kurl; + KIO::MetaData *_metadata; + + QString _password; + + bool _valid; + + const KIO_Protocol * _protocol; + bool _ssl; + + KIO_Count *_count; + KIO_Subjects *_subjects; + KIO_Read *_read; + KIO_Delete *_delete; + + int _readSubjectsTotalSteps; + int _deleteMailsTotalSteps; + //For process + KProcess *_process; + + //List of mailurls fetched by the last time emails were counted + struct FileInfo { + QString name; + long size; + }; + QValueList *_mailurls; + + /* + * The help-classes of this functions are friend functions, because this way, they can + * access the _kurl and _metadata-values without a function; and this way, no signal or + * public functions are neccesairy to emit a signal from KKioDrop. + */ + friend class KIO_Count; + friend class KIO_Subjects; + friend class KIO_Read; + friend class KIO_Delete; + friend class KIO_Single_Subjects; +public: + static const char *ProtoConfigKey; + static const char *HostConfigKey; + static const char *PortConfigKey; + static const char *UserConfigKey; + static const char *MailboxConfigKey; + static const char *PassConfigKey; + static const char *SavePassConfigKey; + static const char *MetadataConfigKey; + +public: + /** + * KKioDrop Constructor + */ + KKioDrop(); + KKioDrop( KConfigGroup* ); + + /** + * Set the server that will be checked for new mail. + */ + void setKioServer( const QString & proto, const QString & server, int port = -1 ); + void setKioServer( const QString & proto, const QString & server, int port, + const KIO::MetaData metadata, bool ssl, bool setProtocol = true ); //Last argument inits _protocol + + /** Set the account information for the PROTO server. */ + void setUser( const QString & user, const QString & password, const QString & mailbox, const QString & auth ); + + // The next functions return settings + QString protocol() const; + QString server() const; + int port() const; + + QString user() const; + QString password() const; + QString mailbox() const; + QString auth() const; + + virtual void recheck(); + virtual void forceRecheck(); + + virtual bool valid(); + + /** + * KKioDrop Destructor + */ + virtual ~KKioDrop(); + + virtual bool canReadSubjects(void); + virtual QValueVector * doReadSubjects(bool * stop); + + virtual bool canDeleteMails(); + virtual bool deleteMails(QPtrList * ids, bool * stop); + + virtual bool canReadMail (); + virtual QString readMail(const KornMailId * id, bool * stop); + + virtual KMailDrop* clone () const ; + virtual bool readConfigGroup ( const QMap< QString, QString >& map, const Protocol * protocol ); + virtual bool writeConfigGroup ( KConfigBase& cfg ) const; + virtual QString type() const { return QString::fromUtf8("kio"); } + + virtual bool synchrone() const { return false; } //class is not synchrone + + //virtual void addConfigPage( KDropCfgDialog * ); + + virtual bool asynchrone() const { return true; } + +private: + KKioDrop& operator = ( const KKioDrop& ); + //static void encrypt( QString& str ); + //static void decrypt( QString& str ); + + /* + * The next functions are called from the help-classes (which are friend of the class). + * The only thing this functions do is emitting signals. + */ + void emitRechecked() { emit rechecked(); } + void emitChanged( int value ) { emit changed( value, this ); } + + void emitReadSubjectsReady( bool success ) { emit readSubjectsReady( success ); } + void emitReadSubjectsRead( KornMailSubject * subject ) { emit readSubject( subject ); } + void emitReadSubjectsTotalSteps( int value ) { _readSubjectsTotalSteps = value; emit readSubjectsTotalSteps( value ); } + void emitReadSubjectsProgress( int value ) { emit readSubjectsProgress( _readSubjectsTotalSteps - value ); } + + void emitReadMailReady( QString* msg ) { emit readMailReady( msg ); } + + void emitDeleteMailsReady( bool value ) { emit deleteMailsReady( value ); } + void emitDeleteMailsTotalSteps( int value ) { _deleteMailsTotalSteps = value; emit deleteMailsTotalSteps( value ); } + void emitDeleteMailsProgress( int value ) { emit deleteMailsProgress( _deleteMailsTotalSteps - value ); } + + void emitShowPassivePopup( QPtrList< KornMailSubject > *subject, int total ) + { emit showPassivePopup( subject, total, passiveDate(), this->realName() ); } + void emitShowPassivePopup( const QString& error ) + { if( passivePopup() ) { emit showPassivePopup( error, this->realName() ); } } + void emitValidChanged() { emit validChanged( valid() ); } + +private slots: + void slotConnectionError( int, const QString& ); + void slotConnectionWarning( const QString& ); + void slotConnectionInfoMessage( const QString& ); + +protected: + //The next functions are needed for Process; + virtual bool startProcess(); + virtual bool stopProcess(); + +public slots: + virtual void readSubjectsCanceled(); + virtual void readMailCanceled(); + virtual void deleteMailsCanceled(); + +private slots: + //For Process too + void processExit(KProcess*); + void receivedStdout( KProcess *, char *, int); +}; +#endif // KEG_KIODROP_H diff --git a/korn/kio_count.cpp b/korn/kio_count.cpp new file mode 100644 index 00000000..e82827bb --- /dev/null +++ b/korn/kio_count.cpp @@ -0,0 +1,330 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "kio_count.h" + +#include "kio.h" +#include "kio_proto.h" +#include "kio_single_subject.h" +#include "mailsubject.h" +#include "sortedmailsubject.h" + +#include +#include +#include +#include +#include +#include +#include + +#include + +KIO_Count::KIO_Count( QObject * parent, const char * name ) + : QObject ( parent, name ), + _kurl( 0 ), + _metadata( 0 ), + _protocol( 0 ), + _valid( true ), + _new_mailurls( 0 ), + _subjects_pending( 0 ), + _total_new_messages( 0 ), + _popup_subjects( 0 ) +{ +} + +KIO_Count::~KIO_Count() +{ + // Delete copies of urls. + delete _kurl; + delete _metadata; +} + +void KIO_Count::count( KKioDrop *drop ) +{ + if( _new_mailurls ) + return; //A counting is pending, so no new one is started. + + delete _kurl; + delete _metadata; + _kio = drop; + + /* + * Saving current settings: all actions are asynchroon, so if someone + * use slow servers, settings could been changed before this class is + * finished with counten. To be able to track back te staring values; + * these are saved in the class. + */ + _kurl = new KURL( *_kio->_kurl ); + _metadata = new KIO::MetaData( *_kio->_metadata ); + _protocol = _kio->_protocol; + + KURL kurl = *_kurl; + KIO::MetaData metadata = *_metadata; + + // Serup a connection + if( _protocol->connectionBased( ) ) + { + _protocol->recheckConnectKURL( kurl, metadata ); + + if( kurl.port() == 0 ) + kurl.setPort( _protocol->defaultPort( _kio->_ssl ) ); + + if( ! ( _slave = KIO::Scheduler::getConnectedSlave( kurl, metadata ) ) ) //Forcing reload + { + kdWarning() << i18n( "Not able to open a kio slave for %1." ).arg( _protocol->configName() ) << endl; + _kio->emitShowPassivePopup( i18n( "Not able to open a kio slave for %1." ).arg( _protocol->configName() ) ); + _valid = false; + _kio->emitValidChanged(); + _slave = 0; + //delete _new_mailurls; _new_mailurls = 0; //No connection pending + return; + } + + connect( _slave, SIGNAL( error( int, const QString& ) ), _kio, SLOT( slotConnectionError( int, const QString& ) ) ); + connect( _slave, SIGNAL( warning( const QString& ) ), _kio, SLOT( slotConnectionWarning( const QString& ) ) ); + connect( _slave, SIGNAL( infoMessage( const QString& ) ), _kio, SLOT( slotConnectionInfoMessage( const QString& ) ) ); + + /* + * _protocol->recheckConnectKURL could have change kurl and metadata in order to have the right + * settings to connect. But some other functions assumed unmodified settings, + * so the settings are set back to his originals. + */ + kurl = *_kurl; + metadata = *_metadata; + } + else + { + _slave = 0; //Prevent disconnecting not-existing slave + } + + /* Blocking this function: no new counts can be started from now */ + _new_mailurls = new QValueList< KKioDrop::FileInfo >; + + _protocol->recheckKURL( kurl, metadata ); + + if( kurl.port() == 0 ) + kurl.setPort( _protocol->defaultPort( _kio->_ssl ) ); + + //Making job to fetch file-list + + _job = KIO::listDir( kurl, false ); + _job->addMetaData( metadata ); + + connect( _job, SIGNAL( result( KIO::Job* ) ), this, SLOT( result( KIO::Job* ) ) ); + connect( _job, SIGNAL( entries( KIO::Job*, const KIO::UDSEntryList& ) ), + this, SLOT( entries( KIO::Job*, const KIO::UDSEntryList& ) ) ); + + if( _protocol->connectionBased() ) + KIO::Scheduler::assignJobToSlave( _slave, _job ); + else + KIO::Scheduler::scheduleJob( _job ); +} + +void KIO_Count::stopActiveCount() +{ + if( !_new_mailurls ) + return; + + disconnect( _job, SIGNAL( result( KIO::Job* ) ), this, SLOT( result( KIO::Job* ) ) ); + disconnect( _job, SIGNAL( entries( KIO::Job*, const KIO::UDSEntryList& ) ), + this, SLOT( entries( KIO::Job*, const KIO::UDSEntryList& ) ) ); + + KIO::Scheduler::cancelJob( _job ); + + if( _slave ) + { + //Slave seems to be disconnected by canceling the last job of the slave + //KIO::Scheduler::disconnectSlave( _slave ); + _slave = 0; + } + + //Deletings settings + delete _kurl; _kurl = 0; + delete _metadata; _metadata = 0; + + delete _new_mailurls; _new_mailurls = 0; +} + +void KIO_Count::showPassive( const QString& id ) +{ + KURL kurl = *_kio->_kurl; + KIO::MetaData metadata = *_kio->_metadata; + kurl = id; + //KIO::Slave *slave = 0; + + _kio->_protocol->readSubjectKURL( kurl, metadata ); + if( kurl.port() == 0 ) + kurl.setPort( _kio->_protocol->defaultPort( _kio->_ssl ) ); + + KIO_Single_Subject *subject = new KIO_Single_Subject( this, id.latin1(), kurl, metadata, _kio->_protocol, _slave, id, 0 ); + + _subjects_pending++; + + connect( subject, SIGNAL( readSubject( KornMailSubject* ) ), this, SLOT( addtoPassivePopup( KornMailSubject* ) ) ); + connect( subject, SIGNAL( finished( KIO_Single_Subject* ) ), this, SLOT( deleteSingleSubject( KIO_Single_Subject* ) ) ); +} + +void KIO_Count::disconnectSlave() +{ + if( _subjects_pending > 0 ) + return; //Still getting data + + if( !_protocol->connectionBased() ) + return; //Protocol doesn't have a connection + + if( !_slave ) + return; //Slave doens't exist + + //Disconnect slave + KIO::Scheduler::disconnectSlave( _slave ); + _slave = 0; + _protocol = 0; +} + +//This function is called when fetching is over +void KIO_Count::result( KIO::Job* job ) +{ + //job should be the latest job; elsewise: print an error. + if( job != _job ) + kdError() << i18n( "Got unknown job; something must be wrong..." ) << endl; + + //look of an error occurred. If there is, print the error. + //This could be very useful by resolving bugs. + if( job->error() ) + { + kdError() << i18n( "The next KIO-error occurred by counting: %1" ).arg( job->errorString() ) << endl; + _kio->emitShowPassivePopup( i18n( "The next KIO-error occurred by counting: %1" ).arg( job->errorString() ) ); + _valid = false; + _kio->emitValidChanged(); + } + + disconnect( job, SIGNAL( result( KIO::Job* ) ), this, SLOT( result( KIO::Job* ) ) ); + disconnect( job, SIGNAL( entries( KIO::Job*, const KIO::UDSEntryList& ) ), + this, SLOT( entries( KIO::Job*, const KIO::UDSEntryList& ) ) ); + + disconnectSlave(); + + //Deletings settings + delete _kurl; _kurl = 0; + delete _metadata; _metadata = 0; + + if( _kio->_mailurls->count() != _new_mailurls->count() ) + { + *_kio->_mailurls = *_new_mailurls; + _kio->emitChanged(_kio->_mailurls->count()); + } + else + { + *_kio->_mailurls = *_new_mailurls; + } + delete _new_mailurls; _new_mailurls = 0; + + _valid = true; + _kio->emitValidChanged(); + _kio->emitRechecked(); +} + +//An file list is ready; now save it in _kio->_mailurls. +void KIO_Count::entries( KIO::Job* job, const KIO::UDSEntryList &list ) +{ + QStringList old_list; + KIO::UDSEntryListConstIterator it1 ; + KIO::UDSEntry::ConstIterator it2 ; + KIO::MetaData metadata; + KURL kurl; + bool isFile; + + //job should be the latest job + if( job != _job ) + kdError() << i18n( "Got unknown job; something must be wrong..." ) << endl; + + for( QValueListConstIterator it = _kio->_mailurls->begin(); it != _kio->_mailurls->end(); ++it ) + old_list.append( (*it).name ); + + for ( it1 = list.begin() ; it1 != list.end() ; it1++ ) + { + /* + * The list contains multiple objects. Each object could be a file. + * Settings about it are saved in this scope until it is added to the list. + */ + isFile=false; + KKioDrop::FileInfo fileinfo; + fileinfo.name = QString::null; + fileinfo.size = 0; + + for ( it2 = (*it1).begin() ; it2 != (*it1).end() ; it2++ ) + { + if( (*it2).m_uds == KIO::UDS_FILE_TYPE && + ((long)(*it2).m_long & S_IFREG ) ) + isFile=true; + else if( (*it2).m_uds == KIO::UDS_URL ) + fileinfo.name = (*it2).m_str; + else if( (*it2).m_uds == KIO::UDS_NAME ) + { //The file kioslave doesn't return UDS_URL. + kurl = *_kurl; + metadata = *_metadata; + _protocol->recheckKURL( kurl, metadata ); + kurl.setPath ( kurl.path() + '/' + (*it2).m_str ); + fileinfo.name = kurl.url(); + } + else if( (*it2).m_uds == KIO::UDS_SIZE ) + { + fileinfo.size = (*it2).m_long; + } + } + + //Add the entry. + if( ! fileinfo.name.isNull() && isFile ) + { + _new_mailurls->append( fileinfo ); + if( ! old_list.contains( fileinfo.name ) && _kio->passivePopup() ) + showPassive( fileinfo.name ); + } + } +} + +void KIO_Count::addtoPassivePopup( KornMailSubject* subject ) +{ + if( ! _popup_subjects ) + { + _popup_subjects = new SortedMailSubject; + _popup_subjects->setAutoDelete( true ); + } + + _popup_subjects->inSort( subject ); + if( _popup_subjects->count() > 5 ) + _popup_subjects->removeFirst(); //Overhead: subject is downloaded + + _subjects_pending--; + _total_new_messages++; + if( _subjects_pending == 0 ) + { + _kio->emitShowPassivePopup( dynamic_cast< QPtrList* >( _popup_subjects ), _total_new_messages ); + delete _popup_subjects; _popup_subjects = 0; + _total_new_messages = 0; + + disconnectSlave(); + } +} + +void KIO_Count::deleteSingleSubject( KIO_Single_Subject* single_subject ) +{ + delete single_subject; +} + +#include "kio_count.moc" diff --git a/korn/kio_count.h b/korn/kio_count.h new file mode 100644 index 00000000..c9a1b9f0 --- /dev/null +++ b/korn/kio_count.h @@ -0,0 +1,81 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_KIOCOUNT_H +#define MK_KIOCOUNT_H + +//This class count the number of message available. + +#include + +#include "kio.h" //Alsewise, no access to KKioDrop::FileInfo (needed in template) + +#include //FIXME: without this, moc-compiler fails. + +class KIO_Protocol; +class KIO_Single_Subject; +class KKioDrop; + +class KornMailSubject; +class SortedMailSubject; + +template class QValueList; +namespace KIO { class Job; class ListJob; class MetaData; class Slave; } + +class KURL; + +class QString; + +class KIO_Count : public QObject +{ Q_OBJECT +public: + KIO_Count( QObject * parent = 0, const char * name = 0 ); + ~KIO_Count(); + + //This function starts counting + void count( KKioDrop* ); + + //This functions returns true of no error has occurred. + bool valid( ) { return _valid; } + + void stopActiveCount(); +private: + KKioDrop *_kio; + KIO::ListJob *_job; + KIO::Slave *_slave; + KURL *_kurl; + KIO::MetaData *_metadata; + const KIO_Protocol *_protocol; + bool _valid; + QValueList *_new_mailurls; //entries can come with more function calls. + int _subjects_pending; + int _total_new_messages; + SortedMailSubject *_popup_subjects; +private: + void showPassive( const QString& ); + void disconnectSlave(); + +private slots: + void result( KIO::Job* ); + void entries( KIO::Job*, const KIO::UDSEntryList &list ); + + void addtoPassivePopup( KornMailSubject* ); + void deleteSingleSubject( KIO_Single_Subject* ); +}; + +#endif diff --git a/korn/kio_delete.cpp b/korn/kio_delete.cpp new file mode 100644 index 00000000..78c2d88a --- /dev/null +++ b/korn/kio_delete.cpp @@ -0,0 +1,201 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "kio_delete.h" + +#include "mailid.h" +#include "stringid.h" +#include "kio.h" +#include "kio_proto.h" + +#include +#include +#include +#include +#include +#include + +#include + +KIO_Delete::KIO_Delete( QObject * parent, const char * name ) : QObject( parent, name ), + _kio( 0 ), + _total( 0 ), + _jobs( 0 ), + _slave( 0 ), + _valid( true ) +{ + _jobs = new QPtrList< KIO::Job >; +} + +KIO_Delete::~KIO_Delete( ) +{ + disConnect( ); + delete _jobs; +} + +bool KIO_Delete::deleteMails( QPtrList< const KornMailId > * ids, KKioDrop *drop ) +{ + KURL kurl = *drop->_kurl; + KIO::MetaData metadata = *drop->_metadata; + + _kio = drop; + _valid = true; + + //disConnect earlier operations + disConnect( ); + if( _kio->_protocol->connectionBased( ) ) + { + if( ! setupSlave( kurl, metadata, _kio->_protocol ) ) + { + _valid = false; + return false; + } + } + + _total = ids->count( ); + + for( const KornMailId * item = ids->first(); item; item = ids->next() ) + deleteItem( item, kurl, metadata, _kio->_protocol ); + + if( _jobs->count() == 0 ) + { + _kio->emitDeleteMailsReady( true ); + disConnect( ); + return true; + } + + if( _kio->_protocol->commitDelete() ) + commitDelete( kurl, metadata, _kio->_protocol ); + + _kio->emitDeleteMailsTotalSteps( _total ); + + return true; +} + +void KIO_Delete::disConnect( ) +{ + _jobs->clear( ); + + if( _slave ) + { + KIO::Scheduler::disconnectSlave( _slave ); + _slave = 0; + } +} + +bool KIO_Delete::setupSlave( KURL kurl, KIO::MetaData metadata, const KIO_Protocol *& protocol ) +{ + protocol->deleteMailConnectKURL( kurl, metadata ); + + if( kurl.port() == 0 ) + kurl.setPort( protocol->defaultPort( _kio->_ssl ) ); + + if( ! ( _slave = KIO::Scheduler::getConnectedSlave( kurl, metadata ) ) ) + { + kdWarning() << i18n( "Could not get a connected slave; I cannot delete this way..." ) << endl; + _valid = false; + return false; + } + + return true; +} + +void KIO_Delete::deleteItem( const KornMailId *item, KURL kurl, KIO::MetaData metadata, const KIO_Protocol *& protocol ) +{ + KIO::Job* job = 0; + + kurl = dynamic_cast( item )->getId(); + + protocol->deleteMailKURL( kurl, metadata ); + + if( kurl.port() == 0 ) + kurl.setPort( protocol->defaultPort( _kio->_ssl ) ); + + if( protocol->deleteFunction() == KIO_Protocol::get ) + { + job = KIO::get( kurl, true, false ); + + if( protocol->connectionBased() ) + KIO::Scheduler::assignJobToSlave( _slave, dynamic_cast< KIO::SimpleJob* >( job ) ); + else + KIO::Scheduler::scheduleJob( dynamic_cast< KIO::SimpleJob* >( job ) ); + } + else if( protocol->deleteFunction() == KIO_Protocol::del ) + { + job = KIO::del( kurl, false, false ); + } + else + return; //Unknown deleteFunction + + connect( job, SIGNAL( result( KIO::Job* ) ), this, SLOT( slotResult( KIO::Job* ) ) ); + + job->addMetaData( metadata ); + + _jobs->append( dynamic_cast< KIO::Job* >( job ) ); +} + +/* + * Some protocols needs to a command to commit protocols. + */ +void KIO_Delete::commitDelete( KURL kurl, KIO::MetaData metadata, const KIO_Protocol *& protocol ) +{ + protocol->deleteCommitKURL( kurl, metadata ); + + if( kurl.port() == 0 ) + kurl.setPort( protocol->defaultPort( _kio->_ssl ) ); + + KIO::TransferJob *job = KIO::get( kurl, true, false ); + job->addMetaData( metadata ); + connect( job, SIGNAL( result( KIO::Job* ) ), this, SLOT( slotResult( KIO::Job* ) ) ); + + _jobs->append( dynamic_cast< KIO::Job* >( job ) ); + + if( protocol->connectionBased() ) + KIO::Scheduler::assignJobToSlave( _slave, job ); + else + KIO::Scheduler::scheduleJob( job ); + + _total++; +} + +void KIO_Delete::canceled( ) +{ + disConnect( ); +} + +void KIO_Delete::slotResult( KIO::Job* job ) +{ + if( job->error() ) + { + kdWarning() << i18n( "An error occurred when deleting email: %1." ).arg( job->errorString() ) << endl; + _valid = false; + } + + _jobs->remove( job ); + + _kio->emitDeleteMailsProgress( _total - _jobs->count() ); + + if( _jobs->isEmpty() ) + { + _kio->emitDeleteMailsReady( _valid ); + disConnect(); + } +} + + +#include "kio_delete.moc" diff --git a/korn/kio_delete.h b/korn/kio_delete.h new file mode 100644 index 00000000..a22c6f17 --- /dev/null +++ b/korn/kio_delete.h @@ -0,0 +1,69 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_KIO_DELETE_H +#define MK_KIO_DELETE_H + +/* + * This class handles removing of selected messages. + * This class starts working when deleteMails() is called. + */ + +#include +class KKioDrop; +class KIO_Protocol; +class KornMailId; + +class KURL; +namespace KIO { class MetaData; class Job; class Slave; } + +template class QPtrList; + +class KIO_Delete : public QObject +{ Q_OBJECT +public: + //constructors + KIO_Delete( QObject * parent = 0, const char * name = 0 ); + ~KIO_Delete( ); + + //This function should be called if there are messages to be deleted. + bool deleteMails( QPtrList< const KornMailId > *, KKioDrop* ); + + //This function should return false then and only then if an error occurred. + bool valid( ) { return _valid; } + +public slots: + //If this slot is called, the whole deletion is canceled. + void canceled( ); +private slots: + void slotResult( KIO::Job* ); + +private: + void disConnect( ); + bool setupSlave( KURL kurl, KIO::MetaData metadata, const KIO_Protocol *& protocol ); + void deleteItem( const KornMailId *item, KURL, KIO::MetaData, const KIO_Protocol *&); + void commitDelete( KURL, KIO::MetaData, const KIO_Protocol *& ); + + KKioDrop *_kio; + unsigned int _total; + QPtrList< KIO::Job > *_jobs; + KIO::Slave *_slave; + bool _valid; +}; + +#endif //MK_KIO_DELETE_H diff --git a/korn/kio_proto.cpp b/korn/kio_proto.cpp new file mode 100644 index 00000000..a3de2272 --- /dev/null +++ b/korn/kio_proto.cpp @@ -0,0 +1,81 @@ +/* + * Copyright (C) 2005, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + + +#include "kio_proto.h" + +#include +#include + +#include + +QMap< QString, QString >* KIO_Protocol::createConfig( KConfigGroup * group, const QString& password ) const +{ + QMap< QString, QString > *result = new QMap< QString, QString >; + + result->insert( "name", group->readEntry( "name", "" ) ); + result->insert( "server", group->readEntry( "server", "" ) ); + result->insert( "port", group->readEntry( "port", "" ) ); + result->insert( "username", group->readEntry( "username", "" ) ); + result->insert( "password", password ); + result->insert( "mailbox", group->readEntry( "mailbox", "" ) ); + result->insert( "savepassword", group->readEntry( "savepassword", "false" ) ); + result->insert( "ssl", group->readEntry( "ssl", "false" ) ); + result->insert( "metadata", group->readEntry( "metadata", "" ) ); + + return result; +} + +void KIO_Protocol::clearFields( QMap *map, const KIO_Protocol::Fields fields ) const +{ + if( fields & server ) + map->insert( "server", "" ); + if( fields & port ) + map->insert( "port", "" ); + if( fields & username ) + map->insert( "username", "" ); + if( fields & password ) + map->insert( "password", "" ); + if( fields & mailbox ) + map->insert( "mailbox", "" ); + if( fields & save_password ) + map->insert( "savepassword", "" ); + if( fields & metadata ) + map->insert( "metadata", "" ); +} + +void KIO_Protocol::readEntries( QMap< QString, QString >* map ) const +{ + QMap< QString, QString> *metadata = new QMap< QString, QString >; + + if( map->contains( "metadata" ) ) + { + QStringList list = QStringList::split( ",", *map->find( "metadata" ) ); + QStringList::Iterator it; + for( it = list.begin(); it != list.end(); ++it ) + { + int split = (*it).find( '=' ); + + metadata->insert( (*it).left( split ), (*it).right( (*it).length() - split - 1 ) ); + } + } + + this->readEntries( map, metadata ); + + delete metadata; +} diff --git a/korn/kio_proto.h b/korn/kio_proto.h new file mode 100644 index 00000000..3770f120 --- /dev/null +++ b/korn/kio_proto.h @@ -0,0 +1,157 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_KIO_PROTO_H +#define MK_KIO_PROTO_H + +/* + * KIO can handle multiple protocols. But some protocols have their own + * manipulations of KURL or MetaData , and some protocols could do more then other + * protocols. So, this class is the generic class of a class specified + * by a protocol. + */ + +class QString; +#include +#include +#include +#include "protocol.h" + +#include "kio.h" + +class KIO_Protocol : public Protocol +{ +public: + /* + * Constuctor; empty + */ + KIO_Protocol() {} + + /* + * Destructor; empty too + */ + virtual ~KIO_Protocol() {} + + /* + * Public enumeration + */ + enum DeleteTypeEnum { get, del }; + /** + * This are the implementation of the Protocol-functions + */ + virtual const Protocol* getProtocol( KConfigGroup* ) const { return this; } + + virtual KMailDrop* createMaildrop( KConfigGroup* config ) const { return new KKioDrop( config ); } + + virtual QMap< QString, QString >* createConfig( KConfigGroup *group, const QString& password ) const; + + /* + * @return: the name of the kio_slave + */ + virtual QString protocol( bool ) const { return "file"; } + + /* + * @return: the name of the protocol used by the configuration + */ + virtual QString configName() const { return "not specified"; } + + virtual bool connectionBased() const { return false; } + + /* + * The next four functions return the [capebilities] of a protocol. + * fullMessage means that by downloaden, the whole message is downloaded. + * if it is false, only the headers should be downloaded. + */ + virtual bool canReadSubjects() const { return false; } + virtual bool canDeleteMail() const { return false; } + virtual bool canReadMail() const { return false; } + virtual bool fullMessage() const { return false; } + + /* + * The following lines are the options in the configuration; + * true means that an option is enabled; + * false means that the option is disabled. + */ + //virtual int fields() const { return server | port | username | password | mailbox; } + //virtual int urlFields() const { return no_fields; } + virtual unsigned short defaultPort( bool ) const { return 0; } + + /* + * This sets the string of such fields in Configuration + */ + virtual QString serverName() const { return i18n( "Server:" ); } + virtual QString portName() const { return i18n( "Port:" ); } + virtual QString usernameName() const { return i18n( "Username:" ); } + virtual QString mailboxName() const { return i18n( "Mailbox:" ); } + virtual QString passwordName() const { return i18n( "Password:" ); } + virtual QString savePasswordName() const { return i18n( "Save password" ); } + virtual QString authName() const { return i18n( "Authentication:" ); } + + /* + * The next function returns the method of deleting: some protoocols + * like to delete files with KIO::get; other with KIO::del + */ + virtual DeleteTypeEnum deleteFunction() const { return del; } + + /* + * The next options are the input for the Authentication Combo, seperated by '|'. + * The name should be the same as the auth-metadata. + */ + virtual QStringList authList() const { return QStringList::split( '|', "Plain", false ); } + + /* + * The next functions are manipulations of an KURL. + * At some points in the code, a KURL is used. But sometimes, + * these have to had a little retouch. That is possible with these function. + * + * For example, by imap, by default, the whole message is downloaded and marked as reed. + * By changing an option to the KURL path, this can be prevented. + * + * The most functions are recognized by name. + * commitDelete return true if a protocol has to confirm a deletion. + * It will be called after marking the messages for deletion. + * deleteCommitKURL is the KURL manipulator; the KURL is as in the settings. + * That KURL isn't retouch by deleteMailKURL. + */ + virtual void recheckConnectKURL( KURL &, KIO::MetaData & ) const { } + virtual void recheckKURL ( KURL &, KIO::MetaData & ) const { }; + virtual void readSubjectConnectKURL ( KURL & kurl, KIO::MetaData & ) const { kurl.setPath( "" ); } + virtual void readSubjectKURL ( KURL &, KIO::MetaData & ) const { } //For editing a kurl (adding extra options) + virtual void deleteMailConnectKURL( KURL & kurl, KIO::MetaData & ) const { kurl.setPath( "" ); } + virtual void deleteMailKURL ( KURL &, KIO::MetaData & ) const { } + virtual bool commitDelete() const { return false; } + virtual void deleteCommitKURL( KURL &, KIO::MetaData & ) const { } + virtual void readMailKURL ( KURL &, KIO::MetaData & ) const { } + + + virtual const KIO_Protocol* getKIOProtocol() const { return this; } + + virtual void readEntries( QMap< QString, QString >* ) const; + virtual void readEntries( QMap< QString, QString >*, QMap< QString, QString >* ) const = 0; + +protected: + /* + * This enumeration is used when returning the capebilitys of a protocol + */ + enum Fields { no_fields = 0, server = 1, port = 2, username = 4, password = 8, + mailbox = 16, save_password = 32, metadata = 64 }; + + void clearFields( QMap< QString, QString > *map, const Fields fields ) const; +}; + +#endif //MK_KIO_PROTO_H diff --git a/korn/kio_read.cpp b/korn/kio_read.cpp new file mode 100644 index 00000000..e1f5211e --- /dev/null +++ b/korn/kio_read.cpp @@ -0,0 +1,97 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "kio_read.h" + +#include "kio.h" +#include "kio_proto.h" +#include "mailid.h" +#include "stringid.h" + +#include +#include +#include +#include +#include +#include + +#include +#include + +KIO_Read::KIO_Read( QObject * parent, const char * name ) + : QObject( parent, name ), + _job( 0 ), + _message( 0 ) +{ + _message = new QString; +} + +KIO_Read::~KIO_Read() +{ + delete _message; + delete _job; +} + +void KIO_Read::readMail( const KornMailId *& mailid, KKioDrop* drop ) +{ + _kio = drop; + KURL kurl = *_kio->_kurl; + KIO::MetaData metadata = *_kio->_metadata; + + kurl = dynamic_cast(mailid)->getId( ); + + _kio->_protocol->readMailKURL( kurl, metadata ); + + _job = KIO::get( kurl, false, false ); + _job->addMetaData( metadata ); + + connect( _job, SIGNAL( result( KIO::Job* ) ), this, SLOT( slotResult( KIO::Job* ) ) ); + connect( _job, SIGNAL( data( KIO::Job*, const QByteArray& ) ), this, SLOT( slotData( KIO::Job*, const QByteArray & ) ) ); +} + +void KIO_Read::canceled( ) +{ + if( _job ) + delete _job; + _job = 0; +} + +void KIO_Read::slotResult( KIO::Job* job ) +{ + if( job != _job ) + kdWarning() << i18n( "Unknown job returned; I will try if this one will do... " ) << endl; + + if( job->error() ) + kdWarning() << i18n( "An error occurred when fetching the requested email: %1." ).arg( job->errorString() ) << endl; + + _kio->emitReadMailReady( _message ); + + *_message = ""; + _job = 0; +} + +void KIO_Read::slotData( KIO::Job* job, const QByteArray & data ) +{ + if( job != _job ) + kdWarning() << i18n( "Unknown job returned; I will try if this one will do... " ) << endl; + + if( !data.isEmpty() ) + _message->append( data ); +} + +#include "kio_read.moc" diff --git a/korn/kio_read.h b/korn/kio_read.h new file mode 100644 index 00000000..52dd986a --- /dev/null +++ b/korn/kio_read.h @@ -0,0 +1,60 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_KIO_READ_H +#define MK_KIO_READ_H + +//This class should be used if someone wants to read the Full Message + +#include + +class KKioDrop; +class KornMailId; + +class KURL; +namespace KIO { class MetaData; class Job; } +class KIO_Protocol; + +class QString; + +class KIO_Read : public QObject +{ Q_OBJECT +public: + KIO_Read( QObject * parent = 0, const char * name = 0 ); + ~KIO_Read(); + +public slots: + //This is the function which makes the nessesairy slaves for reading a message + void readMail( const KornMailId *&, KKioDrop* ); + //This function should be called if the user presses canceled. + void canceled(); +private: + KKioDrop *_kio; + KIO::Job *_job; + QString *_message; + +signals: + //This signal is emitted when the whole message is read; the message got passed as QString* + void ready( QString* ); + +private slots: + void slotResult( KIO::Job* ); + void slotData( KIO::Job*, const QByteArray& ); +}; + +#endif //MK_KIO_READ_H diff --git a/korn/kio_single_subject.cpp b/korn/kio_single_subject.cpp new file mode 100644 index 00000000..cdb70733 --- /dev/null +++ b/korn/kio_single_subject.cpp @@ -0,0 +1,155 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "kio_single_subject.h" + +#include "mailsubject.h" +#include "kio_proto.h" +#include "stringid.h" + +#include +#include +#include +#include +#include +#include +#include +#include + +#include +#include +#include + +KIO_Single_Subject::KIO_Single_Subject( QObject * parent, const char * name, + KURL &kurl, KIO::MetaData &metadata, const KIO_Protocol * protocol, KIO::Slave *& slave, + const QString &url, const long size ) + : QObject( parent, name ) +{ + _kurl = new KURL( kurl ); + _metadata = new KIO::MetaData( metadata ); + _protocol = protocol; + _name = new QString( url ); + _size = size; + _message = new QString; + + init( slave ); +} + +KIO_Single_Subject::~KIO_Single_Subject( ) +{ + if( _job ) + KIO::Scheduler::cancelJob( _job ); + delete _kurl; + delete _metadata; + delete _name; + delete _message; +} + +void KIO_Single_Subject::init( KIO::Slave *& slave) +{ + _job = KIO::get( *_kurl, false, false ); + _job->addMetaData( *_metadata ); + + connect( _job, SIGNAL( result( KIO::Job* ) ), this, SLOT( slotResult( KIO::Job* ) ) ); + connect( _job, SIGNAL( data (KIO::Job *, const QByteArray &) ), + this, SLOT( slotData(KIO::Job *, const QByteArray &) ) ); + + if( _protocol->connectionBased( ) && slave ) + KIO::Scheduler::assignJobToSlave( slave , _job ); + else + KIO::Scheduler::scheduleJob( _job ); + +} + +void KIO_Single_Subject::parseMail( QString * message, KornMailSubject *subject, bool fullMessage ) +{ + QTextStream stream( message, IO_ReadOnly ); + QString line; + QRegExp rx_sender( "^[fF]rom: " ); //Ex: From: ... + QRegExp rx_sender_has_name1( "^[fF]rom:\\s*(\\w+[\\w\\s]*)\\<" ); //Ex: From: A name + QRegExp rx_sender_has_name2( "^[fF]rom:\\s*\\\"\\s*(\\w+[\\w\\s]*)\\\""); //Ex: From: "A name" + QRegExp rx_subject( "^[sS]ubject: " ); //Ex: Subject: ... + QRegExp rx_date ( "^[dD]ate: "); + bool inheader = true; + int fieldnumber = 0; + + while ( ! stream.atEnd() ) + { + line = stream.readLine(); + if( line.isEmpty() && fieldnumber >= 2 ) + inheader = false; + + if( inheader ) + { + if( rx_sender.search( line ) == 0 ) + { + if( rx_sender_has_name1.search( line ) == 0 ) + subject->setSender( rx_sender_has_name1.cap( 1 ) ); + else if(rx_sender_has_name2.search( line ) == 0) + subject->setSender( rx_sender_has_name2.cap( 1 ) ); + else + subject->setSender( line.remove( rx_sender ) ); + ++fieldnumber; + } + else if( rx_subject.search( line ) == 0 ) + { + subject->setSubject( line.remove( rx_subject ) ); + ++fieldnumber; + } + else if( rx_date.search( line ) == 0 ) + { + subject->setDate( KRFCDate::parseDate( line.right( line.length() - 6 ) ) ); + ++fieldnumber; + } + } + } + + subject->setHeader( *message, fullMessage ); +} + +void KIO_Single_Subject::slotData( KIO::Job* job, const QByteArray& data ) +{ + if( job != _job ) + kdWarning() << i18n( "Got invalid job; something strange happened?" ) << endl; + if( !data.isEmpty() ) + _message->append( data ); +} + +//KIO::Scheduler::disconnectSlave missing if connection stops +void KIO_Single_Subject::slotResult( KIO::Job *job ) +{ + if( job != _job ) + kdWarning() << i18n( "Got invalid job; something strange happened?" ) << endl; + + if( job->error() ) + { + kdWarning() << i18n( "Error when fetching %1: %2" ).arg( *_name ).arg( job->errorString() ) << endl; + } else { + KornMailSubject * mailSubject = new KornMailSubject( new KornStringId( *_name ), 0 ); + parseMail( _message, mailSubject, _protocol->fullMessage() ); + mailSubject->decodeHeaders(); + mailSubject->setSize( _size ); + emit readSubject( mailSubject ); + } + + _job = 0; + + emit finished( this ); +} + +#include "kio_single_subject.moc" diff --git a/korn/kio_single_subject.h b/korn/kio_single_subject.h new file mode 100644 index 00000000..d235680a --- /dev/null +++ b/korn/kio_single_subject.h @@ -0,0 +1,68 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_KIO_SINGEL_SUBJECT_H +#define MK_KIO_SINGEL_SUBJECT_H + +//This function reads a single subject + +#include + +class KornMailSubject; + +class KURL; +namespace KIO { class MetaData; class Job; class TransferJob; class Slave; } +class KIO_Protocol; + +class QString; +template class QMemArray; +typedef QMemArray QByteArray; + +class KIO_Single_Subject : public QObject +{ Q_OBJECT +public: + KIO_Single_Subject( QObject * parent, const char * name, KURL &, KIO::MetaData &, const KIO_Protocol *, + KIO::Slave *&, const QString &, const long ); + ~KIO_Single_Subject( ); + + //This functions try's te parse EMail; data, sender names and so on... + static void parseMail( QString * message, KornMailSubject *subject, bool ); + +private: + QString *_message; + QString *_name; + KURL *_kurl; + const KIO_Protocol *_protocol; + KIO::MetaData *_metadata; + KIO::TransferJob* _job; + long _size; + + void init( KIO::Slave*& ); + +private slots: + void slotResult( KIO::Job* ); + void slotData( KIO::Job*, const QByteArray& ); + +signals: + //This signal is emitted if the headers are read and put into a KornMailSubject* + void readSubject( KornMailSubject* ); + //This signal is emitted if this class could be destroyed. + void finished( KIO_Single_Subject* ); +}; + +#endif diff --git a/korn/kio_subjects.cpp b/korn/kio_subjects.cpp new file mode 100644 index 00000000..ba4278ff --- /dev/null +++ b/korn/kio_subjects.cpp @@ -0,0 +1,176 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "kio_subjects.h" + +#include "kio.h" +#include "kio_single_subject.h" +#include "kio_proto.h" +#include "mailsubject.h" + +#include +#include +#include + +#include +#include +#include + +KIO_Subjects::KIO_Subjects( QObject * parent, const char * name ) + : QObject( parent, name ), + _protocol( 0 ), + _slave( 0 ), + _valid( true ) +{ + _jobs = new QPtrList; + _kurl = new KURL; + _metadata = new KIO::MetaData; + + _jobs->setAutoDelete( true ); +} + +KIO_Subjects::~KIO_Subjects( ) +{ + delete _jobs; + delete _kurl; + delete _metadata; + _protocol = 0; +} + +void KIO_Subjects::doReadSubjects( KKioDrop *drop ) +{ + QValueList::ConstIterator it; + QValueList::ConstIterator end_it = drop->_mailurls->end(); + + _kio = drop; + _protocol = _kio->_protocol; + *_kurl = *_kio->_kurl; + *_metadata = *_kio->_metadata; + + if( _jobs->count() > 0 ) + kdWarning() << i18n( "Already a slave pending." ) << endl; + + _jobs->clear( ); + + //Open connection + getConnection( ); + + //Open jobs for easy item in the list + for( it = _kio->_mailurls->begin(); it != end_it; it++ ) + startJob( (*it).name, (*it).size ); + + //close connection for trivial situations (empty list) + disConnect( true ); + + //passing number of subjects for progress bar. + _kio->emitReadSubjectsTotalSteps( _jobs->count() ); +} + +void KIO_Subjects::getConnection( ) +{ + KURL kurl = *_kurl; + KIO::MetaData metadata = *_metadata; + + if( _slave ) + { + KIO::Scheduler::disconnectSlave( _slave ); + _slave = 0; + } + + if( _protocol->connectionBased( ) ) + { + _protocol->readSubjectConnectKURL( kurl, metadata ); + + if( kurl.port() == 0 ) + kurl.setPort( _protocol->defaultPort( _kio->_ssl ) ); + + if( ! ( _slave = KIO::Scheduler::getConnectedSlave( kurl, metadata ) ) ) + { + kdWarning() << i18n( "Not able to open a kio-slave for %1." ).arg( _protocol->configName() ); + _kio->emitShowPassivePopup( i18n( "Not able to open a kio-slave for %1." ).arg( _protocol->configName() ) ); + _valid = false; + _kio->emitValidChanged(); + _slave = 0; + _kio->emitReadSubjectsReady( false ); + return; + } + } +} + +void KIO_Subjects::startJob( const QString &name, const long size ) +{ + KURL kurl = *_kurl; + KIO::MetaData metadata = *_metadata; + KIO_Single_Subject *subject; + + kurl = name; + + _protocol->readSubjectKURL( kurl, metadata ); + + if( kurl.port() == 0 ) + kurl.setPort( _protocol->defaultPort( _kio->_ssl ) ); + + subject = new KIO_Single_Subject( this, name.latin1(), kurl, metadata, _protocol, _slave, name, size ); + + connect( subject, SIGNAL( readSubject( KornMailSubject* ) ), this, SLOT( slotReadSubject( KornMailSubject* ) ) ); + connect( subject, SIGNAL( finished( KIO_Single_Subject* ) ), this, SLOT( slotFinished( KIO_Single_Subject* ) ) ); + + _jobs->append( subject ); +} + +void KIO_Subjects::disConnect( bool result ) +{ + if( _jobs->isEmpty() ) + { + if( _slave ) + { + KIO::Scheduler::disconnectSlave( _slave ); + _slave = 0; + } + _kio->emitReadSubjectsReady( result ); + } +} + +void KIO_Subjects::cancelled( ) +{ + _jobs->clear(); + //_slave died in cancelJob with is by called from the destructor of KIO_Single_Subject, + //withs is by called by _jobs->clear because autoRemove equals true. + _slave = 0; + disConnect( false ); +} + +void KIO_Subjects::slotReadSubject( KornMailSubject* subject ) +{ + _valid = true; + _kio->emitValidChanged(); + subject->setMailDrop( _kio ); + _kio->emitReadSubjectsRead( subject ); +} + +void KIO_Subjects::slotFinished( KIO_Single_Subject* item ) +{ + //Remove sender.... I didn't know of the computer gonna like me, but it seems he does :) + _jobs->remove( item ); + + _kio->emitReadSubjectsProgress( _jobs->count( ) ); + + disConnect( true ); //Only works when all jobs are finished. +} + +#include "kio_subjects.moc" diff --git a/korn/kio_subjects.h b/korn/kio_subjects.h new file mode 100644 index 00000000..c14ff43b --- /dev/null +++ b/korn/kio_subjects.h @@ -0,0 +1,74 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_KIO_SUBJECTS_H +#define MK_KIO_SUBJECTS_H + +//This class calls other class to read all the subjects + +#include +class KKioDrop; +class KIO_Single_Subject; +class KIO_Protocol; +class KornMailSubject; + +namespace KIO { class MetaData; class Slave; } +class KURL; + +template class QPtrList; +class QString; +template class QValueList; + +class KIO_Subjects : public QObject +{ Q_OBJECT +public: + KIO_Subjects( QObject * parent, const char * name ); + ~KIO_Subjects( ); + + //This function let it start fetching headers. + void doReadSubjects( KKioDrop* ); + + //This function should return true then and only then of no error occurred. + bool valid( ) { return _valid; } + +private: + KKioDrop *_kio; + KURL *_kurl; + KIO::MetaData *_metadata; + const KIO_Protocol *_protocol; + QPtrList *_jobs; + KIO::Slave *_slave; + bool _valid; + + //Opens a connection. + void getConnection( ); + //Start a job; the job itself is executed in KIO_Single_Subject + void startJob( const QString&, const long ); + //Disconnect the connection + void disConnect( bool ); + +public slots: + //This function called the fetching of headers. + void cancelled( ); + +private slots: + void slotReadSubject( KornMailSubject* ); + void slotFinished( KIO_Single_Subject* ); +}; + +#endif diff --git a/korn/kmail_proto.cpp b/korn/kmail_proto.cpp new file mode 100644 index 00000000..15b228f3 --- /dev/null +++ b/korn/kmail_proto.cpp @@ -0,0 +1,246 @@ +/* + * Copyright (C) 2005, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + + +#include "kmail_proto.h" + +#include "account_input.h" +#include "kio.h" +#include "password.h" +#include "protocols.h" + +#include +#include +#include + +#include +#include +#include +#include + +const char* KMail_Protocol::kmailGroupName = "Account %1"; +const char* KMail_Protocol::kmailKeyType = "Type"; +const char* KMail_Protocol::kmailKeyName = "Name"; +const char* KMail_Protocol::kmailKeyId = "Id"; +const char* KMail_Protocol::kmailKeyMBox = "Location"; +const char* KMail_Protocol::kmailKeyQMail = "Location"; +const int KMail_Protocol::kmailFirstGroup = 1; + +class KMailDrop; + +KMail_Protocol::KMail_Protocol() +{ +} + +KMail_Protocol::~KMail_Protocol() +{ +} + +const Protocol* KMail_Protocol::getProtocol( KConfigGroup* config ) const +{ + KConfig kmailconfig( "kmailrc", true, false ); + int id; + QString type = getTypeAndConfig( config->readEntry( "kmailname" ), kmailconfig, id ); + + if( type == "imap" ) + return Protocols::getProto( "imap" ); + if( type == "cachedimap" ) + return Protocols::getProto( "imap" ); + if( type == "pop" ) + return Protocols::getProto( "pop3" ); + if( type == "local" ) + return Protocols::getProto( "mbox" ); + if( type == "maildir" ) + return Protocols::getProto( "qmail" ); + + //Type not recognized, or does not exist in KOrn + kdWarning() << "KMail configuration not found" << endl; + return 0; +} + +KMailDrop* KMail_Protocol::createMaildrop( KConfigGroup *config ) const +{ + int id; + KConfig kmailconfig( "kmailrc", true, false ); + QString type = getTypeAndConfig( config->readEntry( "kmailname" ), kmailconfig, id ); + + if( type == "imap" || type == "cachedimap" || type == "pop" || type == "local" || type == "maildir" ) + return new KKioDrop(); + + kdWarning() << "KMail configuration not found" << endl; + return 0; +} + +QMap< QString, QString > * KMail_Protocol::createConfig( KConfigGroup* config, const QString& ) const +{ + QMap< QString, QString > *result = new QMap; + int id; + KConfig kmailconfig( "kmailrc", true, false ); + //First: find the account in the configuration and get the type and id out of it. + QString type = getTypeAndConfig( config->readEntry( "kmailname" ), kmailconfig, id ); + QString metadata; + + if( type == "imap" || type == "cachedimap" ) + { + //Construct metadata + if( kmailconfig.hasKey( "auth" ) ) + metadata += QString( "auth=%1," ).arg( kmailconfig.readEntry( "auth" ) ); + if( !kmailconfig.hasKey( "use-tls" ) ) + metadata += "tls=auto"; + else + { + if( kmailconfig.readBoolEntry( "use-tls", false ) ) + metadata += "tls=on"; + else + metadata += "tls=off"; + } + //Add the fields into the mapping. + result->insert( "name", config->readEntry( "name", "" ) ); + result->insert( "server", kmailconfig.readEntry( "host", "localhost" ) ); + result->insert( "port", kmailconfig.readEntry( "port", "143" ) ); + result->insert( "ssl", kmailconfig.readEntry( "use-ssl", "false" ) ); + result->insert( "metadata", metadata ); + result->insert( "username", kmailconfig.readEntry( "login", "" ) ); + result->insert( "mailbox", "INBOX" ); //Didn't find a good way to get this out of the configuration yet. + result->insert( "password", readPassword( kmailconfig.readBoolEntry( "store-passwd", false ), kmailconfig, id ) ); + result->insert( "savepassword", kmailconfig.readEntry( "store-passwd", "false" ) ); + } + if( type == "pop" ) + { + //Constructing metadata + if( kmailconfig.hasKey( "auth" ) ) + metadata += QString( "auth=%1," ).arg( kmailconfig.readEntry( "auth" ) ); + if( !kmailconfig.hasKey( "use-tls" ) ) + metadata += "tls=auto"; + else + { + if( kmailconfig.readBoolEntry( "use-tls", false ) ) + metadata += "tls=on"; + else + metadata += "tls=off"; + } + result->insert( "name", config->readEntry( "name", "" ) ); + result->insert( "server", kmailconfig.readEntry( "host", "localhost" ) ); + result->insert( "port", kmailconfig.readEntry( "port", "110" ) ); + result->insert( "ssl", kmailconfig.readEntry( "use-ssl", "false" ) ); + result->insert( "metadata", metadata ); + result->insert( "username", kmailconfig.readEntry( "login", "" ) ); + result->insert( "mailbox", "" ); + result->insert( "password", readPassword( kmailconfig.readBoolEntry( "store-passwd", false ), kmailconfig, id ) ); + result->insert( "savepassword", kmailconfig.readEntry( "store-password", "false" ) ); + } + if( type == "local" ) //mbox + { + result->insert( "name", config->readEntry( "name", "" ) ); + result->insert( "server", "" ); + result->insert( "port", "0" ); + result->insert( "ssl", "false" ); + result->insert( "metadata", "" ); + result->insert( "username", "" ); + result->insert( "mailbox", kmailconfig.readPathEntry( kmailKeyMBox, "" ) ); + result->insert( "password", "" ); + result->insert( "savepassword", "false" ); + } + if( type == "maildir" ) + { + result->insert( "name", config->readEntry( "name", "" ) ); + result->insert( "server", "" ); + result->insert( "port", "0" ); + result->insert( "ssl", "false" ); + result->insert( "metadata", "" ); + result->insert( "username", "" ); + result->insert( "mailbox", kmailconfig.readPathEntry( kmailKeyQMail, "" ) ); + result->insert( "password", "" ); + result->insert( "savepassword", "false" ); + } + + return result; +} + +void KMail_Protocol::configFillGroupBoxes( QStringList* lijst ) const +{ + lijst->append( "KMail" ); +} + +void KMail_Protocol::configFields( QPtrVector< QWidget >* vector, const QObject*, QPtrList< AccountInput >* result ) const +{ + QMap< QString, QString > accountList; + QString type; + QString name; + int nummer = kmailFirstGroup - 1; + + KConfig kmailconfig( "kmailrc", true, false ); + while( kmailconfig.hasGroup( QString( kmailGroupName ).arg( ++nummer ) ) ) + { + kmailconfig.setGroup( QString( kmailGroupName ).arg( nummer ) ); + type = kmailconfig.readEntry( kmailKeyType, QString::null ); + name = kmailconfig.readEntry( kmailKeyName, QString::null ); + if( type == "imap" || type == "cachedimap" || type == "pop" || type == "local" ) + { + accountList.insert( name, name ); + } + } + + result->append( new ComboInput( (QWidget*)vector->at( 0 ), i18n( "KMail name" ), accountList, *accountList.begin(), "kmailname" ) ); +} + +void KMail_Protocol::readEntries( QMap< QString, QString >* ) const +{ + //The configuartion is read out on the right way +} + +void KMail_Protocol::writeEntries( QMap< QString, QString >* ) const +{ + //The configuartion is read out on the right way +} + +QString KMail_Protocol::readPassword( bool store, const KConfigBase& config, int id ) const +{ + if( !store ) + return ""; + + return KOrnPassword::readKMailPassword( id, config ); +} + +QString KMail_Protocol::getTypeAndConfig( const QString& kmailname, KConfig &kmailconfig, int &id ) const +{ + int nummer = kmailFirstGroup - 1; + bool found = false; + + id = -1; + + while( kmailconfig.hasGroup( QString( kmailGroupName ).arg( ++nummer ) ) ) + { + kmailconfig.setGroup( QString( kmailGroupName ).arg( nummer ) ); + if( kmailconfig.readEntry( kmailKeyName, QString::null ) == kmailname ) + { + id = kmailconfig.readNumEntry( kmailKeyId, 0 ); + found = true; + break; + } + } + if( !found ) + { + nummer = -1; + return QString::null; + } + + //The correct group is found, and kmailconfig.setGroup() is already called for the right group. + return kmailconfig.readEntry( kmailKeyType, QString::null ); +} + diff --git a/korn/kmail_proto.h b/korn/kmail_proto.h new file mode 100644 index 00000000..6e055b40 --- /dev/null +++ b/korn/kmail_proto.h @@ -0,0 +1,122 @@ +/* + * Copyright (C) 2005, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + + +#ifndef MK_KMAILPROTOCOL +#define MK_KMAILPROTOCOL + +#include "protocol.h" + +class KConfig; +class KConfigBase; + +/** + * This class is the comminucation between KOrn and KMail. + * If provides an configuration option to fill in the KMail account name, + * and it provides a conversion from the KMail config to a configuration KOrn can read. + * That conversion is done every time, so that changing the settings in KMail also affects + * the settings in KOrn. + */ +class KMail_Protocol : public Protocol +{ +public: + /** + * Constructor + */ + KMail_Protocol(); + /** + * Destructor + */ + ~KMail_Protocol(); + + /** + * This function returns the protocol of the resulting configuration. + * This is not itself, because an real Protocol of type KMail doesn't exist. + * + * @param config The configuration group to read the kmailname from. + * @return A pointer to a Protocol (not newly created) or 0 if an error orrured. + */ + virtual const Protocol* getProtocol( KConfigGroup* config ) const; + /** + * This gives a new Maildrop back. The maildrop is responsible to execute the configuration. + * In most cases, it will return a new instance of the KKioDrop Maildrop. + * @param config The configuration group to read the kmailname from. + * @return A new KMailDrop, or a 0 pointer if an error occured. + */ + virtual KMailDrop* createMaildrop( KConfigGroup* config ) const; + /** + * This does the real convertion: given a namen of a KMail account (hidden in config), + * it calculates how the configuration whould have looked in KOrn. + * + * @param config The configuration group to read the kmailname from. + * @param password The password fetched out of the configuration or KWallet. + * @return A mapping containing the configuration if success, and empty mapping otherwise. + */ + virtual QMap< QString, QString > * createConfig( KConfigGroup* config, const QString& password ) const; + /** + * The name of thes protocol + * + * @return "kmail" + */ + virtual QString configName() const { return "kmail"; } + + /** + * This adds the names of the groupboxes neccesairy for configuration to list. + * + * @param list A empty list at calling; after this function, "KMail" is added, because KMail is the only group here. + */ + virtual void configFillGroupBoxes( QStringList* list ) const; + /** + * This filles the config fields of the configuration. + * There is only one config field, containing the accounts of KMail. + * + * @param vector A vector containing the groupboxes. + * @param object An object to connect slots to. + * @param result The resulting object. + */ + virtual void configFields( QPtrVector< QWidget >* vector, const QObject* object, QPtrList< AccountInput >* result ) const; + /** + * This can manipulate entries that are readed from the configuartion. + * This function does nothing here. + * + * @param config The configuration mapping as read from the configuration file + */ + virtual void readEntries( QMap< QString, QString >* config ) const; + + /** + * This can manipulate entries that are writed to the configuartion file. + * This function does nothing here. + * + * @param config The configuration mapping as to be written to the configuration file (can be modified) + */ + virtual void writeEntries( QMap< QString, QString >* config ) const; + +private: + QString readPassword( bool store, const KConfigBase &config, int id ) const; + QString getTypeAndConfig( const QString& kmailname, KConfig &config, int &nummer ) const; + + static const char* kmailGroupName; + static const char* kmailKeyName; + static const char* kmailKeyType; + static const char* kmailKeyId; + static const char* kmailKeyMBox; + static const char* kmailKeyQMail; + static const int kmailFirstGroup; +}; + +#endif //MK_KMAILPROTOCOL diff --git a/korn/kornaccountcfg.ui b/korn/kornaccountcfg.ui new file mode 100644 index 00000000..18b06829 --- /dev/null +++ b/korn/kornaccountcfg.ui @@ -0,0 +1,249 @@ + +KornAccountCfg + + + KornAccountCfg + + + + 0 + 0 + 472 + 471 + + + + + unnamed + + + + tab + + + + server_tab + + + &Server + + + + lbProtocol + + + + 11 + 41 + 206 + 24 + + + + &Protocol: + + + cbProtocol + + + + + cbProtocol + + + + 223 + 41 + 206 + 24 + + + + + + + TabPage + + + &Account + + + + unnamed + + + + layout35 + + + + unnamed + + + + lbInterval + + + C&heck every (sec): + + + edInterval + + + + + edInterval + + + + + + + + + TabPage + + + &Events + + + + unnamed + + + + chUseBox + + + &Use settings of box + + + true + + + + + gbNewMail + + + false + + + On New Mail + + + + unnamed + + + + layout33 + + + + unnamed + + + + edRunCommand + + + + + lbRunCommand + + + Run &command: + + + edRunCommand + + + + + edPlaySound + + + + + lbPlaySound + + + Play sou&nd: + + + edPlaySound + + + + + + + chPassivePopup + + + Show &passive popup + + + + + chPassiveDate + + + false + + + Add &date to passive popup + + + + + + + + + + + + + + chUseBox + toggled(bool) + gbNewMail + setDisabled(bool) + + + chPassivePopup + toggled(bool) + chPassiveDate + setEnabled(bool) + + + cbProtocol + activated(const QString&) + KornAccountCfg + slotProtocolChanged(const QString&) + + + + tab + edInterval + chUseBox + edRunCommand + edPlaySound + chPassivePopup + chPassiveDate + + + slotProtocolChanged( const QString& ) + + + + kurlrequester.h + klineedit.h + kpushbutton.h + kurlrequester.h + klineedit.h + kpushbutton.h + + diff --git a/korn/kornaccountcfgimpl.cpp b/korn/kornaccountcfgimpl.cpp new file mode 100644 index 00000000..f4980ca9 --- /dev/null +++ b/korn/kornaccountcfgimpl.cpp @@ -0,0 +1,232 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "kornaccountcfgimpl.h" + +#include "account_input.h" +#include "kio_proto.h" +#include "password.h" +#include "protocol.h" +#include "protocols.h" + +#include +#include +#include +#include + +#include +#include +#include +#include +#include +#include +#include + +KornAccountCfgImpl::KornAccountCfgImpl( QWidget * parent, const char * name ) + : KornAccountCfg( parent, name ), + _config( 0 ), + _fields( 0 ), + _urlfields( 0 ), + _boxnr( 0 ), + _accountnr( 0 ), + _vlayout( 0 ), + _protocolLayout( 0 ), + _groupBoxes( 0 ), + _accountinput( new QPtrList< AccountInput >() ) +{ + connect( parent, SIGNAL( okClicked() ), this, SLOT( slotOK() ) ); + connect( parent, SIGNAL( cancelClicked() ), this, SLOT( slotCancel() ) ); + + this->cbProtocol->insertStringList( Protocols::getProtocols() ); + + _accountinput->setAutoDelete( true ); + +} + +KornAccountCfgImpl::~KornAccountCfgImpl() +{ + delete _accountinput; +} + +void KornAccountCfgImpl::readConfig( KConfigGroup *config, QMap< QString, QString > *entries, int boxnr, int accountnr ) +{ + AccountInput *input; + + _config = config; + + _accountinput->clear(); + + this->cbProtocol->setCurrentText( _config->readEntry( "protocol", "mbox" ) ); + slotProtocolChanged( this->cbProtocol->currentText() ); + const Protocol *protocol = Protocols::getProto( _config->readEntry( "protocol", "mbox" ) ); + + protocol->readEntries( entries ); + + (*entries)[ "password" ] = KOrnPassword::readKOrnPassword( boxnr, accountnr, *config ); + + for( input = _accountinput->first(); input; input = _accountinput->next() ) + if( entries->contains( input->configName() ) ) + input->setValue( *(entries->find( input->configName() ) ) ); + + this->edInterval->setText( _config->readEntry( "interval", "300" ) ); + + this->chUseBox->setChecked( _config->readBoolEntry( "boxsettings", true ) ); + this->edRunCommand->setURL( _config->readEntry( "newcommand", "" ) ); + this->edPlaySound->setURL( _config->readEntry( "sound", "" ) ); + this->chPassivePopup->setChecked( _config->readBoolEntry( "passivepopup", false ) ); + this->chPassiveDate->setChecked( _config->readBoolEntry( "passivedate", false ) ); + + _boxnr = boxnr; + _accountnr = accountnr; +} + +void KornAccountCfgImpl::writeConfig() +{ + AccountInput *input; + const Protocol *protocol = Protocols::getProto( this->cbProtocol->currentText() ); + + if( !protocol ) + { + kdWarning() << "An error occured during writing the account information: protocol does not exist" << endl; + return; + } + + _config->writeEntry( "protocol", this->cbProtocol->currentText() ); + + QMap< QString, QString > *map = new QMap< QString, QString >; + QMap< QString, QString >::ConstIterator it; + for( input = _accountinput->first(); input; input = _accountinput->next() ) + map->insert( input->configName(), input->value() ); + + protocol->writeEntries( map ); + + if( map->contains( "password" ) ) + { + KOrnPassword::writeKOrnPassword( _boxnr, _accountnr, *_config, *map->find( "password" ) ); + map->erase( "password" ); + } + + for( it = map->begin(); it != map->end(); ++it ) + _config->writeEntry( it.key(), it.data() ); + + delete map; + + _config->writeEntry( "interval", this->edInterval->text().toInt() ); + + _config->writeEntry( "boxsettings", this->chUseBox->isChecked() ); + _config->writeEntry( "newcommand", this->edRunCommand->url() ); + _config->writeEntry( "sound", this->edPlaySound->url() ); + _config->writeEntry( "passivepopup", this->chPassivePopup->isChecked() ); + _config->writeEntry( "passivedate", this->chPassiveDate->isChecked() ); +} + +void KornAccountCfgImpl::slotSSLChanged() +{ + AccountInput *input; + const Protocol* protocol = Protocols::getProto( this->cbProtocol->currentText() ); + bool ssl = false; + + if( !protocol ) + return; + + for( input = _accountinput->first(); input; input = _accountinput->next() ) + if( ( input->configName() == "ssl" && input->value() == "true" ) || input->value() == "ssl" ) + ssl = true; + + for( input = _accountinput->first(); input; input = _accountinput->next() ) + if( input->configName() == "port" && ( input->value() == QString::number( protocol->defaultPort( !ssl ) ) ) ) + input->setValue( QString::number( protocol->defaultPort( ssl ) ) ); +} + +void KornAccountCfgImpl::slotOK() +{ + writeConfig(); +} + +void KornAccountCfgImpl::slotCancel() +{ +} + +void KornAccountCfgImpl::slotProtocolChanged( const QString& proto ) +{ + const Protocol *protocol = Protocols::getProto( proto ); + QStringList *groupBoxes = new QStringList; + int counter = 1; + + protocol->configFillGroupBoxes( groupBoxes ); + + _accountinput->clear(); + delete _groupBoxes; + delete _protocolLayout; + delete _vlayout; + _vlayout = new QVBoxLayout( this->server_tab, groupBoxes->count() + 1 ); + _vlayout->setSpacing( 10 ); + _vlayout->setMargin( 10 ); + + _protocolLayout = new QHBoxLayout( _vlayout ); + _protocolLayout->addWidget( this->lbProtocol ); + _protocolLayout->addWidget( this->cbProtocol ); + + QStringList::iterator it; + counter = 0; + _groupBoxes = new QPtrVector< QWidget >( groupBoxes->count() ); + _groupBoxes->setAutoDelete( true ); + for( it = groupBoxes->begin(); it != groupBoxes->end(); ++it ) + { + _groupBoxes->insert( counter, new QGroupBox( (*it), this->server_tab, "groupbox" ) ); + _vlayout->addWidget( _groupBoxes->at( counter ) ); + ++counter; + } + delete groupBoxes; + + AccountInput *input; + protocol->configFields( _groupBoxes, this, _accountinput ); + + for( unsigned int groupCounter = 0; groupCounter < _groupBoxes->count(); ++groupCounter ) + { + int counter = 0; + QGridLayout *grid = new QGridLayout( _groupBoxes->at( groupCounter ), 0, 2 ); + grid->setSpacing( 10 ); + grid->setMargin( 15 ); + for( input = _accountinput->first(); input; input = _accountinput->next() ) + { + if( input->leftWidget() && _groupBoxes->at( groupCounter ) == input->leftWidget()->parent() ) + { + grid->addWidget( input->leftWidget(), counter, 0 ); + if( input->rightWidget() && _groupBoxes->at( groupCounter ) == input->rightWidget()->parent() ) + grid->addWidget( input->rightWidget(), counter, 1 ); + ++counter; + } else { + if( input->rightWidget() && _groupBoxes->at( groupCounter ) == input->rightWidget()->parent() ) + { + grid->addWidget( input->rightWidget(), counter, 1 ); + ++counter; + } + } + } + + _groupBoxes->at( groupCounter )->show(); + } + + this->lbInterval->setEnabled( proto != "process" && proto != "dcop" ); + this->edInterval->setEnabled( proto != "process" && proto != "dcop" ); + + this->server_tab->updateGeometry(); +} + +#include "kornaccountcfgimpl.moc" diff --git a/korn/kornaccountcfgimpl.h b/korn/kornaccountcfgimpl.h new file mode 100644 index 00000000..1bbb44c3 --- /dev/null +++ b/korn/kornaccountcfgimpl.h @@ -0,0 +1,69 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_KORNACCOUNTCFGIMPL_H +#define MK_KORNACCOUNTCFGIMPL_H + +#include "kornaccountcfg.h" + +class KConfigGroup; +class KURLRequester; + +class QVBoxLayout; +class QHBoxLayout; +class QLabel; +class QString; +class QWidget; + +class AccountInput; + +template< class T > class QPtrList; +template< class T > class QPtrVector; + +class KornAccountCfgImpl : public KornAccountCfg +{ Q_OBJECT +public: + KornAccountCfgImpl( QWidget * parent = 0, const char * name = 0 ); + ~KornAccountCfgImpl(); + + void readConfig( KConfigGroup *config, QMap< QString, QString > *entries, int boxnr, int accountnr ); + void writeConfig(); + +public slots: + void slotSSLChanged(); + +protected slots: + virtual void slotProtocolChanged( const QString& ); + +private slots: + void slotOK(); + void slotCancel(); +private: + KConfigGroup *_config; + int _fields; + int _urlfields; + int _boxnr, _accountnr; + + QVBoxLayout *_vlayout; + QHBoxLayout *_protocolLayout; + QPtrVector< QWidget > *_groupBoxes; + + QPtrList< AccountInput > *_accountinput; +}; + +#endif //MK_KORNACCOUNTCFGIMPL_H diff --git a/korn/kornapp.cpp b/korn/kornapp.cpp new file mode 100644 index 00000000..1205c800 --- /dev/null +++ b/korn/kornapp.cpp @@ -0,0 +1,21 @@ +/* +* kornapp.cpp -- Implementation of class KornApp. +* Author: Sirtaj Singh Kang +* Version: $Id$ +* Generated: Sun Apr 22 23:50:49 EST 2001 +*/ + +#include"kornapp.h" +#include +#include"kornshell.h" + +int KornApp::newInstance() +{ + if( _instanceCount ) { + _shell->optionDlg(); + } + _instanceCount++; + + return 0; +} +#include "kornapp.moc" diff --git a/korn/kornapp.h b/korn/kornapp.h new file mode 100644 index 00000000..c07ac55c --- /dev/null +++ b/korn/kornapp.h @@ -0,0 +1,43 @@ +/* +* kornapp.h -- Declaration of class KornApp. +* Generated by newclass on Sun Apr 22 23:50:49 EST 2001. +*/ +#ifndef SSK_KORNAPP_H +#define SSK_KORNAPP_H + +#include + +class KornShell; + +/** +* @short KornApp +* @author Sirtaj Singh Kang (taj@kde.org) +* @version $Id$ +*/ +class KornApp : public KUniqueApplication +{ + Q_OBJECT + +public: + /** + * KornApp Constructor + */ + KornApp() : KUniqueApplication(), _shell( 0 ), _instanceCount( 0 ) {} + + /** + * KornApp Destructor + */ + virtual ~KornApp(){} + + virtual int newInstance(); + void setShell( KornShell *shell ){ _shell = shell; }; + +private: + KornShell *_shell; + int _instanceCount; + + KornApp& operator=( const KornApp& ); + KornApp( const KornApp& ); +}; + +#endif // SSK_KORNAPP_H diff --git a/korn/kornboxcfg.ui b/korn/kornboxcfg.ui new file mode 100644 index 00000000..4b61ee06 --- /dev/null +++ b/korn/kornboxcfg.ui @@ -0,0 +1,1698 @@ + +KornBoxCfg + + + KornBoxCfg + + + + 0 + 0 + 340 + 448 + + + + + unnamed + + + + tabWidget3 + + + + tab + + + &View + + + + unnamed + + + + layout32 + + + + unnamed + + + + chNewText + + + + + + true + + + + + cbNewText + + + + + + + 0 + 0 + 0 + + + + + + + + layout34 + + + + unnamed + + + + chNormalBack + + + + + + false + + + + + cbNormalBack + + + false + + + + + + + 208 + 208 + 208 + + + + + + + + lbIcon + + + Icon: + + + + + lbBackground + + + Background: + + + + + layout33 + + + + unnamed + + + + chNewBack + + + + + + false + + + + + cbNewBack + + + false + + + + + + + + + + lbNormal + + + Normal + + + AlignCenter + + + + + layout36 + + + + unnamed + + + + chNewIcon + + + + + + + + ibNewIcon + + + false + + + + + + + + + + lbNew + + + New Mail + + + AlignCenter + + + + + lbText + + + Text: + + + + + layout31 + + + + unnamed + + + + chNormalText + + + + + + true + + + + + cbNormalText + + + + + + + 0 + 0 + 0 + + + + + + + + layout35 + + + + unnamed + + + + chNormalIcon + + + + + + + + ibNormalIcon + + + false + + + + + + + + + + spacer1 + + + Vertical + + + Expanding + + + + 41 + 160 + + + + + + layout29 + + + + unnamed + + + + chNormalAnim + + + + + + + + pbNormalAnim + + + false + + + Change + + + + + + + layout28 + + + + unnamed + + + + chNewAnim + + + + + + + + pbNewAnim + + + false + + + Change + + + + + + + lbAnimation + + + Animation: + + + + + lbFont + + + Font: + + + + + layout28_2 + + + + unnamed + + + + chNewFont + + + + + + + + pbNewFont + + + false + + + Change + + + + + + + layout29_2 + + + + unnamed + + + + chNormalFont + + + + + + + + pbNormalFont + + + false + + + Change + + + + + + + + + tab + + + &Events + + + + unnamed + + + + layout31 + + + + unnamed + + + + lbLeft + + + Left + + + AlignCenter + + + + + layout52_7 + + + + unnamed + + + + spacer7_7_3 + + + Horizontal + + + Expanding + + + + 21 + 20 + + + + + + chMiddleRun + + + + + + + + spacer6_7_3 + + + Horizontal + + + Expanding + + + + 21 + 21 + + + + + + + + lbRight + + + Right + + + AlignCenter + + + + + layout52 + + + + unnamed + + + + spacer7 + + + Horizontal + + + Expanding + + + + 21 + 20 + + + + + + chMiddleRecheck + + + + + + + + spacer6 + + + Horizontal + + + Expanding + + + + 21 + 21 + + + + + + + + layout52_4 + + + + unnamed + + + + spacer7_4 + + + Horizontal + + + Expanding + + + + 21 + 20 + + + + + + chLeftReset + + + + + + + + spacer6_4 + + + Horizontal + + + Expanding + + + + 21 + 21 + + + + + + + + layout52_9 + + + + unnamed + + + + spacer7_9_3 + + + Horizontal + + + Expanding + + + + 21 + 20 + + + + + + chRightRun + + + + + + + + spacer6_9_3 + + + Horizontal + + + Expanding + + + + 21 + 21 + + + + + + + + layout52 + + + + unnamed + + + + spacer7 + + + Horizontal + + + Expanding + + + + 21 + 20 + + + + + + chLeftRecheck + + + + + + + + spacer6 + + + Horizontal + + + Expanding + + + + 21 + 21 + + + + + + + + lbReset + + + Reset counter: + + + + + lbMouseButton + + + Mousebutton + + + AlignCenter + + + + + layout52_9 + + + + unnamed + + + + spacer7_9 + + + Horizontal + + + Expanding + + + + 21 + 20 + + + + + + chRightView + + + + + + + + spacer6_9 + + + Horizontal + + + Expanding + + + + 21 + 21 + + + + + + + + layout52_5 + + + + unnamed + + + + spacer7_5_3 + + + Horizontal + + + Expanding + + + + 21 + 20 + + + + + + chLeftRun + + + + + + + + spacer6_5_3 + + + Horizontal + + + Expanding + + + + 21 + 21 + + + + + + + + lbMiddle + + + Middle + + + AlignCenter + + + + + layout52_5 + + + + unnamed + + + + spacer7_5_3 + + + Horizontal + + + Expanding + + + + 21 + 20 + + + + + + chLeftPopup + + + + + + + + spacer6_5_3 + + + Horizontal + + + Expanding + + + + 21 + 21 + + + + + + + + lbPopup + + + Popup: + + + + + layout52_8 + + + + unnamed + + + + spacer7_8 + + + Horizontal + + + Expanding + + + + 21 + 20 + + + + + + chRightReset + + + + + + + + spacer6_8 + + + Horizontal + + + Expanding + + + + 21 + 21 + + + + + + + + lbView + + + View emails: + + + + + layout52_7 + + + + unnamed + + + + spacer7_7_3 + + + Horizontal + + + Expanding + + + + 21 + 20 + + + + + + chMiddlePopup + + + + + + + + spacer6_7_3 + + + Horizontal + + + Expanding + + + + 21 + 21 + + + + + + + + lbRecheck + + + Recheck: + + + + + layout52_5 + + + + unnamed + + + + spacer7_5 + + + Horizontal + + + Expanding + + + + 21 + 20 + + + + + + chLeftView + + + + + + + + spacer6_5 + + + Horizontal + + + Expanding + + + + 21 + 21 + + + + + + + + layout52_3 + + + + unnamed + + + + spacer7_3 + + + Horizontal + + + Expanding + + + + 21 + 20 + + + + + + chRightRecheck + + + + + + + + spacer6_3 + + + Horizontal + + + Expanding + + + + 21 + 21 + + + + + + + + layout52_6 + + + + unnamed + + + + spacer7_6 + + + Horizontal + + + Expanding + + + + 21 + 20 + + + + + + chMiddleReset + + + + + + + + spacer6_6 + + + Horizontal + + + Expanding + + + + 21 + 21 + + + + + + + + layout52_7 + + + + unnamed + + + + spacer7_7 + + + Horizontal + + + Expanding + + + + 21 + 20 + + + + + + chMiddleView + + + + + + + + spacer6_7 + + + Horizontal + + + Expanding + + + + 21 + 21 + + + + + + + + lbRun + + + Run command: + + + + + layout52_9 + + + + unnamed + + + + spacer7_9_3 + + + Horizontal + + + Expanding + + + + 21 + 20 + + + + + + chRightPopup + + + + + + + + spacer6_9_3 + + + Horizontal + + + Expanding + + + + 21 + 21 + + + + + + + + + + layout31_3 + + + + unnamed + + + + lbCommand + + + Co&mmand: + + + edCommand + + + + + edCommand + + + true + + + + + + + gbNewMail + + + On &New Mail + + + + unnamed + + + + layout33 + + + + unnamed + + + + edNewRun + + + + + lbNewRun + + + &Run command: + + + edNewRun + + + + + edPlaySound + + + + + lbPlaySound + + + Play &sound: + + + edPlaySound + + + + + + + chShowPassive + + + Show &passive popup + + + + + chPassiveDate + + + false + + + Add da&te to passive popup + + + + + + + + + TabPage + + + Acco&unts + + + + unnamed + + + + elbAccounts + + + + + pbEdit + + + E&dit + + + + + + + TabPage + + + &DCOP + + + + unnamed + + + + elbDCOP + + + DCO&Objects + + + The names of DCOP-objects by this box. DCOP-objects let other programs add 'virtual' emails to the box. + + + + + + + + + + KEditListBoxManager +
keditlistboxman.h
+ + -1 + -1 + + 0 + + 5 + 5 + 0 + 0 + + image0 + activated( const QString& ) + activated( const int ) + setDefaults( const QString&, KConfig* ) + setDefaults( const QString&, const int, KConfig* ) + + + + + 89504e470d0a1a0a0000000d4948445200000016000000160806000000c4b46c3b0000030149444154388db59531681b5718c77f0e377c070e3c810a3a70e0041eac51852e0a19e45134830a1d9a4c69a04bc8928e990a693a640e1d0c8642b08742321894c1507991b484c890902bb8701a047760c3bd21701fe4201dde49b6a41a32b8df72dcbbeffdbefffbbfefbd5b1b0c07cce266ebe667ae2006c3c1dada0cdc3be87d6e6c35b0d692a409d9c7ec8b20d65ae29398d19b1114e7e3de4ce98b3f5e10dc0053cf0951b4506496e1b964bf7ce6c585d9054c62d01d617ca48be0596553cf496d8f2c8b01c5f795fc93904e85ec4c01a152857a5d9175d0b2805c872080f18595ccc1499a10a225d4e2fbc2877786fe81253ab6c04c8d106e09db5d43ab0d146e5c64d1a23938fb98a185cea1c33eecfd9eba49eb427dcb201e245365f2b7b2fb5b4a3a31dcb927178afe07d86901df870fefa4842aed6f6b74ba42e52b4014d580e1eb9cbd9d94de7e4aad16d2f9be02d805f0b5e532f927a1ffcacea1777f122a8105b164a7c25faf323a5d9f1f1fd600e1e5bec59e2d4b5c7ef5209d0ad17b8b31864e57c0b3e0815ac3ee33253ab664a770ff5185d1a1cb8d2267d3e58aa1dc7d2508cbe597d0e74fdd269aaaf0f52d414c4ea3e9762c996869e42560d7a72e41c4799a2586e74f95e8d8151481fa86efbe7b3398ac58b1a2b8527589f15451ad303ac2293542ad6648a796278f13a27185e4c4754310facb98c53a79e19a3fdc1426ff28c3d7399d1f7cb25343eb96106cf83c790ce9c4f2eb831855c55485663327992eb6dc8a6259874ed700b0b793323cccb9ffa842b30d6133e3e75fea989ac15a8b16ca76b746b0b92278d919774c5b6d48a78697fb29bbcf52468742a32120909c24e899ce67beed5be2db01e22d1e9485bb620e47f9ee9e606a21bd3f5d3744c7e7c54d55e87443867d8b554515ac5db4620e8e4f62263170fd1cdee90aad7640141992891b0f367c9adfe4049bb07d3b7022bd8c687c0978f46684ee084150b65ac1fcca94591b7a90a496e4c095164fb016a2b192a497795cc0f84817aebe25f7bf70ccc54a575c555c03f78ffa5fc0570d1f0c076bff0232285a09643cc7ce0000000049454e44ae426082 + + + + + chNormalText + toggled(bool) + cbNormalText + setEnabled(bool) + + + chNewText + toggled(bool) + cbNewText + setEnabled(bool) + + + chNormalBack + toggled(bool) + cbNormalBack + setEnabled(bool) + + + chNewBack + toggled(bool) + cbNewBack + setEnabled(bool) + + + chNormalIcon + toggled(bool) + ibNormalIcon + setEnabled(bool) + + + chNewIcon + toggled(bool) + ibNewIcon + setEnabled(bool) + + + chShowPassive + toggled(bool) + chPassiveDate + setEnabled(bool) + + + pbEdit + clicked() + KornBoxCfg + slotEditBox() + + + elbAccounts + activated(const QString&) + KornBoxCfg + slotActivated(const QString&) + + + elbAccounts + setDefaults(const QString&,const int,KConfig*) + KornBoxCfg + slotSetDefaults(const QString&,const int,KConfig*) + + + pbNormalFont + pressed() + KornBoxCfg + slotChangeNormalFont() + + + pbNewFont + pressed() + KornBoxCfg + slotChangeNewFont() + + + pbNormalAnim + released() + KornBoxCfg + slotChangeNormalAnim() + + + pbNewAnim + pressed() + KornBoxCfg + slotChangeNewAnim() + + + chNormalFont + toggled(bool) + pbNormalFont + setEnabled(bool) + + + chNewFont + toggled(bool) + pbNewFont + setEnabled(bool) + + + chNormalAnim + toggled(bool) + pbNormalAnim + setEnabled(bool) + + + chNewAnim + toggled(bool) + pbNewAnim + setEnabled(bool) + + + chNormalAnim + toggled(bool) + KornBoxCfg + slotNormalAnimToggled(bool) + + + chNewAnim + toggled(bool) + KornBoxCfg + slotNewAnimToggled(bool) + + + + tabWidget3 + chNormalText + cbNormalText + chNewText + cbNewText + chNormalBack + cbNormalBack + chNewBack + cbNewBack + chNormalIcon + ibNormalIcon + chNewIcon + ibNewIcon + chNormalFont + pbNormalFont + chNewFont + pbNewFont + chNormalAnim + pbNormalAnim + chNewAnim + pbNewAnim + chLeftRecheck + chMiddleRecheck + chRightRecheck + chLeftReset + chMiddleReset + chRightReset + chLeftView + chMiddleView + chRightView + chLeftRun + chMiddleRun + chRightRun + chLeftPopup + chMiddlePopup + chRightPopup + edCommand + edNewRun + edPlaySound + chShowPassive + chPassiveDate + pbEdit + + + slotEditBox() + slotActivated( const QString& ) + slotActivated( const int ) + slotSetDefaults( const QString&, const int, KConfig* ) + slotChangeNormalFont() + slotChangeNewFont() + slotChangeNormalAnim() + slotChangeNewAnim() + slotNormalAnimToggled( bool ) + slotNewAnimToggled( bool ) + + + + kcolorbutton.h + kcolorbutton.h + kcolorbutton.h + kcolorbutton.h + kurlrequester.h + klineedit.h + kpushbutton.h + kurlrequester.h + klineedit.h + kpushbutton.h + kurlrequester.h + klineedit.h + kpushbutton.h + keditlistbox.h + klineedit.h + + diff --git a/korn/kornboxcfgimpl.cpp b/korn/kornboxcfgimpl.cpp new file mode 100644 index 00000000..6ab6ce5e --- /dev/null +++ b/korn/kornboxcfgimpl.cpp @@ -0,0 +1,372 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +class KConfig; +#include "kornboxcfgimpl.h" + +#include "keditlistboxman.h" +#include "kornaccountcfgimpl.h" +#include "password.h" + +#include +#include +#include +#include +#include +#include +#include +#include + +#include +#include +#include +#include +#include + +KornBoxCfgImpl::KornBoxCfgImpl( QWidget * parent, const char * name ) + : KornBoxCfg( parent, name ), + _config( 0 ), + _base( 0 ), + _index( -1 ) +{ + _fonts[ 0 ] = new QFont; + _fonts[ 1 ] = new QFont; + _anims[ 0 ] = new QString; + _anims[ 1 ] = new QString; + + lbLeft->setText( i18n( "Left mousebutton", "Left" ) ); + if( lbLeft->text() == "Left" ) + lbLeft->setText( i18n( "Left" ) ); + lbRight->setText( i18n( "Right mousebutton", "Right" ) ); + if( lbRight->text() == "Right" ) + lbRight->setText( i18n( "Right" ) ); + + connect( parent, SIGNAL( okClicked() ), this, SLOT( slotOK() ) ); + connect( parent, SIGNAL( cancelClicked() ), this, SLOT( slotCancel() ) ); + + elbAccounts->setTitle( i18n( "Accounts" ) ); + + connect( elbAccounts, SIGNAL( elementsSwapped( int, int ) ), this, SLOT( slotAccountsSwapped( int, int ) ) ); + connect( elbAccounts, SIGNAL( elementDeleted( int ) ), this, SLOT( slotAccountDeleted( int ) ) ); +} + +KornBoxCfgImpl::~KornBoxCfgImpl() +{ + delete _fonts[ 0 ]; + delete _fonts[ 1 ]; + delete _anims[ 0 ]; + delete _anims[ 1 ]; +} + +void KornBoxCfgImpl::readConfig( KConfig * config, const int index ) +{ + _config = config; + _index = index; + + _config->setGroup( QString( "korn-%1" ).arg( index ) ); + + readViewConfig(); + readEventConfig(); + readDCOPConfig(); + readAccountsConfig(); +} + +void KornBoxCfgImpl::writeConfig( KConfig * config, const int index ) +{ + config->setGroup( QString( "korn-%1" ).arg( index ) ); + + writeViewConfig( config ); + writeEventConfig( config ); + writeDCOPConfig( config ); + writeAccountsConfig( config ); +} + +//private +void KornBoxCfgImpl::readViewConfig() +{ + this->chNormalText->setChecked(_config->readBoolEntry ( "hasnormalfgcolour", true ) ); + this->cbNormalText->setColor( _config->readColorEntry( "normalfgcolour", &Qt::black ) ); + this->chNewText->setChecked( _config->readBoolEntry ( "hasnewfgcolour", true ) ); + this->cbNewText->setColor( _config->readColorEntry( "newfgcolour", &Qt::black ) ); + this->chNormalBack->setChecked(_config->readBoolEntry ( "hasnormalbgcolour", false ) ); + this->cbNormalBack->setColor( _config->readColorEntry( "normalbgcolour", &Qt::white ) ); + this->chNewBack->setChecked( _config->readBoolEntry ( "hasnewbgcolour", false ) ); + this->cbNewBack->setColor( _config->readColorEntry( "newbgcolour", &Qt::white ) ); + + this->chNormalIcon->setChecked(_config->readBoolEntry( "hasnormalicon", false ) ); + this->ibNormalIcon->setIcon( _config->readEntry ( "normalicon", "" ) ); + this->chNewIcon->setChecked( _config->readBoolEntry( "hasnewicon", false ) ); + this->ibNewIcon->setIcon( _config->readEntry ( "newicon", "" ) ); + + this->chNormalFont->setChecked(_config->readBoolEntry( "hasnormalfont", false ) ); + this->chNewFont->setChecked (_config->readBoolEntry( "hasnewfont", false ) ); + this->chNormalAnim->setChecked(_config->readBoolEntry( "hasnormalanim", false ) ); + this->chNewAnim->setChecked( _config->readBoolEntry( "hasnewanim", false ) ); + *_fonts[ 0 ] = _config->readFontEntry( "normalfont" ); + *_fonts[ 1 ] = _config->readFontEntry( "newfont" ); + *_anims[ 0 ] = _config->readEntry ( "normalanim", "" ); + *_anims[ 1 ] = _config->readEntry ( "newanim", "" ); +} + +void KornBoxCfgImpl::readEventConfig() +{ + this->chLeftRecheck ->setChecked( _config->readBoolEntry( "leftrecheck", true ) ); + this->chMiddleRecheck->setChecked( _config->readBoolEntry( "middlerecheck", false ) ); + this->chRightRecheck ->setChecked( _config->readBoolEntry( "rightrecheck", false ) ); + + this->chLeftReset ->setChecked( _config->readBoolEntry( "leftreset", false ) ); + this->chMiddleReset->setChecked( _config->readBoolEntry( "middlereset", false ) ); + this->chRightReset ->setChecked( _config->readBoolEntry( "rightreset", false ) ); + + this->chLeftView ->setChecked( _config->readBoolEntry( "leftview", false ) ); + this->chMiddleView->setChecked( _config->readBoolEntry( "middleview", false ) ); + this->chRightView ->setChecked( _config->readBoolEntry( "rightview", false ) ); + + this->chLeftRun ->setChecked( _config->readBoolEntry( "leftrun", false ) ); + this->chMiddleRun->setChecked( _config->readBoolEntry( "middlerun", false ) ); + this->chRightRun ->setChecked( _config->readBoolEntry( "rightrun", false ) ); + + this->chLeftPopup ->setChecked( _config->readBoolEntry( "leftpopup", false ) ); + this->chMiddlePopup->setChecked( _config->readBoolEntry( "middlepopup", false ) ); + this->chRightPopup ->setChecked( _config->readBoolEntry( "rightpopup", true ) ); + + this->edCommand->setURL( _config->readEntry( "command", "" ) ); + + this->edNewRun->setURL( _config->readEntry( "newcommand", "" ) ); + this->edPlaySound->setURL( _config->readEntry( "sound", "" ) ); + this->chShowPassive->setChecked( _config->readBoolEntry( "passivepopup", false ) ); + this->chPassiveDate->setChecked( _config->readBoolEntry( "passivedate", false ) ); +} + +void KornBoxCfgImpl::readAccountsConfig() +{ + elbAccounts->setGroupName( QString( "korn-%1-%2" ).arg( _index ) ); + elbAccounts->setConfig( _config ); +} + +void KornBoxCfgImpl::readDCOPConfig() +{ + elbDCOP->clear(); + elbDCOP->insertStringList( _config->readListEntry( "dcop", ',' ) ); +} + +void KornBoxCfgImpl::writeViewConfig( KConfig* config ) +{ + QColor invalid; + + config->writeEntry( "hasnormalfgcolour", this->chNormalText->isChecked() ); + config->writeEntry( "normalfgcolour", this->chNormalText->isChecked() ? this->cbNormalText->color() : invalid ); + config->writeEntry( "hasnewfgcolour", this->chNewText->isChecked() ); + config->writeEntry( "newfgcolour", this->chNewText->isChecked() ? this->cbNewText->color() : invalid ); + config->writeEntry( "hasnormalbgcolour", this->chNormalBack->isChecked() ); + config->writeEntry( "normalbgcolour", this->chNormalBack->isChecked() ? this->cbNormalBack->color() : invalid ); + config->writeEntry( "hasnewbgcolour", this->chNewBack->isChecked() ); + config->writeEntry( "newbgcolour", this->chNewBack->isChecked() ? this->cbNewBack->color() : invalid ); + + config->writeEntry( "hasnormalicon", this->chNormalIcon->isChecked() ); + config->writeEntry( "normalicon", this->chNormalIcon->isChecked() ? this->ibNormalIcon->icon() : "" ); + config->writeEntry( "hasnewicon", this->chNewIcon->isChecked() ); + config->writeEntry( "newicon", this->chNewIcon->isChecked() ? this->ibNewIcon->icon() : "" ); + + config->writeEntry( "hasnormalfont", this->chNormalFont->isChecked() ); + config->writeEntry( "normalfont", this->chNormalFont->isChecked() ? *_fonts[ 0 ] : QFont() ); + config->writeEntry( "hasnewfont", this->chNewFont->isChecked() ); + config->writeEntry( "newfont", this->chNewFont->isChecked() ? *_fonts[ 1 ] : QFont() ); + config->writeEntry( "hasnormalanim", this->chNormalAnim->isChecked() ); + config->writeEntry( "normalanim", this->chNormalAnim->isChecked() ? *_anims[ 0 ] : "" ); + config->writeEntry( "hasnewanim", this->chNewAnim->isChecked() ); + config->writeEntry( "newanim", this->chNewAnim->isChecked() ? *_anims[ 1 ] : "" ); + +} + +void KornBoxCfgImpl::writeEventConfig( KConfig *config ) +{ + config->writeEntry( "leftrecheck", this->chLeftRecheck ->isChecked() ); + config->writeEntry( "middlerecheck", this->chMiddleRecheck->isChecked() ); + config->writeEntry( "rightrecheck", this->chRightRecheck ->isChecked() ); + + config->writeEntry( "leftreset", this->chLeftReset ->isChecked() ); + config->writeEntry( "middlereset", this->chMiddleReset->isChecked() ); + config->writeEntry( "rightreset", this->chRightReset ->isChecked() ); + + config->writeEntry( "leftview", this->chLeftView ->isChecked() ); + config->writeEntry( "middleview", this->chMiddleView->isChecked() ); + config->writeEntry( "rightview", this->chRightView ->isChecked() ); + + config->writeEntry( "leftrun", this->chLeftRun ->isChecked() ); + config->writeEntry( "middlerun", this->chMiddleRun->isChecked() ); + config->writeEntry( "rightrun", this->chRightRun ->isChecked() ); + + config->writeEntry( "leftpopup", this->chLeftPopup ->isChecked() ); + config->writeEntry( "middlepopup", this->chMiddlePopup->isChecked() ); + config->writeEntry( "rightpopup", this->chRightPopup ->isChecked() ); + + config->writeEntry( "command", this->edCommand->url() ); + + config->writeEntry( "newcommand", this->edNewRun->url() ); + config->writeEntry( "sound", this->edPlaySound->url() ); + config->writeEntry( "passivepopup", this->chShowPassive->isChecked() ); + config->writeEntry( "passivedate", this->chPassiveDate->isChecked() ); +} + +void KornBoxCfgImpl::writeAccountsConfig( KConfig */*config */) +{ +} + +void KornBoxCfgImpl::writeDCOPConfig( KConfig *config ) +{ + config->writeEntry( "dcop", elbDCOP->items(), ',' ); +} + +void KornBoxCfgImpl::slotEditBox() +{ + if( _base ) + return; //Already a dialog open + if( elbAccounts->listBox()->currentItem() < 0 ) + return; //No item selected + elbAccounts->setEnabled( false ); + + _base = new KDialogBase( this, "Account Dialog", false, i18n("Box Configuration"), + KDialogBase::Ok | KDialogBase::Cancel, KDialogBase::Ok, true ); + KornAccountCfgImpl *widget = new KornAccountCfgImpl( _base, "Account Widget" ); + + _base->setMainWidget( widget ); + + connect( _base, SIGNAL( finished() ), this, SLOT( slotDialogDestroyed() ) ); + + _group = new KConfigGroup( _config, QString( "korn-%1-%2" ). + arg( _index ).arg(elbAccounts->listBox()->currentItem() ) ); + + QMap< QString, QString > *map = new QMap< QString, QString >( _config->entryMap( QString( "korn-%1-%2" ). + arg( _index ).arg(elbAccounts->listBox()->currentItem() ) ) ); + widget->readConfig( _group, map, _index, elbAccounts->listBox()->currentItem() ); + delete map; + + _base->show(); +} + +void KornBoxCfgImpl::slotActivated( const QString& ) +{ + slotEditBox(); +} + +void KornBoxCfgImpl::slotActivated( const int ) +{ + slotEditBox(); +} + +void KornBoxCfgImpl::slotSetDefaults( const QString& name, const int, KConfig* config ) +{ + config->writeEntry( "name", name ); + config->writeEntry( "protocol", "mbox" ); + config->writeEntry( "host", QString::null ); + config->writeEntry( "port", QString::null ); + config->writeEntry( "username", QString::null ); + config->writeEntry( "mailbox", "/var/spool/mail/" ); + config->writeEntry( "savepassword", 0 ); + config->writeEntry( "password", QString::null ); + config->writeEntry( "auth", QString::null ); + config->writeEntry( "interval", 300 ); + config->writeEntry( "boxsettings", true ); + config->writeEntry( "command", "" ); + config->writeEntry( "sound", "" ); + config->writeEntry( "passivepopup", false ); + config->writeEntry( "passivedate", false ); +} + +void KornBoxCfgImpl::slotChangeNormalAnim() +{ + *_anims[ 0 ] = KFileDialog::getOpenFileName( *_anims[ 0 ], ".mng .gif", this, i18n("Normal animation") ); +} + +void KornBoxCfgImpl::slotChangeNewAnim() +{ + *_anims[ 1 ] = KFileDialog::getOpenFileName( *_anims[ 1 ], ".mng .gif", this, i18n("Normal animation") ); +} + +void KornBoxCfgImpl::slotChangeNormalFont() +{ + KFontDialog fd( this, "font dialog" ); + fd.setFont( *_fonts[ 0 ], false ); + fd.exec(); + *_fonts[ 0 ] = fd.font(); +} + +void KornBoxCfgImpl::slotChangeNewFont() +{ + KFontDialog fd( this, "font dialog" ); + fd.setFont( *_fonts[ 1 ], false ); + fd.exec(); + *_fonts[ 1 ] = fd.font(); +} + +void KornBoxCfgImpl::slotNormalAnimToggled( bool enabled ) +{ + this->chNormalText->setEnabled( !enabled ); + //this->chNormalBack->setEnabled( !enabled ); + this->chNormalIcon->setEnabled( !enabled ); + this->chNormalFont->setEnabled( !enabled ); + + this->cbNormalText->setEnabled( !enabled && this->chNormalText->isChecked() ); + //this->cbNormalBack->setEnabled( !enabled && this->chNormalBack->isChecked() ); + this->ibNormalIcon->setEnabled( !enabled && this->chNormalIcon->isChecked() ); + this->pbNormalFont->setEnabled( !enabled && this->chNormalFont->isChecked() ); +} + +void KornBoxCfgImpl::slotNewAnimToggled( bool enabled ) +{ + this->chNewText->setEnabled( !enabled ); + //this->chNewBack->setEnabled( !enabled ); + this->chNewIcon->setEnabled( !enabled ); + this->chNewFont->setEnabled( !enabled ); + + this->cbNewText->setEnabled( !enabled && this->chNewText->isChecked() ); + //this->cbNewBack->setEnabled( !enabled && this->chNewBack->isChecked() ); + this->ibNewIcon->setEnabled( !enabled && this->chNewIcon->isChecked() ); + this->pbNewFont->setEnabled( !enabled && this->chNewFont->isChecked() ); +} + +void KornBoxCfgImpl::slotOK() +{ + writeConfig( _config, _index ); +} + +void KornBoxCfgImpl::slotCancel() +{ + readConfig( _config, _index ); +} + +void KornBoxCfgImpl::slotDialogDestroyed() +{ + _base->deleteLater(); _base = 0; + _group->deleteLater(); + elbAccounts->setEnabled( true ); +} + +void KornBoxCfgImpl::slotAccountsSwapped( int account1, int account2 ) +{ + KOrnPassword::swapKOrnWalletPassword( _index, account1, _index, account2 ); +} + +void KornBoxCfgImpl::slotAccountDeleted( int account ) +{ + KOrnPassword::deleteKOrnPassword( _index, account ); +} + +#include "kornboxcfgimpl.moc" + diff --git a/korn/kornboxcfgimpl.h b/korn/kornboxcfgimpl.h new file mode 100644 index 00000000..3a3ea2ee --- /dev/null +++ b/korn/kornboxcfgimpl.h @@ -0,0 +1,93 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_KORNBOXCFGIMPL_H +#define MK_KORNBOXCFGIMPL_H + +#include "kornboxcfg.h" + +class KConfig; +class KConfigGroup; +class KDialogBase; + +class QFont; +class QString; +class QWidget; + +class KornBoxCfgImpl : public KornBoxCfg +{ Q_OBJECT +public: + KornBoxCfgImpl( QWidget *parent, const char * name ); + ~KornBoxCfgImpl(); + + /** + * This method write the current configuration to a specified KConfig-object. + * + * @param config The config where in which the configuration should be added. + * @param index The index of the selected config. This is the group-number. + */ + void writeConfig( KConfig * config, const int index ); + + /** + * This method write the current configuration to a specified KConfig-object. + * + * @param config The config where in which the configuration should be added. Note that this object is stored locally until the object is destroyed. + * @param index The index of the selected config. This is the group-number. + */ + void readConfig( KConfig * config, const int index ); + +private: + void readViewConfig(); + void readEventConfig(); + void readAccountsConfig(); + void readDCOPConfig(); + + void writeViewConfig( KConfig* config ); + void writeEventConfig( KConfig *config ); + void writeAccountsConfig( KConfig *config ); + void writeDCOPConfig( KConfig *config ); + + KConfig* _config; + KConfigGroup *_group; + KDialogBase *_base; + int _index; + QString *_anims[ 2 ]; + QFont *_fonts[ 2 ]; + +protected slots: + virtual void slotEditBox(); + virtual void slotActivated( const QString& ); + virtual void slotActivated( const int ); + virtual void slotSetDefaults( const QString&, const int, KConfig* ); + virtual void slotChangeNormalAnim(); + virtual void slotChangeNewAnim(); + virtual void slotChangeNormalFont(); + virtual void slotChangeNewFont(); + virtual void slotNormalAnimToggled( bool enabled ); + virtual void slotNewAnimToggled( bool enabled ); + +private slots: + void slotOK(); + void slotCancel(); + void slotDialogDestroyed(); + + void slotAccountsSwapped( int account1, int account2 ); + void slotAccountDeleted( int account ); +}; + +#endif //MK_KORNBOXCFGIMPL_H diff --git a/korn/korncfg.ui b/korn/korncfg.ui new file mode 100644 index 00000000..46a812a5 --- /dev/null +++ b/korn/korncfg.ui @@ -0,0 +1,176 @@ + +KornCfgWidget + + + KornCfgWidget + + + + 0 + 0 + 350 + 336 + + + + Korn Configuration + + + + unnamed + + + + tabKornCfg + + + + tab + + + &Boxes + + + + unnamed + + + + elbBoxes + + + + + pbEdit + + + &Edit + + + + + chUseWallet + + + Use &KWallet if possible + + + true + + + + + + + tab + + + &View + + + + unnamed + + + + bgCheckBoxes + + + + + + true + + + + unnamed + + + + rbHorizontal + + + &Horizontal + + + + + rbVertical + + + &Vertical + + + + + rbDocked + + + &Docked + + + + + + + + + + + + KEditListBoxManager +
keditlistboxman.h
+ + -1 + -1 + + 0 + + 5 + 5 + 0 + 0 + + image0 + activated( const QString& ) + activated( const int ) + setDefaults( const QString&, KConfig* ) + setDefaults( const QString&, const int, KConfig* ) + + + + + 89504e470d0a1a0a0000000d4948445200000016000000160806000000c4b46c3b0000030149444154388db59531681b5718c77f0e377c070e3c810a3a70e0041eac51852e0a19e45134830a1d9a4c69a04bc8928e990a693a640e1d0c8642b08742321894c1507991b484c890902bb8701a047760c3bd21701fe4201dde49b6a41a32b8df72dcbbeffdbefffbbfefbd5b1b0c07cce266ebe667ae2006c3c1dada0cdc3be87d6e6c35b0d692a409d9c7ec8b20d65ae29398d19b1114e7e3de4ce98b3f5e10dc0053cf0951b4506496e1b964bf7ce6c585d9054c62d01d617ca48be0596553cf496d8f2c8b01c5f795fc93904e85ec4c01a152857a5d9175d0b2805c872080f18595ccc1499a10a225d4e2fbc2877786fe81253ab6c04c8d106e09db5d43ab0d146e5c64d1a23938fb98a185cea1c33eecfd9eba49eb427dcb201e245365f2b7b2fb5b4a3a31dcb927178afe07d86901df870fefa4842aed6f6b74ba42e52b4014d580e1eb9cbd9d94de7e4aad16d2f9be02d805f0b5e532f927a1ffcacea1777f122a8105b164a7c25faf323a5d9f1f1fd600e1e5bec59e2d4b5c7ef5209d0ad17b8b31864e57c0b3e0815ac3ee33253ab664a770ff5185d1a1cb8d2267d3e58aa1dc7d2508cbe597d0e74fdd269aaaf0f52d414c4ea3e9762c996869e42560d7a72e41c4799a2586e74f95e8d8151481fa86efbe7b3398ac58b1a2b8527589f15451ad303ac2293542ad6648a796278f13a27185e4c4754310facb98c53a79e19a3fdc1426ff28c3d7399d1f7cb25343eb96106cf83c790ce9c4f2eb831855c55485663327992eb6dc8a6259874ed700b0b793323cccb9ffa842b30d6133e3e75fea989ac15a8b16ca76b746b0b92278d919774c5b6d48a78697fb29bbcf52468742a32120909c24e899ce67beed5be2db01e22d1e9485bb620e47f9ee9e606a21bd3f5d3744c7e7c54d55e87443867d8b554515ac5db4620e8e4f62263170fd1cdee90aad7640141992891b0f367c9adfe4049bb07d3b7022bd8c687c0978f46684ee084150b65ac1fcca94591b7a90a496e4c095164fb016a2b192a497795cc0f84817aebe25f7bf70ccc54a575c555c03f78ffa5fc0570d1f0c076bff0232285a09643cc7ce0000000049454e44ae426082 + + + + + elbBoxes + activated(const QString&) + KornCfgWidget + slotActivated(const QString&) + + + elbBoxes + setDefaults(const QString&,const int,KConfig*) + KornCfgWidget + slotSetDefaults(const QString&,const int,KConfig*) + + + pbEdit + clicked() + KornCfgWidget + slotEditBox() + + + + slotActivated( const QString& ) + slotActivated( const int ) + slotOK() + slotApply() + slotCancel() + slotSetDefaults( const QString&, const int, KConfig* ) + slotEditBox() + + + diff --git a/korn/korncfgimpl.cpp b/korn/korncfgimpl.cpp new file mode 100644 index 00000000..6860c17e --- /dev/null +++ b/korn/korncfgimpl.cpp @@ -0,0 +1,253 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "korncfgimpl.h" + +#include "keditlistboxman.h" +#include "kornboxcfgimpl.h" +#include "password.h" + +#include +#include +#include +#include + +#include +#include +#include +#include +#include + + +/* + * parent should be of type KDialogBase + */ +KornCfgImpl::KornCfgImpl( QWidget * parent, const char * name ) + : KornCfgWidget( parent, name ), + _config( new KConfig( "kornrc" ) ), + _base( 0 ) +{ + elbBoxes->setSubGroupName( "korn-%1-%2" ); + elbBoxes->setGroupName( "korn-%1" ); + elbBoxes->setConfig( _config ); + elbBoxes->setTitle( i18n( "Boxes" ) ); + + connect( parent, SIGNAL( okClicked() ), this, SLOT( slotOK() ) ); + connect( parent, SIGNAL( cancelClicked() ), this, SLOT( slotCancel() ) ); + connect( parent, SIGNAL( applyClicked() ), this, SLOT( slotApply() ) ); + + connect( elbBoxes, SIGNAL( elementsSwapped( int, int ) ), this, SLOT( slotElementsSwapped( int, int ) ) ); + connect( elbBoxes, SIGNAL( elementDeleted( int ) ), this, SLOT( slotElementDeleted( int ) ) ); + + readConfig(); +} + +KornCfgImpl::~KornCfgImpl() +{ + _config->sync(); +} + +void KornCfgImpl::slotEditBox() +{ + if( _base ) + return; //Already a dialog open + if( elbBoxes->listBox()->currentItem() < 0 ) + return; //No item selected + elbBoxes->setEnabled( false ); + + _base = new KDialogBase( this, "Box Dialog", false, "Box Configuration", + KDialogBase::Ok | KDialogBase::Cancel, KDialogBase::Ok, true ); + KornBoxCfgImpl *widget = new KornBoxCfgImpl( _base, "Box Widget" ); + + connect( _base, SIGNAL( finished() ), this, SLOT( slotDialogDestroyed() ) ); + + _base->setMainWidget( widget ); + widget->readConfig( _config, elbBoxes->listBox()->currentItem() ); + + _base->show(); +} + +void KornCfgImpl::slotDialogDestroyed() +{ + _base->deleteLater(); _base = 0; + elbBoxes->setEnabled( true ); +} + +void KornCfgImpl::slotElementsSwapped( int box1, int box2 ) +{ + int accountnumber1 = 0, accountnumber2 = 0; + while( _config->hasGroup( QString( "korn-%1-%2" ).arg( box1 ).arg( accountnumber1 ) ) ) + ++accountnumber1; + + while( _config->hasGroup( QString( "korn-%1-%2" ).arg( box2 ).arg( accountnumber2 ) ) ) + ++accountnumber2; + + KOrnPassword::swapKOrnWalletPasswords( box1, accountnumber1, box2, accountnumber2 ); +} + +void KornCfgImpl::slotElementDeleted( int box ) +{ + int accountnumber = 0; + while( _config->hasGroup( QString( "korn-%1-%2" ).arg( box ).arg( accountnumber ) ) ) + { + KOrnPassword::deleteKOrnPassword( box, accountnumber ); + ++accountnumber; + } +} + +void KornCfgImpl::slotActivated( const QString& ) +{ + slotEditBox(); +} + +void KornCfgImpl::slotActivated( const int ) +{ + slotEditBox(); +} + +void KornCfgImpl::slotSetDefaults( const QString& name, const int index, KConfig* config ) +{ + config->writeEntry( "name", name ); + config->writeEntry( "hasnormalfgcolour", true ); + config->writeEntry( "hasnewfgcolour", true ); + config->writeEntry( "hasnormalbgcolour", false ); + config->writeEntry( "hasnewbgcolour", false ); + config->writeEntry( "hasnormalicon", false ); + config->writeEntry( "hasnewicon", false ); + config->writeEntry( "hasnormalanim", false ); + config->writeEntry( "hasnewanim", false ); + config->writeEntry( "normalfgcolour", Qt::black ); + config->writeEntry( "newfgcolour", Qt::black ); + config->writeEntry( "normalbgcolour", QString::null ); + config->writeEntry( "newbgcolour", QString::null ); + config->writeEntry( "normalicon", QString::null ); + config->writeEntry( "newicon", QString::null ); + config->writeEntry( "normalanim", QString::null ); + config->writeEntry( "newanim", QString::null ); + config->writeEntry( "leftrecheck", true ); + config->writeEntry( "middlerecheck", false ); + config->writeEntry( "rightrecheck", false ); + config->writeEntry( "leftreset", false ); + config->writeEntry( "middlereset", false ); + config->writeEntry( "rightreset", false ); + config->writeEntry( "leftview", false ); + config->writeEntry( "middleview", false ); + config->writeEntry( "rightview", false ); + config->writeEntry( "leftcommand", false ); + config->writeEntry( "middlecommand", false ); + config->writeEntry( "rightcommand", false ); + config->writeEntry( "leftpopup", false ); + config->writeEntry( "middlepopupk", false ); + config->writeEntry( "rightpopup", true ); + config->writeEntry( "command", "" ); + config->writeEntry( "newcommand", "" ); + config->writeEntry( "sound", "" ); + config->writeEntry( "passivepopup", false ); + config->writeEntry( "passivedate", false ); + config->writeEntry( "numaccounts", 1 ); + config->writeEntry( "dcop", QStringList() ); + config->setGroup( QString( "korn-%1-0" ).arg( index ) ); + config->writeEntry( "name", name ); + config->writeEntry( "protocol", "mbox" ); + config->writeEntry( "server", QString::null ); + config->writeEntry( "port", QString::null ); + config->writeEntry( "username", QString::null ); + config->writeEntry( "mailbox", "/var/spool/mail/" ); + config->writeEntry( "savepassword", 0 ); + config->writeEntry( "password", QString::null ); + config->writeEntry( "auth", QString::null ); + config->writeEntry( "interval", 300 ); + config->writeEntry( "boxsettings", true ); + config->writeEntry( "command", "" ); + config->writeEntry( "sound", "" ); + config->writeEntry( "passivepopup", false ); + config->writeEntry( "passivedate", false ); +} + +void KornCfgImpl::slotOK() +{ + writeConfig(); +} + +void KornCfgImpl::slotCancel() +{ + _config->rollback(); +} + +void KornCfgImpl::slotApply() +{ + writeConfig(); +} + +void KornCfgImpl::readConfig() +{ + _config->setGroup( "korn" ); + + QChar layout = _config->readEntry( "layout" ).stripWhiteSpace()[0].upper(); + if( layout == QChar( 'H' ) ) + rbHorizontal->setChecked( true ); + else if( layout == QChar( 'V' ) ) + rbVertical->setChecked( true ); + else + rbDocked->setChecked( true ); + + chUseWallet->setChecked( _config->readBoolEntry( "usewallet", true ) ); +} + +void KornCfgImpl::writeConfig() +{ + _config->setGroup( "korn" ); + + if( rbHorizontal->isChecked() ) + _config->writeEntry( "layout", "Horizontal" ); + if( rbVertical->isChecked() ) + _config->writeEntry( "layout", "Vertical" ); + if( rbDocked->isChecked() ) + _config->writeEntry( "layout", "Docked" ); + + //Default is 'false' here, because if no option is set, KWallet isn't used. + if( _config->readBoolEntry( "usewallet", false ) != chUseWallet->isChecked() ) + //Configuration box changed => setting over configuration + rewritePasswords(); + + _config->writeEntry( "usewallet", chUseWallet->isChecked() ); + + _config->sync(); +} + +void KornCfgImpl::rewritePasswords() +{ + int box = 0 - 1; + int account = 0 - 1; + KConfigGroup *group; + + while( _config->hasGroup( QString( "korn-%1" ).arg( ++box ) ) ) + { + account = 0 - 1; + while( _config->hasGroup( QString( "korn-%1-%2" ).arg( box ).arg( ++account ) ) ) + { + group = new KConfigGroup( _config, QString( "korn-%1-%2" ).arg( box ).arg( account ) ); + KOrnPassword::rewritePassword( box, account, *group, chUseWallet->isChecked() ); + delete group; + } + } + + _config->setGroup( "korn" ); +} + +#include "korncfgimpl.moc" diff --git a/korn/korncfgimpl.h b/korn/korncfgimpl.h new file mode 100644 index 00000000..fc86a4fa --- /dev/null +++ b/korn/korncfgimpl.h @@ -0,0 +1,61 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_KORNCFGIMPL_H +#define MK_KORNCFGIMPL_H + +class KConfig; +#include "korncfg.h" + +class KDialogBase; + +class QObject; +class QString; + +class KornCfgImpl : public KornCfgWidget +{ Q_OBJECT +public: + KornCfgImpl( QWidget * parent = 0, const char * name = 0 ); + ~KornCfgImpl(); + +private slots: + virtual void slotDialogDestroyed(); + void slotElementsSwapped( int box1, int box2 ); + void slotElementDeleted( int box ); +protected slots: + virtual void slotEditBox(); + virtual void slotActivated( const QString& ); + virtual void slotActivated( const int ); + virtual void slotSetDefaults( const QString&, const int, KConfig* ); +public slots: + virtual void slotOK(); + virtual void slotCancel(); + virtual void slotApply(); + +private: + void readConfig(); + void writeConfig(); + + void rewritePasswords(); + + KConfig *_config; + KDialogBase *_base; +}; + + +#endif //MK_KORNCFGIMPL_H diff --git a/korn/kornshell.cpp b/korn/kornshell.cpp new file mode 100644 index 00000000..3e87ba42 --- /dev/null +++ b/korn/kornshell.cpp @@ -0,0 +1,155 @@ +/* + * Copyright (C) 2004-2006, Mart Kelder (mart@kelder31.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "kornshell.h" + +#include "boxcontainer.h" +#include "dockedcontainer.h" +#include "korncfgimpl.h" +#include "hvcontainer.h" +#include "password.h" + +#include +#include +#include +#include +#include + +#include + +KornShell::KornShell( QWidget * parent, const char * name ) + : QWidget( parent, name ), + _config( new KConfig( "kornrc" ) ), + _box( 0 ), + _configDialog( 0 ), + _show( false ) +{ + _config->checkUpdate( "korn_kde_3_4_config_change", "korn-3-4-config_change.upd" ); + if( kapp->isRestored() ) + { + _config->setGroup( "korn" ); + QTimer::singleShot( _config->readNumEntry( "session_startup_delay", 2000 ), this, SLOT(readConfig()) ); + kdDebug() << "startup delayed" << endl; + } + else + { + kdDebug() << "Startup not delayed" << endl; + readConfig(); + } + +} + +KornShell::~KornShell() +{ + if( _box ) + _box->writeConfig( _config ); + delete _config; + delete _box; +} + +void KornShell::show() +{ + if( _box ) + _box->showBox(); + else + _show = true; +} + +void KornShell::optionDlg() +{ + if( _configDialog ) + { + _configDialog->show(); + return; + } + + _configDialog = new KDialogBase( 0, "Configuration Dialog", false, i18n( "Korn Configuration" ), + KDialogBase::Ok | KDialogBase::Cancel | KDialogBase::Apply, KDialogBase::Ok, true ); + + KornCfgImpl *widget = new KornCfgImpl( _configDialog, "Configuration widget" ); + _configDialog->setMainWidget( widget ); + + connect( _configDialog, SIGNAL( finished() ), this, SLOT( slotDialogClosed() ) ); + connect( _configDialog, SIGNAL( applyClicked() ), this, SLOT( slotApply() ) ); + + _configDialog->show(); +} + +void KornShell::readConfig() +{ + static bool shownConfig = false; + + _config->setGroup( "korn" ); + QChar layout = _config->readEntry( "layout", "Docked" )[0].upper(); + KOrnPassword::setUseWallet( _config->readBoolEntry( "usewallet", false ) ); + + if( layout == 'H' ) + _box = new HVContainer( Qt::Horizontal, this, "horizontal container" ); + else if( layout == 'V' ) + _box = new HVContainer( Qt::Vertical, this, "vertical container" ); + else + _box = new DockedContainer( this, "docked container" ); + + connect( _box, SIGNAL( showConfiguration() ), this, SLOT( optionDlg() ) ); + + _box->readConfig( _config ); + + //Show configuration dialog of no boxes are configurated + if( !_config->hasGroup( "korn-0" ) ) + //If user pressed cancel, or did not add a box, close KOrn + if( !shownConfig ) + { + shownConfig = true; + optionDlg(); + } + else + { + kapp->quit(); + } + + if( _show ) + { + // Show is called, but _box wasn't available at that time + show(); + _show = false; + } +} + +void KornShell::slotDialogClosed() +{ + _configDialog->deleteLater(); _configDialog = 0; + + //At this time, just delete all widgets and make a new one. + //Maybe, this should replaces later by a better variant. + slotApply(); +} + +void KornShell::slotApply() +{ + //At this time, just delete all widgets and make a new one. + //Maybe, this should replaces later by a better variant. + + delete _box; _box = 0; + + _config->reparseConfiguration(); + + readConfig(); + _box->showBox(); +} + +#include "kornshell.moc" diff --git a/korn/kornshell.h b/korn/kornshell.h new file mode 100644 index 00000000..b999bfed --- /dev/null +++ b/korn/kornshell.h @@ -0,0 +1,57 @@ +/* + * Copyright (C) 2004-2006, Mart Kelder (mart@kelder31.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_KORNSHELL_H +#define MK_KORNSHELL_H + +class BoxContainer; +class KDialogBase; + +class KConfig; + +#include + +/** + * This is a rewritten KornShell class. It is rewritten because the depending classes changed. + */ +class KornShell : public QWidget +{ Q_OBJECT +public: + KornShell( QWidget * parent = 0, const char * name = 0 ); + ~KornShell(); + + void show(); +public slots: + /** + * This function shows the configuration-dialog + */ + void optionDlg(); + +private slots: + void slotDialogClosed(); + void slotApply(); + void readConfig(); + +private: + KConfig *_config; + BoxContainer *_box; + KDialogBase *_configDialog; + bool _show; +}; + +#endif //MK_KORNSHELL_H diff --git a/korn/label.h b/korn/label.h new file mode 100644 index 00000000..d3c87ae9 --- /dev/null +++ b/korn/label.h @@ -0,0 +1,43 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_LABEL_H +#define MK_LABEL_H + +#include +#include + +/** + * A simple overriding of the QLabel class to get a mouseButtonPressed() signal + */ +class Label : public QLabel +{ Q_OBJECT +public: + Label( QWidget * parent = 0, const char * name = 0 ) : QLabel( parent, name ) {} + virtual ~Label() {} + +protected: + virtual void mousePressEvent( QMouseEvent *e ) { emit mouseButtonPressed( e->button() ); } +signals: + /** + * Emitted when a button is pressed. + */ + void mouseButtonPressed( Qt::ButtonState ); +}; + +#endif //MK_LABEL_H diff --git a/korn/maildir_proto.h b/korn/maildir_proto.h new file mode 100644 index 00000000..b3b7ae3a --- /dev/null +++ b/korn/maildir_proto.h @@ -0,0 +1,56 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_MAILDIR_PROTO_H +#define MK_MAILDIR_PROTO_H + +#include "kio_proto.h" + +/* + * Protocol for (postfix?) maildir + * Only tested with a copy of a maildir forder + */ +class Maildir_Protocol : public KIO_Protocol +{ +public: + Maildir_Protocol() {} + virtual ~Maildir_Protocol() {} + + virtual KIO_Protocol * clone() const { return new Maildir_Protocol; } + + virtual QString protocol() const { return "file"; } + virtual QString configName() const { return "maildir"; } + + virtual bool canReadSubjects() const { return true; } + virtual bool canDeleteMail() const { return true; } + virtual bool canReadMail() const { return true; } + virtual bool fullMessage() const { return true; } + + virtual int fields() const { return server | mailbox; } + virtual int urlFields() const { return no_fields; } + + virtual QString serverName() const { return i18n( "Path:" ); } + + virtual void recheckKURL( KURL &kurl, KIO::MetaData & ) + { kurl.setPath( kurl.host() + "/." + kurl.path().replace( '/' , '.' ) + "/new" ); kurl.setHost( "" ); } + virtual void readSubjectKURL( KURL &, KIO::MetaData & ) { } + virtual void deleteMailKURL( KURL &, KIO::MetaData & ) { } + virtual void readMailKURL( KURL &, KIO::MetaData & ) { } +}; + +#endif diff --git a/korn/maildlg.cpp b/korn/maildlg.cpp new file mode 100644 index 00000000..3e6cd4cc --- /dev/null +++ b/korn/maildlg.cpp @@ -0,0 +1,109 @@ +#include "maildlg.h" +#include +#include +#include +#include +#include "mailsubject.h" +#include +#include "maildrop.h" + +KornMailDlg::KornMailDlg( QWidget *parent ) + : KDialogBase( parent, "maildialog", true, i18n("Mail Details"), User1|Close, Close, true, KGuiItem(i18n("&Full Message"))), + _progress( 0 ) +{ + QWidget * page = new QWidget( this ); + setMainWidget(page); + QVBoxLayout * topLayout = new QVBoxLayout( page, 0, spacingHint() ); + _editCtrl = new KEdit(page); + topLayout->addWidget(_editCtrl, 10); + _editCtrl->setReadOnly(true); + connect(this, SIGNAL(user1Clicked()), this, SLOT(showFullMessage())); + setInitialSize(QSize(QApplication::desktop()->width()*9/10, QApplication::desktop()->height()/2)); +} + +KornMailDlg::~KornMailDlg() +{ +} + +void KornMailDlg::loadMailCanceled() +{ + _loadMailCanceled = true; +} + + +void KornMailDlg::showFullMessage() +{ + _loadMailCanceled = false; + + // create progress dialog + _progress = new QProgressDialog(this, "bla", TRUE); + _progress->setMinimumDuration(0); + _progress->setLabelText(i18n("Loading full mail. Please wait...")); + + // this should show it even if the mailbox does not support progress bars + _progress->setTotalSteps(1000); + _progress->setProgress(1); + qApp->processEvents(); + + // connect the mailbox with the progress dialog in case it supports progress bars + connect(_mailDrop, SIGNAL(readMailTotalSteps(int)), _progress, SLOT(setTotalSteps(int))); + connect(_mailDrop, SIGNAL(readMailProgress(int)), _progress, SLOT(setProgress(int))); + qApp->processEvents(); + + // connect the mailbox's cancel button + connect(_progress, SIGNAL(canceled()), this, SLOT(loadMailCanceled())); + + connect(_mailDrop, SIGNAL(readMailReady(QString*)), this, SLOT(readMailReady(QString*))); + + // now load the mail fully + if( _mailDrop->synchrone() ) + { + QString mail = _mailDrop->readMail(_mailSubject->getId(), &_loadMailCanceled); + readMailReady( &mail ); + } + else + _mailDrop->readMail(_mailSubject->getId(), &_loadMailCanceled); +} + +void KornMailDlg::setMailSubject( KornMailSubject * mailSubject ) +{ + _mailSubject = mailSubject; + _mailDrop = mailSubject->getMailDrop(); + + // show mail + _editCtrl->setText(_mailSubject->getHeader()); + + // disable "Full Message" button if mail is already loaded fully + enableButton(User1, !_mailSubject->isHeaderFullMessage() && _mailDrop->canReadMail()); +} + +void KornMailDlg::readMailReady( QString* mail ) +{ + deleteProgress(); + + // if loading was not canceled and did not fail + if ( mail->length() > 0) + { + // store full mail in KornMailSubject instance (so that it has not to be loaded again next time) + _mailSubject->setHeader(*mail, true); + + // show fully loaded mail + _editCtrl->setText(*mail); + + // disable "Full Message" button + enableButton(User1, false); + } +} + +void KornMailDlg::deleteProgress() +{ + _progress->setProgress(_progress->totalSteps()); + _progress->hide(); + + disconnect( _mailDrop, SIGNAL(readMailReady(QString*)), this, SLOT(readMailReady(QString*))); + + delete _progress; + _progress = 0; +} + +#include "maildlg.moc" diff --git a/korn/maildlg.h b/korn/maildlg.h new file mode 100644 index 00000000..0d222a70 --- /dev/null +++ b/korn/maildlg.h @@ -0,0 +1,82 @@ +#ifndef KornMailDlg_h +#define KornMailDlg_h + +#include +#include + +class KornMailSubject; +class KMailDrop; + +class QProgressDialog; +class QString; + +/** + * KornMailDlg shows the header and (if available) the body of a mail. + * If the mails body is not available a button allows the user to load it. + */ +class KornMailDlg : public KDialogBase +{ + Q_OBJECT + + /** + * Edit control showing the mail (read only) + */ + KEdit * _editCtrl; + + /** + * The mail to show + */ + KornMailSubject * _mailSubject; + + /** + * The mailbox which can load the mail fully + */ + KMailDrop * _mailDrop; + + /** + * Flag used during the load process. Set to true if the user clicks the cancel button. + */ + bool _loadMailCanceled; + + /** + * Progress bar + */ + QProgressDialog *_progress; +public: + /** + * KornMailDlg Constructor + * @param parent parent widget + */ + KornMailDlg( QWidget *parent=0 ); + + /** + * Set the mail details to show. The mails body is transfered to the edit control + * and the "Full Message" button is enabled, if the mail body is not available and + * if the mailbox can load the mail fully. + * @param mailDrop maibox which can load the mesage fully + * @param mailSubject mail to show + */ + void setMailSubject( KornMailSubject * mailSubject); + + /** + * KornMailDlg Destructor + */ + virtual ~KornMailDlg(); + +private: + void deleteProgress(); +private slots: + /** + * Slot triggered if the user presses the "Full Message" button + */ + void showFullMessage(); + + /** + * Slot triggered if the user canceles the message loading process + */ + void loadMailCanceled(); + + void readMailReady( QString* ); +}; + +#endif diff --git a/korn/maildrop.cpp b/korn/maildrop.cpp new file mode 100644 index 00000000..7a1dd444 --- /dev/null +++ b/korn/maildrop.cpp @@ -0,0 +1,250 @@ +/* +* maildrop.cpp -- Implementation of class KMailDrop. +* Author: Sirtaj Singh Kang +* Version: $Id$ +* Generated: Sat Nov 29 20:07:45 EST 1997 +*/ + +#include +#include + +#include +#include + +#include"utils.h" +#include"maildrop.h" +#include"mailsubject.h" + +const char *KMailDrop::TypeConfigKey = "type"; +const char *KMailDrop::CaptionConfigKey = "caption"; +const char *KMailDrop::ClickConfigKey = "onclick"; +const char *KMailDrop::NewMailConfigKey = "newcommand"; +const char *KMailDrop::SoundFileConfigKey = "sound"; +const char *KMailDrop::BgColourConfigKey = "bgcolour"; +const char *KMailDrop::FgColourConfigKey = "fgcolour"; +const char *KMailDrop::NBgColourConfigKey = "newmailbgcolour"; +const char *KMailDrop::NFgColourConfigKey = "newmailfgcolour"; +const char *KMailDrop::IconConfigKey = "icon"; +const char *KMailDrop::NewMailIconConfigKey = "newmailicon"; +const char *KMailDrop::DisplayStyleConfigKey = "displaystyle"; +const char *KMailDrop::ResetCounterConfigKey = "resetcounter"; +const char *KMailDrop::PassivePopupConfigKey = "passivepopup"; +const char *KMailDrop::PassiveDateConfigKey = "passivedate"; +const char *KMailDrop::UseBoxSettingsConfigKey = "boxsettings"; +const char *KMailDrop::RealNameConfigKey = "name"; + +KMailDrop::KMailDrop() + : _style(Plain), + _lastCount(0) +{ + connect(this, SIGNAL(changed( int, KMailDrop* )), SLOT(setCount( int, KMailDrop* ))); + + //Set default colours; this prevents black (QColor::invalid) boxes after creating a new box. + _bgColour = QApplication::palette().active().background(); + _fgColour = QApplication::palette().active().text(); + _nbgColour = QApplication::palette().active().background(); + _nfgColour = QApplication::palette().active().text(); +} + +KMailDrop::~KMailDrop() +{ + // Empty. +} + +void KMailDrop::setCount(int count, KMailDrop*) +{ + _lastCount = count; +} + +void KMailDrop::notifyClients() +{ + emit(notifyDisconnect()); +} + +//void KMailDrop::addConfigPage(KDropCfgDialog * dlg) +//{ +// dlg->addConfigPage(new KGeneralCfg(this)); +// dlg->addConfigPage(new KCommandsCfg(this)); +//} + +void KMailDrop::forceCountZero() +{ + emit changed( 0, this ); +} + +void KMailDrop::readGeneralConfigGroup( const KConfigBase& cfg ) +{ + _passivePopup = cfg.readBoolEntry(fu(PassivePopupConfigKey), false ); + _passiveDate = cfg.readBoolEntry(fu(PassiveDateConfigKey), false ); + _soundFile = cfg.readEntry(fu(SoundFileConfigKey),""); + _nMailCmd = cfg.readEntry(fu(NewMailConfigKey),""); + + emit(configChanged()); +} + +bool KMailDrop::readConfigGroup(const KConfigBase & c) +{ + _caption = c.readEntry(fu(CaptionConfigKey)); + _clickCmd = c.readPathEntry(fu(ClickConfigKey)); + _style = Style(c.readUnsignedNumEntry(fu(DisplayStyleConfigKey), Plain)); + _bgColour = c.readColorEntry(fu(BgColourConfigKey), &QApplication::palette().active().background()); + _fgColour = c.readColorEntry(fu(FgColourConfigKey), &QApplication::palette().active().text()); + _nbgColour = c.readColorEntry(fu(NBgColourConfigKey), &QApplication::palette().active().background()); + _nfgColour = c.readColorEntry(fu(NFgColourConfigKey), &QApplication::palette().active().text()); + _icon = c.readEntry(fu(IconConfigKey)); + _nIcon = c.readEntry(fu(NewMailIconConfigKey)); + _realName = c.readEntry(fu(RealNameConfigKey)); + + if( !c.readBoolEntry(fu(UseBoxSettingsConfigKey), true ) ) + readGeneralConfigGroup( c ); + + emit(configChanged()); + + return true; +} + +bool KMailDrop::writeConfigGroup(KConfigBase & c) const +{ + c.writeEntry(fu(TypeConfigKey), type()); + c.writeEntry(fu(CaptionConfigKey), caption()); + c.writePathEntry(fu(ClickConfigKey), clickCmd()); + c.writePathEntry(fu(NewMailConfigKey), newMailCmd()); + c.writePathEntry(fu(SoundFileConfigKey), soundFile()); + c.writeEntry(fu(DisplayStyleConfigKey), _style); + c.writeEntry(fu(BgColourConfigKey), _bgColour); + c.writeEntry(fu(FgColourConfigKey), _fgColour); + c.writeEntry(fu(NBgColourConfigKey), _nbgColour); + c.writeEntry(fu(NFgColourConfigKey), _nfgColour); + c.writeEntry(fu(IconConfigKey), _icon); + c.writeEntry(fu(NewMailIconConfigKey), _nIcon); + c.writeEntry(fu(PassivePopupConfigKey), _passivePopup ); + c.writeEntry(fu(PassiveDateConfigKey), _passiveDate ); + + return true; +} + +QValueVector * KMailDrop::doReadSubjects(bool * /*stop*/) +{ + return new QValueVector(); // empty vector +} + +QValueVector * KMailDrop::readSubjects(bool * stop) +{ + // remember timer status + bool timerWasRunning = running(); + + // stop timer to avoid conflicts with reading mesage count + if (timerWasRunning) + stopMonitor(); + + // read the subjects + QValueVector * result = doReadSubjects(stop); + int newcount = result->size(); + + // if the mail count has changed: notify the button! + if( newcount != count() && (!stop || !*stop) && synchrone() ) + { //asynchrone connections don't have a list at this time + emit changed( newcount, this ); + } + + // if the timer was previously running, start it again + if (timerWasRunning) + startMonitor(); + return result; +} + + +bool KMailDrop::deleteMails(QPtrList * /*ids*/, bool * /*stop*/) +{ + return false; +} + +QString KMailDrop::readMail(const KornMailId * /*id*/, bool * /*stop*/) +{ + return ""; +} + +void KMailDrop::setCaption(QString s) +{ + _caption = s; + emit(configChanged()); +} + +void KMailDrop::setClickCmd(QString s) +{ + _clickCmd = s; + emit(configChanged()); +} + +void KMailDrop::setNewMailCmd(QString s) +{ + _nMailCmd = s; + emit(configChanged()); +} + +void KMailDrop::setSoundFile(QString s) +{ + _soundFile = s; + emit(configChanged()); +} + +void KMailDrop::setDisplayStyle(Style s) +{ + _style = s; + emit(configChanged()); +} + +void KMailDrop::setBgColour(QColor c) +{ + _bgColour = c; + emit(configChanged()); +} + +void KMailDrop::setFgColour(QColor c) +{ + _fgColour = c; + emit(configChanged()); +} + +void KMailDrop::setNewBgColour(QColor c) +{ + _nbgColour = c; + emit(configChanged()); +} + +void KMailDrop::setNewFgColour(QColor c) +{ + _nfgColour = c; + emit(configChanged()); +} + +void KMailDrop::setIcon(QString s) +{ + _icon = s; + emit(configChanged()); +} + +void KMailDrop::setNewIcon(QString s) +{ + _nIcon = s; + emit(configChanged()); +} + +void KMailDrop::setPassivePopup( bool pp ) +{ + _passivePopup = pp; + emit(configChanged()); +} + +void KMailDrop::setPassiveDate( bool pd ) +{ + _passiveDate = pd; + emit(configChanged()); +} + +void KMailDrop::setRealName(QString str) +{ + _realName = str; +} + +#include "maildrop.moc" diff --git a/korn/maildrop.h b/korn/maildrop.h new file mode 100644 index 00000000..4bf8f0fa --- /dev/null +++ b/korn/maildrop.h @@ -0,0 +1,456 @@ +/* +* maildrop.h -- Declaration of class KMailDrop. +* Generated by newclass on Sat Nov 29 20:07:45 EST 1997. +*/ +#ifndef SSK_MAILDROP_H +#define SSK_MAILDROP_H + +#include +#include +#include +#include +#include + +class Protocol; + +class KConfigBase; +class KConfigGroup; +class KDropCfgDialog; +class QColor; +class KornMailSubject; +class KornMailId; + +template< class T, class R > class QMap; + +/** +* Abstract base class for all mailbox monitors. +* @author Sirtaj Singh Kang (taj@kde.org) +* @version $Id$ +*/ +class KMailDrop : public QObject +{ + Q_OBJECT + + public: + + enum Style { Plain, Colour, Icon }; + + private: + + QString _caption; + QString _clickCmd; + QString _nMailCmd; + QString _soundFile; + Style _style; + QColor _bgColour; + QColor _fgColour; + QColor _nbgColour; + QColor _nfgColour; + QString _icon; + QString _nIcon; + int _lastCount; + QString _realName; + bool _passivePopup; + bool _passiveDate; + + public: + + static const char *TypeConfigKey; + static const char *CaptionConfigKey; + static const char *ClickConfigKey; + static const char *NewMailConfigKey; + static const char *SoundFileConfigKey; + static const char *DisplayStyleConfigKey; + static const char *NFgColourConfigKey; + static const char *NBgColourConfigKey; + static const char *FgColourConfigKey; + static const char *BgColourConfigKey; + static const char *IconConfigKey; + static const char *NewMailIconConfigKey; + static const char *ResetCounterConfigKey; + static const char *PassivePopupConfigKey; + static const char *PassiveDateConfigKey; //Enabled date in Passive popup + static const char *UseBoxSettingsConfigKey; + static const char *RealNameConfigKey; + + /** + * KMailDrop Constructor + */ + KMailDrop(); + + /** + * KMailDrop Destructor + */ + virtual ~KMailDrop(); + + /** + * @return TRUE if the mailbox and its configuration are valid. + */ + virtual bool valid() = 0; + + /** + * Number of messages in the mailbox at the last count. + * @return The number of messages in the mailbox since last count. + */ + int count() {return _lastCount;}; + + /** + * Recheck the number of letters in this mailbox. Raises the + * changed(int) signal if new mail is found. + * + * Concrete subclasses MUST reimplement this method. + */ + virtual void recheck()=0; + + /** + * Force a recheck + */ + virtual void forceRecheck() { recheck(); } + + /** + */ + virtual bool startMonitor()=0; + + /** + */ + virtual bool stopMonitor()=0; + + /** + * Check monitor run status. + * @return true if monitor is running. + */ + virtual bool running()=0; + + /** + * Add a configuration page to the configuration dialog. + * Each reimplementation should first call the inherited implementation, + * then call @ref KDropCfgDialog::addConfigPage with a custom + * @ref KMonitorCfg object. + */ +// virtual void addConfigPage( KDropCfgDialog * ); + + /** + * Returns a newly created KBoxFactory object initialized to + * be equivalent to this object (prototype pattern). + * + * Deletion of the returned object becomes the responsibility of + * the caller. + * + * Subclasses should override this to return objects of their + * own type. + */ + virtual KMailDrop *clone() const = 0; + + /** + * This function reads the settings which can be used by several + * accounts. These values can be overwritten by the readConfigGroup + * -function. + * + *@param cfg A configuration object with the group already + * set to the configuration for this box + */ + virtual void readGeneralConfigGroup( const KConfigBase& cfg ); + + /** + * Read box configuration from a config group. Subclasses that + * reimplement this should call the overridden method. + * + * @param cfg A configuration object with the group already set to + * the configuration for this box. + * @return true if read was successful, false otherwise. + */ + virtual bool readConfigGroup( const KConfigBase& cfg ); + virtual bool readConfigGroup( const QMap< QString, QString > &, const Protocol * ) { return true; } + + /** + * Write box configuration to a config group. Subclasses that + * reimplement this should call the overridden method. + * + * @param cfg A configuration object with the group already set to + * the configuration for this box. + * @return true if read was successful, false otherwise. + */ + virtual bool writeConfigGroup( KConfigBase& cfg ) const; + + /** + * Return the type of this monitor, for display and + * configuration purposes. Each concrete subclass should return a + * unique identifier. + */ + virtual QString type() const = 0; + + /** + * Return if the maildrop is synchrone (true) or asynchrone (false). + * This way, classes like KornSubjectDlg know if functions like + * readSubject() return a result immediately. + * @param true by a synchrone type; false by an asynchrone (like KKkioDrop) type. + */ + virtual bool synchrone() const { return true; } + + /** + * Return true if the concrete subclass can read the subjects of + * all new mails. This will enable the "Read Subjects" menu item. + */ + virtual bool canReadSubjects() {return false;} + + /** + * Read the subjects of all new mails. + * NOTE: the default implementation stops the timer, calls + * doReadSubjects, restarts the time if necessary and updates + * the displayed mail count. Concrete implementations should not + * touch readSubjects() but implement doReadSubjects() instead! + * @param stop: stop flag. If it is set to true during the execution, + * readSubjects shoulkd return as soon as possible. The return value + * is invalid in this case. If stop is 0, readSubjects will not + * terminate before all mail subjects are loaded. + * @return all new mails subjects as a vector. + */ + virtual QValueVector * readSubjects(bool * stop); + + /** + * Read the subjects of all new mails. The concrete subclass has + * to implement it, if canReadSubjects() returns true. + * @param stop: stop flag. If it is set to true during the execution, + * readSubjects should return as soon as possible. The return value + * is invalid in this case. If stop is 0, readSubjects will not + * terminate before all mail subjects are loaded. + * @return all new mails subjects as a vector. + */ + virtual QValueVector * doReadSubjects(bool * stop); + + /** + * Return true if the concrete subclass can delete individual mails. + * This will enable the "Delete" button in the mail subjects dialog. + */ + virtual bool canDeleteMails() {return false;} + + /** + * Delete some mails in the mailbox. The concrete subclass has + * to implement it, if canDeleteMails() returns true. + * @param ids list of mail ids to delete. The ids are taken from + * the corresponding KornMailSubject instances returned by a previous + * call to doReadSubjects(). + * @param stop: stop flag. If it is set to true during the execution, + * deleteMails() should return as soon as possible. The return value + * is invalid in this case. If stop is 0, deleteMails() will not + * terminate before the mails are deleted. + * @return true, if the mail ids of the remaining mails might have changed. + * The corresponding KornMailSubject instances returned by a previous + * call to doReadSubjects() have to be discarded and readSubjects() must + * be called again to get the correct mail ids. If false is returned, + * the KornMailSubject instances of the remaining mails might be used + * further more. + */ + virtual bool deleteMails(QPtrList * ids, bool * stop); + + /** + * Return true if the concrete subclass can load individual mails fully. + * This will enable the "Full Message" button in the mail dialog. + */ + virtual bool canReadMail() {return false;} + + /** + * Load a mail from the mailbox fulle . The concrete subclass has + * to implement it, if deleteMails() returns true. + * @param id id of the mail to load. The id is taken from the corresponding + * KornMailSubject instances returned by a previous call to doReadSubjects(). + * @param stop: stop flag. If it is set to true during the execution, + * readMail() should return as soon as possible. The return value + * is invalid in this case. If stop is 0, readMail() will not + * terminate before the mail is loaded. + * @return the fully loaded mail (header and body) or "" on error. + */ + virtual QString readMail(const KornMailId * id, bool * stop); + + // data that belongs in every monitor + + QString caption() const { return _caption; } + QString clickCmd() const { return _clickCmd; } + QString newMailCmd() const { return _nMailCmd; } + QString soundFile() const { return _soundFile;} + QColor bgColour() const { return _bgColour; } + QColor fgColour() const { return _fgColour; } + QColor newBgColour() const { return _nbgColour; } + QColor newFgColour() const { return _nfgColour; } + QString icon() const { return _icon; } + QString newIcon() const { return _nIcon; } + Style displayStyle() const { return _style; } + bool passivePopup() const { return _passivePopup; } + bool passiveDate() const { return _passiveDate; } + QString realName() const { return _realName; } +; + void setCaption(QString); + void setClickCmd(QString); + void setNewMailCmd(QString); + void setSoundFile(QString); + void setDisplayStyle(Style); + void setBgColour(QColor); + void setFgColour(QColor); + void setNewBgColour(QColor); + void setNewFgColour(QColor); + void setIcon(QString); + void setNewIcon(QString); + void setResetCounter(int); + void setPassivePopup(bool); + void setPassiveDate(bool); + void setRealName(QString); + + /** + * This is called by the manager when it wishes to delete + * a monitor. Clients should connect to the @ref ::notifyDisconnect + * signal and ensure that the monitor is not accessed after + * the signal has been received. + * + * Reimplementations should call this implementation too. + */ + virtual void notifyClients(); + + public slots: + + /** + * Forcibly set the count to zero; + */ + virtual void forceCountZero(); + + /* + * The next slots are used by kio; the present at this places + * prevent warnings at runtime. + */ + virtual void readSubjectsCanceled() {} + virtual void readMailCanceled() {} + virtual void deleteMailsCanceled() {} + + protected slots: + + void setCount( int, KMailDrop* ); + +signals: + + /** + * This signal is emitted when the mailbox discovers + * new messages in the maildrop. + */ + void changed( int, KMailDrop* ); + + /** + * This signal is emitted when the valid-status changes. + * @param isValid true then and only then if the box is valid + */ + void validChanged( bool isValid ); + + /** + * This is emitted on configuration change, normally + * on an updateConfig() but + */ + void configChanged(); + + /** + * Clients should connect to this and discontinue use + * after it is emitted. + */ + void notifyDisconnect(); + + /** + * rechecked() is called if an asynchrone maildrop has + * rechecked the availability of email. + */ + void rechecked(); + + /** + * The next signal is emitted when a passive popup could be displayed. + * As argument, there is a KornSubject, which contains a subject and + * some more info that could be used with the popup. + */ + void showPassivePopup( QPtrList< KornMailSubject >*, int, bool, const QString& realname ); + + /** + * This signal is emitted when a passive error message should be displayed. + * + * @param error The error message + * @param realName The real name of this object. + */ + void showPassivePopup( const QString& error, const QString& realname ); + + /** + * readSubjects() might signal readSubject() if + * an subject is received. This is only useful in + * asynchrone situations. + * @param the subject structure which is read + */ + void readSubject( KornMailSubject * ); + + /** + * readSubjects() might signal readSubjectsTotalSteps() to + * send the expected total number of steps to a possible + * progress bar. See readSubjectsProgress(); + * @param totalSteps expected total number of steps. + */ + void readSubjectsTotalSteps(int totalSteps); + + /** + * readSubjects() might signal readSubjectsProgress() to + * send the current progress in relation to the + * expected total number of steps (see readSubjectsTotalSteps()). + * @param curent progress. + */ + void readSubjectsProgress(int progress); + + /** + * readSubjects() might signal readSubjectsReady() to + * remove the progress bar in asynchrone situations. + * @param: true if succes, false if cancelled + */ + void readSubjectsReady( bool success ); + + /** + * deleteMails() might signal deleteMailsTotalSteps() to + * send the expected total number of steps to a possible + * progress bar. See deleteMailsProgress(); + * @param totalSteps expected total number of steps. + */ + void deleteMailsTotalSteps(int totalSteps); + + /** + * deleteMails() might signal deleteMailsProgress() to + * send the current progress in relation to the + * expected total number of steps (see deleteMailsTotalSteps()). + * @param curent progress. + */ + void deleteMailsProgress(int progress); + + /** + * deleteMails() might signal deleteMailsReady() if + * it is not going to do something anyway. + * This could be the case when an email has been succesfully + * removed, or when the deletions failed. This is useful + * in asynchrone situations. + * @param: true if deletion was succesful; elsewise false. + */ + void deleteMailsReady( bool ); + + /** + * readMail() might signal readMailTotalSteps() to + * send the expected total number of steps to a possible + * progress bar. See readMailProgress(); + * @param totalSteps expected total number of steps. + */ + void readMailTotalSteps(int totalSteps); + + /** + * readMail() might signal readMailProgress() to + * send the current progress in relation to the + * expected total number of steps (see readMailTotalSteps()). + * @param curent progress. + */ + void readMailProgress(int progress); + + /** + * readMail() might signal readMailReady() if + * a email is totally read. This is useful + * in asynchrone situations. + * @param pointer to the full email-message. + */ + void readMailReady( QString* ); +}; + +#endif // SSK_MAILDROP_H diff --git a/korn/mailid.cpp b/korn/mailid.cpp new file mode 100644 index 00000000..a4822024 --- /dev/null +++ b/korn/mailid.cpp @@ -0,0 +1,5 @@ +#include "mailid.h" + +KornMailId::~KornMailId() +{ +} diff --git a/korn/mailid.h b/korn/mailid.h new file mode 100644 index 00000000..d640bfe7 --- /dev/null +++ b/korn/mailid.h @@ -0,0 +1,33 @@ +#ifndef MailId_h +#define MailId_h + +#include + +/** + * Abstract base class for mail ids. Concrete mail ids store the id. + * Its sole purpose is to treat all possible mail id format in a unique + * way (by inheritence). + */ +class KornMailId +{ +public: + /** + * KornMailId Destructor + */ + virtual ~KornMailId(); + + /** + * Return a string representation of this (for debuggin purposes only) + * @return a string representation + */ + virtual QString toString() const = 0; + + /** + * Create an exact copy of this. + * @return the cloned object + */ + virtual KornMailId * clone() const = 0; +}; + + +#endif diff --git a/korn/mailsubject.cpp b/korn/mailsubject.cpp new file mode 100644 index 00000000..1f2011a0 --- /dev/null +++ b/korn/mailsubject.cpp @@ -0,0 +1,189 @@ +#include"mailsubject.h" + +#include +#include +#include +#include +#include +#include +#include +#include + +KornMailSubject::KornMailSubject() : _id(0), _drop(0), _size(-1), _date(-1), _fullMessage(false) +{ +} + +KornMailSubject::KornMailSubject(KornMailId * id, KMailDrop *drop) + : _id(id), _drop( drop ), _size(-1), _date(-1), _fullMessage(false) +{ +} + +KornMailSubject::KornMailSubject(const KornMailSubject & src) + : _id(0), _drop(0), _size(-1), _date(-1) +{ + operator=(src); +} + +KornMailSubject & KornMailSubject::operator= (const KornMailSubject & src) +{ + _size = src._size; + _date = src._date; + _subject = src._subject; + _sender = src._sender; + _header = src._header; + _fullMessage = src._fullMessage; + if (_id) + delete _id; + _id = 0; + if (src._id) + _id = src._id->clone(); + _drop = src._drop; + return *this; +} + +KornMailSubject::~KornMailSubject() +{ + if (_id) + delete _id; + _id = 0; +} + +QString KornMailSubject::toString() const +{ + QDateTime date; + date.setTime_t(_date); + return QString("KornMailSubject, Id: ") + (_id?_id->toString():QString("NULL")) + ", " + i18n("Subject:") + " " + _subject + + ", " + i18n("Sender:") + " " + _sender + ", " + i18n("Size:") + " " + QString::number(_size) + + ", " + i18n("Date:") + " " + date.toString(Qt::ISODate); +} + +QString KornMailSubject::decodeRFC2047String(const QCString& aStr) +{ + if ( aStr.isEmpty() ) + return QString::null; + + const QCString str = unfold( aStr ); + + if ( str.isEmpty() ) + return QString::null; + + if ( str.find( "=?" ) < 0 ) { + // No need to decode + return QString(str); + } + + QString result; + QCString LWSP_buffer; + bool lastWasEncodedWord = false; + + for ( const char * pos = str.data() ; *pos ; ++pos ) { + // collect LWSP after encoded-words, + // because we might need to throw it out + // (when the next word is an encoded-word) + if ( lastWasEncodedWord && isBlank( pos[0] ) ) { + LWSP_buffer += pos[0]; + continue; + } + // verbatimly copy normal text + if (pos[0]!='=' || pos[1]!='?') { + result += LWSP_buffer + pos[0]; + LWSP_buffer = 0; + lastWasEncodedWord = false; + continue; + } + // found possible encoded-word + const char * const beg = pos; + { + // parse charset name + QCString charset; + int i = 2; + pos += 2; + for ( ; *pos != '?' && ( *pos==' ' || ispunct(*pos) || isalnum(*pos) ); ++i, ++pos ) { + charset += *pos; + } + if ( *pos!='?' || i<4 ) + goto invalid_encoded_word; + + // get encoding and check delimiting question marks + const char encoding[2] = { pos[1], '\0' }; + if (pos[2]!='?' || (encoding[0]!='Q' && encoding[0]!='q' && + encoding[0]!='B' && encoding[0]!='b')) + goto invalid_encoded_word; + pos+=3; i+=3; // skip ?x? + const char * enc_start = pos; + // search for end of encoded part + while ( *pos && !(*pos=='?' && *(pos+1)=='=') ) { + i++; + pos++; + } + if ( !*pos ) + goto invalid_encoded_word; + + // valid encoding: decode and throw away separating LWSP + const KMime::Codec * c = KMime::Codec::codecForName( encoding ); + kdFatal( !c ) << "No \"" << encoding << "\" codec!?" << endl; + + QByteArray in; in.setRawData( enc_start, pos - enc_start ); + const QByteArray enc = c->decode( in ); + in.resetRawData( enc_start, pos - enc_start ); + + const QTextCodec * codec = codecForName(charset); + if (!codec) return QString::null; + result += codec->toUnicode(enc); + lastWasEncodedWord = true; + + ++pos; // eat '?' (for loop eats '=') + LWSP_buffer = 0; + } + continue; +invalid_encoded_word: + // invalid encoding, keep separating LWSP. + pos = beg; + if ( !LWSP_buffer.isNull() ) + result += LWSP_buffer; + result += "=?"; + lastWasEncodedWord = false; + ++pos; // eat '?' (for loop eats '=') + LWSP_buffer = 0; + } + return result; +} + +QCString KornMailSubject::unfold( const QCString & header ) +{ + if ( header.isEmpty() ) + return QCString(); + + QCString result( header.size() ); // size() >= length()+1 and size() is O(1) + char * d = result.data(); + + for ( const char * s = header.data() ; *s ; ) + if ( *s == '\r' ) { // ignore + ++s; + continue; + } else if ( *s == '\n' ) { // unfold + while ( this->isBlank( *++s ) ); + *d++ = ' '; + } else + *d++ = *s++; + + *d++ = '\0'; + + result.truncate( d - result.data() ); + return result; +} + +//----------------------------------------------------------------------------- +const QTextCodec* KornMailSubject::codecForName(const QCString& _str) +{ + if (_str.isEmpty()) return 0; + QCString codec = _str; + return KGlobal::charsets()->codecForName(codec); +} + +void KornMailSubject::decodeHeaders() +{ + _subject = decodeRFC2047String( _subject.latin1() ); + _sender = decodeRFC2047String( _sender.latin1() ); +} + diff --git a/korn/mailsubject.h b/korn/mailsubject.h new file mode 100644 index 00000000..f3e2e457 --- /dev/null +++ b/korn/mailsubject.h @@ -0,0 +1,187 @@ +#ifndef MailSubject_h +#define MailSubject_h + +class QTextCodec; + +class KMailDrop; + +#include "mailid.h" + + + +/** + * A KornMailSubject instance represents a single mail. It stores + * its id, sender, subject, header, size and date and possibly its + * mail body + */ +class KornMailSubject +{ + KornMailId * _id; + KMailDrop * _drop; + QString _subject; + QString _sender; + QString _header; + int _size; + int _date; + bool _fullMessage; +public: + /** + * KornMailSubject default constructor + */ + KornMailSubject(); + + /** + * KornMailSubject constructor + * @param id id of the mail. The KornMailId instance should + * not be touched or deleted afterwards. It is destroyed by + * KornMailSubject's destructor. + * @param drop The KMailDrop. + */ + KornMailSubject(KornMailId * id, KMailDrop * drop); + + /** + * KornMailSubject copy constructor. All data of the source + * KornMailSubject instance are cloned. + * @param src KornMailSubject to copy from + */ + KornMailSubject(const KornMailSubject & src); + + /** + * replaces the contents of this by the contents of another + * KornMailSubject instance. All data of the source + * KornMailSubject instance are cloned. + * @param src KornMailSubject to copy from + */ + KornMailSubject & operator= (const KornMailSubject & src); + + /** + * KornMailSubject destructor + */ + virtual ~KornMailSubject(); + + /** + * Return the mail id. + * @return the mail id. + */ + const KornMailId * getId() const {return _id;} + + /** + * Set the mails subject. + * @param subject the mails subject. + */ + void setSubject(const QString & subject) {_subject = subject;} + + /** + * Return the subject. + * @return the subject. + */ + const QString & getSubject() const {return _subject;} + + /** + * Set the mails sender. + * @param sender the mails sender. + */ + void setSender(const QString & sender) {_sender = sender;} + + /** + * Return the sender. + * @return the sender. + */ + const QString & getSender() const {return _sender;} + + /** + * Set the mails header and (if possible) body. + * @param header the mails header with or without body (see fullMessage parameter). + * @param fullMessage true, if header contains the message body as well, false otherwise. + */ + void setHeader(const QString & header, bool fullMessage) {_header = header; _fullMessage = fullMessage;} + + /** + * Return the header or the full message (if isHeaderFullMessage() is true). + * @return the header or the full message. + */ + const QString & getHeader() const {return _header;} + + /** + * Return true, if the header contains the header and the full message. + * Return false if the header just contains the header. + * @return see above. + */ + bool isHeaderFullMessage() const {return _fullMessage;} + + /** + * Set the size of the full mail. + * @param the mails full size. + */ + void setSize(int size) {_size = size;} + + /** + * Return the size of the full mail. + * @return the size of the full mail. + */ + int getSize() const {return _size;} + + /** + * Set the mails date in seconds since 1970-01-01 00:00:00. + * @param date the mails date. + */ + void setDate(int date) {_date = date;} + + /** + * Return the mails date in seconds since 1970-01-01 00:00:00. + * @return the mails date. + */ + int getDate() const {return _date;} + + /** + * Return a string representation of this (for debugging purposes only) + * @return a string representation + */ + QString toString() const; + + /** + * Sets the KMailDrop field. + * @param drop The KMailDrop-object + */ + void setMailDrop( KMailDrop* drop ) { _drop = drop; } + + /** + * Returns the KMailDrop instance of the Maildrop which owns the subject + */ + KMailDrop* getMailDrop() const { return _drop; } + + /** + * decodes headers using decodeRFC2047String + */ + void decodeHeaders(); + +private: + + /** + * Decode a string based on RFC2047 + */ + QString decodeRFC2047String(const QCString& aStr); + + /** + * Unfolding a string (basically changing tabs to spaces + */ + QCString unfold( const QCString & header ); + + /** + * Returns true if the parameter is a blank (or tab) + * + * Note from KMail's code, where this function is taken from: + * don't rely on isblank(), which is a GNU extension in + * . But if someone wants to write a configure test for + * isblank(), we can then rename this function to isblank and #ifdef + * it's definition... + */ + inline bool isBlank( char ch ) { return ch == ' ' || ch == '\t' ; } + + /** + * ?? + */ + const QTextCodec* codecForName(const QCString& _str); +}; + +#endif diff --git a/korn/main.cpp b/korn/main.cpp new file mode 100644 index 00000000..97a79441 --- /dev/null +++ b/korn/main.cpp @@ -0,0 +1,53 @@ +/* + * (C) 1999, 2000 Sirtaj Singh Kang + * (C) 2000 Rik Hemsley + */ + +#include"kornapp.h" +#include +#include +#include + +#include"kornshell.h" + +static const char description[] = I18N_NOOP("KDE mail checker"); +static const char version[] = "0.4"; + + +int main(int argc, char *argv[]) +{ + KAboutData aboutData(argv[0], I18N_NOOP("Korn"), + version, description, KAboutData::License_GPL, + I18N_NOOP("(c) 1999-2004, The Korn Developers")); + aboutData.addAuthor("Sirtaj Singh Kang",0, "taj@kde.org"); + aboutData.addAuthor("Cristian Tibirna",0, "tibirna@kde.org"); + aboutData.addAuthor("Kurt Granroth",0, "granroth@kde.org"); + aboutData.addAuthor("Rik Hemsley",0, "rik@kde.org"); + aboutData.addAuthor("Fixes by Jörg Habenicht",0, "j.habenicht@europemail.com"); + aboutData.addAuthor("Preview by Heiner Eichmann",0, "h.eichmann@gmx.de"); + aboutData.addAuthor("Mart Kelder",0,"mart@kelder31.nl"); + + KCmdLineArgs::init( argc, argv, &aboutData ); + KUniqueApplication::addCmdLineOptions(); + + if( !KUniqueApplication::start() ) { + // Already running. Should pop up the preferences dialog + return 0; + } + + KornApp *app = new KornApp(); + KornShell *korn = new KornShell( 0, "shell" ); + app->setShell( korn ); + + //app->enableSessionManagement( true ); + + //if( korn->init() ) { + korn->show(); + app->exec(); + //} + + delete korn; + delete app; + + return 0; +} diff --git a/korn/mbox_proto.cpp b/korn/mbox_proto.cpp new file mode 100644 index 00000000..5ee32711 --- /dev/null +++ b/korn/mbox_proto.cpp @@ -0,0 +1,47 @@ +/* + * Copyright (C) 2005, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + + +#include "mbox_proto.h" + +#include + +#include +#include +#include + +#include "account_input.h" + +void MBox_Protocol::configFillGroupBoxes( QStringList* groupBoxes ) const +{ + groupBoxes->append( "mbox" ); +} + +void MBox_Protocol::configFields( QPtrVector< QWidget >* vector, const QObject*, QPtrList< AccountInput > *result ) const +{ + result->append( new URLInput( (QWidget*)vector->at( 0 ), i18n( "File:" ), "", "mailbox" ) ); +} + +void MBox_Protocol::readEntries( QMap< QString, QString >*, QMap< QString, QString >* ) const +{ +} + +void MBox_Protocol::writeEntries( QMap< QString, QString >* map ) const +{ + clearFields( map, (KIO_Protocol::Fields)( server | port | username | password | save_password | metadata ) ); +} diff --git a/korn/mbox_proto.h b/korn/mbox_proto.h new file mode 100644 index 00000000..d33ff894 --- /dev/null +++ b/korn/mbox_proto.h @@ -0,0 +1,58 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_MBOX_PROTO_H +#define MK_MBOX_PROTO_H + +#include "kio_proto.h" + +/* + * Protocol for mbox + */ +class MBox_Protocol : public KIO_Protocol +{ +public: + MBox_Protocol() {} + virtual ~MBox_Protocol() {} + + virtual QString protocol( bool ) const { return "mbox"; } + virtual QString configName() const { return "mbox"; } + + virtual bool canReadSubjects() const { return true; } + virtual bool canDeleteMail() const { return false; } + virtual bool canReadMail() const { return true; } + virtual bool fullMessage() const { return true; } + + //virtual int fields() const { return no_fields; } + //virtual int urlFields() const { return mailbox; } + + virtual QString mailboxName() const { return i18n( "File:" ); } + + virtual void recheckKURL( KURL &, KIO::MetaData & md ) const + { md.insert( "onlynew", "" ); md.insert( "savetime", "" ); } + virtual void readSubjectKURL( KURL &, KIO::MetaData & ) const { } + virtual void deleteMailKURL( KURL &, KIO::MetaData & ) const { } + virtual void readMailKURL( KURL &, KIO::MetaData & ) const { } + + virtual void configFillGroupBoxes( QStringList* ) const; + virtual void configFields( QPtrVector< QWidget >*, const QObject*, QPtrList< AccountInput >* ) const; + virtual void readEntries( QMap< QString, QString >*, QMap< QString, QString >* ) const; + virtual void writeEntries( QMap< QString, QString >* ) const; +}; + +#endif diff --git a/korn/nntp_proto.cpp b/korn/nntp_proto.cpp new file mode 100644 index 00000000..532ac47a --- /dev/null +++ b/korn/nntp_proto.cpp @@ -0,0 +1,57 @@ +/* + * Copyright (C) 2005, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + + +#include "nntp_proto.h" + +#include "account_input.h" + +#include +#include +#include +#include +#include + +void Nntp_Protocol::configFillGroupBoxes( QStringList* groupBoxes ) const +{ + groupBoxes->append( "server" ); + groupBoxes->append( "user" ); +} + +void Nntp_Protocol::configFields( QPtrVector< QWidget >* vector, const QObject*, QPtrList< AccountInput > * result ) const +{ + result->append( new TextInput( (QWidget*)vector->at( 0 ), i18n( "Server" ), TextInput::text, "", "server" ) ); + result->append( new TextInput( (QWidget*)vector->at( 0 ), i18n( "Port" ), 0, 65535, "119", "port" ) ); + + result->append( new TextInput( (QWidget*)vector->at( 1 ), i18n( "Username" ), TextInput::text, "", "username" ) ); + result->append( new TextInput( (QWidget*)vector->at( 1 ), i18n( "Password" ), TextInput::password, "", "password" ) ); + result->append( new CheckboxInput( (QWidget*)vector->at( 1 ), i18n( "Save password" ), "true", "savepassword" ) ); + QObject::connect( (QObject*)result->last()->rightWidget(), SIGNAL( toggled( bool ) ), + (QObject*)result->prev()->rightWidget(), SLOT( setEnabled( bool ) ) ); + result->last()->setValue( "false" ); +} + +void Nntp_Protocol::readEntries( QMap< QString, QString >*, QMap< QString, QString > * ) const +{ +} + +void Nntp_Protocol::writeEntries( QMap< QString, QString >* map ) const +{ + clearFields( map, (KIO_Protocol::Fields)( KIO_Protocol::mailbox | KIO_Protocol::metadata ) ); +} + diff --git a/korn/nntp_proto.h b/korn/nntp_proto.h new file mode 100644 index 00000000..c32a50b6 --- /dev/null +++ b/korn/nntp_proto.h @@ -0,0 +1,52 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_NNTP_PROTO_H +#define MK_NNTP_PROTO_H + +#include "kio_proto.h" + +class Nntp_Protocol : public KIO_Protocol +{ +public: + Nntp_Protocol() { } + virtual ~Nntp_Protocol() { } + + virtual KIO_Protocol * clone() const { return new Nntp_Protocol; } + + virtual bool connectionBased() const { return true; } + + virtual QString protocol() const { return "nntp"; } + virtual QString configName() const { return "nntp"; } + + virtual bool canReadSubjects() const { return true; } + virtual bool canDeleteMail() const { return false; } + virtual bool canReadMail() const { return true; } + virtual bool fullMessage() const { return true; } + + //virtual int fields() const { return server | port | username | password | mailbox; } + //virtual int urlFields() const { return no_fields; } + virtual unsigned short defaultPort( bool ) const { return 119; } + + virtual void configFillGroupBoxes( QStringList* ) const; + virtual void configFields( QPtrVector< QWidget >* vector, const QObject*, QPtrList< AccountInput >* ) const; + virtual void readEntries( QMap< QString, QString >*, QMap< QString, QString >* ) const; + virtual void writeEntries( QMap< QString, QString >* ) const; +}; + +#endif diff --git a/korn/password.cpp b/korn/password.cpp new file mode 100644 index 00000000..a3eb76ed --- /dev/null +++ b/korn/password.cpp @@ -0,0 +1,247 @@ +/* + * Copyright (C) 2005, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + + +#include "password.h" + +#include +#include +#include + +#include +#include + +KWallet::Wallet* KOrnPassword::m_wallet = 0; +bool KOrnPassword::m_openFailed = false; +bool KOrnPassword::m_useWallet = false; //Not default true until moving works + +QString KOrnPassword::readKOrnPassword( int box, int account, const KConfigBase &fallbackConfig ) +{ + QString result; + + if( readKOrnPassword( box, account, result ) ) + return result; + else + return fallbackConfig.readEntry( "password" ); +} + +QString KOrnPassword::readKMailPassword( int accountnr, const KConfigBase& fallbackConfig ) +{ + QString password; + open(); + + if( !m_wallet || !m_wallet->isOpen() || m_openFailed ) + return KMailDecrypt( fallbackConfig.readEntry( "pass" ) ); + + if( !m_wallet->hasFolder( "kmail" ) ) + return KMailDecrypt( fallbackConfig.readEntry( "pass" )); + m_wallet->setFolder( "kmail" ); + + if( m_wallet->readPassword( QString( "account-%1" ).arg( accountnr ), password ) != 0 ) + return fallbackConfig.readEntry( "password" ); + + return password; +} + +void KOrnPassword::writeKOrnPassword( int box, int account, KConfigBase& fallbackConfig, const QString& password ) +{ + if( writeKOrnPassword( box, account, password ) ) + { + if( fallbackConfig.hasKey( "password" ) ) + fallbackConfig.deleteEntry( "password" ); + } + else + fallbackConfig.writeEntry( "password", password ); +} + +void KOrnPassword::deleteKOrnPassword( int box, int account, KConfigBase& fallbackConfig ) +{ + deleteKOrnPassword( box, account ); + if( fallbackConfig.hasKey( "password" ) ) + fallbackConfig.deleteEntry( "password" ); +} + +bool KOrnPassword::deleteKOrnPassword( int box, int account ) +{ + if( !m_useWallet ) + //Wallet should not be used => saving in config file + return false; + + //Open wallet + open(); + + if( !m_wallet || !m_wallet->isOpen() || m_openFailed ) + //Opening failed => delete in config file + return false; + + //Make folder for KOrn if needed + if( !m_wallet->hasFolder( "korn" ) ) + return false; //It does not exist + m_wallet->setFolder( "korn" ); + + //Write to wallet + if( m_wallet->removeEntry( QString( "account-%1-%2" ).arg( box ).arg( account ) ) != 0 ) + //Writing failed + return false; + + //Password succesfully stored in the configuration. + return true; +} + +void KOrnPassword::moveKOrnPassword( int boxSrc, int accountSrc, KConfigBase& configSrc, + int boxDest, int accountDest, KConfigBase &configDest ) +{ + QString password; + + password = readKOrnPassword( boxSrc, accountSrc, configSrc ); + deleteKOrnPassword( boxSrc, accountSrc, configSrc ); + writeKOrnPassword( boxDest, accountDest, configDest, password ); +} + +void KOrnPassword::swapKOrnPassword( int box1, int account1, KConfigBase &config1, int box2, int account2, KConfigBase &config2 ) +{ + QString password1, password2; + password1 = readKOrnPassword( box1, account1, config1 ); + password2 = readKOrnPassword( box2, account2, config2 ); + deleteKOrnPassword( box1, account1, config1 ); + deleteKOrnPassword( box2, account2, config2 ); + writeKOrnPassword( box1, account1, config1, password2 ); + writeKOrnPassword( box2, account2, config2, password1 ); +} + +void KOrnPassword::swapKOrnWalletPassword( int box1, int account1, int box2, int account2 ) +{ + QString password1, password2; + bool passExist1, passExist2; + passExist1 = readKOrnPassword( box1, account1, password1 ); + passExist2 = readKOrnPassword( box2, account2, password2 ); + + if( passExist1 ) + deleteKOrnPassword( box1, account1 ); + if( passExist2 ) + deleteKOrnPassword( box2, account2 ); + + if( passExist1 ) + writeKOrnPassword( box2, account2, password1 ); + if( passExist2 ) + writeKOrnPassword( box1, account1, password2 ); +} + +void KOrnPassword::swapKOrnWalletPasswords( int box1, int accountnumber1 ,int box2, int accountnumber2 ) +{ + int max = accountnumber1 > accountnumber2 ? accountnumber1 : accountnumber2; + for( int xx = 0; xx < max; ++xx ) + swapKOrnWalletPassword( box1, xx, box2, xx ); +} + +void KOrnPassword::rewritePassword( int box, int account, KConfigBase &config, bool newUseWalletValue ) +{ + bool useWallet = m_useWallet; + QString password; + + setUseWallet( !newUseWalletValue ); + password = readKOrnPassword( box, account, config ); + deleteKOrnPassword( box, account, config ); + + setUseWallet( newUseWalletValue ); + writeKOrnPassword( box, account, config, password ); + + setUseWallet( useWallet ); +} + +void KOrnPassword::setUseWallet( const bool value ) +{ + m_useWallet = value; +} + +void KOrnPassword::open() +{ + if( m_wallet && m_wallet->isOpen() ) + return; //Already open + + if( m_openFailed ) + return; //Not open, and can't be opened + + delete m_wallet; m_wallet = 0; + m_wallet = KWallet::Wallet::openWallet( KWallet::Wallet::NetworkWallet(), 0 ); + + if( !m_wallet ) + m_openFailed = true; +} + +bool KOrnPassword::readKOrnPassword( int box, int account, QString& password ) +{ + if( !m_useWallet ) + return false; + + //Otherwise: try to open the wallet + open(); + + if( !m_wallet || !m_wallet->isOpen() || m_openFailed ) + //Opening failed: getting value out of config if it exists there + return false; + + if( !m_wallet->hasFolder( "korn" ) ) + //No folder korn exist, so no password stored in the wallet. + return false; + m_wallet->setFolder( "korn" ); + + if( m_wallet->readPassword( QString( "account-%1-%2" ).arg( box ).arg( account ), password ) != 0 ) + //Error during reading the password: use the one in the config file + return false; + + //Reading completed: returning + return true; +} + +bool KOrnPassword::writeKOrnPassword( int box, int account, const QString& password ) +{ + if( !m_useWallet ) + //Wallet should not be used => saving in the config file + return false; + + //Open wallet + open(); + + if( !m_wallet || !m_wallet->isOpen() || m_openFailed ) + //Opening failed => write to configfile + return false; + + //Make folder for KOrn if needed + if( !m_wallet->hasFolder( "korn" ) ) + m_wallet->createFolder( "korn" ); + m_wallet->setFolder( "korn" ); + + //Write to wallet + if( m_wallet->writePassword( QString( "account-%1-%2" ).arg( box ).arg( account ), password ) != 0 ) + //Writing failed + return false; + + //Password succesfully stored in the configuration. + return true; +} + +//This function is copyed from kmail/kmaccount.cpp +QString KOrnPassword::KMailDecrypt( const QString& enc ) +{ + QString result; + for (uint i = 0; i < enc.length(); i++) + result += (enc[i].unicode() <= 0x21) ? enc[i] : QChar(0x1001F - enc[i].unicode()); + + return result; +} diff --git a/korn/password.h b/korn/password.h new file mode 100644 index 00000000..b024fa84 --- /dev/null +++ b/korn/password.h @@ -0,0 +1,168 @@ +/* + * Copyright (C) 2005, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + + +#ifndef KORNPASSWORD_H +#define KORNPASSWORD_H + +class KConfigBase; +namespace KWallet { class Wallet; } + +class QString; + +/** + * This class can be used to store and retrieve passwords. + * It uses KWallet if possible, and the configuartion files otherwise. + */ +class KOrnPassword +{ +public: + /** + * Constructor: empty + */ + KOrnPassword(); + /** + * Destructor: empty + */ + ~KOrnPassword(); + + /** + * This function gets a password for KOrn. + * + * @param box The boxnumber of the account + * @param account The accountnumber of the account + * @param fallbackConfig The configuration file if KWallet cannot be used. + * @return The password, or QString::null if it failes. + */ + static QString readKOrnPassword( int box, int account, const KConfigBase& fallbackConfig ); + /** + * This function gets a password with is puts in KWallet by KMail + * + * @param accountnr The id of the KMail account + * @param fallbackConfig The configuration used if KWallet isn't available. + * @return The password, QStirng::null if it failes. + */ + static QString readKMailPassword( int accountnr, const KConfigBase& fallbackConfig ); + + /** + * This function saves a password for usage in KOrn. + * + * @param box The boxnumber of the account. + * @param account The accountnumber of the account. + * @param fallbackConfig The configuration file if KWallet isn't available. + * @param password The password to be stored. + */ + static void writeKOrnPassword( int box, int account, KConfigBase& fallbackConfig, const QString& password ); + + /** + * This function deletes a password from both KWallet and the configuration file + * + * @param box The boxnumber of the account. + * @param account The accountnumber of the account. + * @param fallbackConfig The configuration file if KWallet isn't available. + */ + static void deleteKOrnPassword( int box, int account, KConfigBase& fallbackConfig ); + + /** + * This function deletes a password from KWallet + * + * @param box The boxnumber of the account. + * @param account The accountnumber of the account. + */ + static bool deleteKOrnPassword( int box, int account ); + + /** + * This function moves a password + * + * @param boxSrc The source box number. + * @param accountSrc The source account number. + * @param configSrc The source configuration group. + * @param boxDest The destination box number. + * @param accountDest The destination account number + * @param configDest The destination configuration group. + */ + static void moveKOrnPassword( int boxSrc, int accountSrc, KConfigBase &configSrc, + int boxDest, int accountDest, KConfigBase &configDest ); + + /** + * This swaps the password from one box/account combination to another. + * + * @param box1 The box number of the first password. + * @param account1 The account number of the first password. + * @param config1 The configurationgroup of the first password. + * @param box2 The box number of the second password. + * @param account2 The account number of the second password. + * @param config2 The configurationgroup of the second password. + */ + static void swapKOrnPassword( int box1, int account1, KConfigBase &config1, int box2, int account2, KConfigBase &config2 ); + + /** + * This swaps the Wallet password from one box/account combination to another. + * + * @param box1 The box number of the first password. + * @param account1 The number of accounts to be investigated + * @param box2 The box number of the first password. + * @param account2 The number of accounts to be investigated + */ + static void swapKOrnWalletPassword( int box1, int account1 ,int box2, int account2 ); + + /** + * This swaps the password from one box to another. + * + * @param box1 The box number of the first password. + * @param accountnumber1 The number of accounts to be investigated + * @param box2 The box number of the first password. + * @param accountnumber2 The number of accounts to be investigated + */ + static void swapKOrnWalletPasswords( int box1, int accountnumber1 ,int box2, int accountnumber2 ); + + /** + * This function read the password from the configuration (wallet or configuration) with UseWallet set to !newUseWalletValue, + * afterwards, it writes the password to the configuration with UseWallet set to newUseWalletValue + * + * @param box The box number + * @param account The account number + * @param config The configuration group + * @param newUseWalletValue true to transport a password from a configuration to a wallet, false the other wat around + */ + static void rewritePassword( int box, int account, KConfigBase &config, bool newUseWalletValue ); + + /** + * If set to true, this class will try to use KWallet, + * if false, it will not. + * + * The default value is true. + * + * @param value The value to be set to this property. + */ + static void setUseWallet( const bool value ); +private: + static void open(); + + static bool readKOrnPassword( int box, int account, QString& password ); + static bool writeKOrnPassword( int box, int account, const QString& password ); + + static QString KMailDecrypt( const QString& enc ); + + static KWallet::Wallet *m_wallet; + static bool m_openFailed; + static bool m_useWallet; +}; + +#endif //KORNPASSWORD_H + diff --git a/korn/polldrop.cpp b/korn/polldrop.cpp new file mode 100644 index 00000000..32a44be4 --- /dev/null +++ b/korn/polldrop.cpp @@ -0,0 +1,90 @@ +/* +* polldrop.cpp -- Implementation of class KPollableDrop. +* Author: Sirtaj Singh Kang +* Version: $Id$ +* Generated: Sun Nov 30 22:41:49 EST 1997 +*/ + + +#include + +#include"utils.h" +#include"polldrop.h" + +KPollableDrop::KPollableDrop() + : KMailDrop() +{ + _timerId = 0; + _timerRunning = false; + _freq = 300; +} + + +bool KPollableDrop::startMonitor() +{ + if( !running() ) { + recheck(); + + _timerId = startTimer( _freq * 1000 ); + _timerRunning = true; + + return startProcess(); + } + + return false; +} + +bool KPollableDrop::stopMonitor() +{ + if( running() ) { + killTimer( _timerId ); + _timerId = 0; + _timerRunning = false; + + return stopProcess(); + } + + return false; +} + + +void KPollableDrop::timerEvent( QTimerEvent *ev ) +{ + if( _timerRunning && (ev->timerId() == _timerId) ) { + // this event is ours. + recheck(); // should be reimplemented by children. + } + else { + QObject::timerEvent( ev ); + } +} + +bool KPollableDrop::readConfigGroup( const KConfigBase& cfg ) +{ + KMailDrop::readConfigGroup( cfg ); + + setFreq( cfg.readNumEntry(fu(PollConfigKey), DefaultPoll ) ); + + return true; +} + +bool KPollableDrop::writeConfigGroup( KConfigBase& cfg ) const +{ + KMailDrop::writeConfigGroup( cfg ); + + cfg.writeEntry(fu(PollConfigKey), freq() ); + + return true; +} + +//void KPollableDrop::addConfigPage( KDropCfgDialog *dlg ) +//{ +// dlg->addConfigPage( new KPollCfg( this ) ); +// +// KMailDrop::addConfigPage( dlg ); +//} + +const char *KPollableDrop::PollConfigKey = "interval"; +const int KPollableDrop::DefaultPoll = 300; // 5 minutes + +#include "polldrop.moc" diff --git a/korn/polldrop.h b/korn/polldrop.h new file mode 100644 index 00000000..b7ea69ab --- /dev/null +++ b/korn/polldrop.h @@ -0,0 +1,69 @@ +/* +* polldrop.h -- Declaration of class KPollableDrop. +* Generated by newclass on Sun Nov 30 22:41:49 EST 1997. +*/ +#ifndef SSK_POLLDROP_H +#define SSK_POLLDROP_H + +#include"maildrop.h" + +class QTimerEvent; + +/** +* Superclass for all pollable maildrop monitors. +* +* To implement a polling maildrop, reimplement recheck and emit +* changed(int) in recheck if new messages have been received. +* +* @author Sirtaj Singh Kang (taj@kde.org) +* @version $Id$ +*/ +class KPollableDrop : public KMailDrop +{ + Q_OBJECT +public: + static const char *PollConfigKey; + static const int DefaultPoll; + +private: + int _freq; + int _timerId; + bool _timerRunning; + +public: + /** + * KPollableDrop Constructor + */ + KPollableDrop(); + + virtual bool startMonitor(); + virtual bool stopMonitor(); + virtual bool startProcess() { return true; } //Start en stop-functions for progress; it is not pollable, but a member of kio + virtual bool stopProcess() { return true; } + + virtual bool running() { return _timerRunning; }; + + int freq() const { return _freq; } + void setFreq( int freq ); + + virtual bool readConfigGroup ( const KConfigBase& cfg ); + virtual bool writeConfigGroup ( KConfigBase& cfg ) const; + + //virtual void addConfigPage( KDropCfgDialog * ); + +protected: + void timerEvent( QTimerEvent * ); +}; + +inline void KPollableDrop::setFreq( int freq ) +{ + bool r = running(); + + if( r ) stopMonitor(); + + _freq = freq; + + if( r ) startMonitor(); +} + +#endif // SSK_POLLDROP_H diff --git a/korn/pop3_proto.cpp b/korn/pop3_proto.cpp new file mode 100644 index 00000000..7e88f7fb --- /dev/null +++ b/korn/pop3_proto.cpp @@ -0,0 +1,102 @@ +/* + * Copyright (C) 2005, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + + +#include "pop3_proto.h" + +#include "account_input.h" + +#include + +#include +#include +#include +#include +#include + +void Pop3_Protocol::configFillGroupBoxes( QStringList* groupBoxes ) const +{ + groupBoxes->append( "Server" ); + groupBoxes->append( "Identify" ); +} + +void Pop3_Protocol::configFields( QPtrVector< QWidget >* vector, const QObject* configDialog, QPtrList< AccountInput > * result ) const +{ + QMap< QString, QString > encrList; + encrList.insert( "ssl", i18n( "SSL" ) ); + encrList.insert( "tls=auto", i18n( "TLS if possible" ) ); + encrList.insert( "tls=on", i18n( "Always TLS" ) ); + encrList.insert( "tls=off", i18n( "Never TLS" ) ); + + QMap< QString, QString > authList; + authList.insert( "", i18n( "Plain" ) ); + authList.insert( "auth=APOP", i18n( "APOP" ) ); + + result->append( new TextInput( (QWidget*)vector->at( 0 ), i18n( "Server" ), TextInput::text, "", "server" ) ); + result->append( new TextInput( (QWidget*)vector->at( 0 ), i18n( "Port" ), 0, 65535, "110", "port" ) ); + result->append( new ComboInput( (QWidget*)vector->at( 0 ), i18n( "Encryption" ), encrList, "tls=auto", "encryption" ) ); + QObject::connect( (QObject*)result->last()->rightWidget(), SIGNAL( activated( int) ), + configDialog, SLOT( slotSSLChanged() ) ); + + result->append( new TextInput( (QWidget*)vector->at( 1 ), i18n( "Username" ), TextInput::text, "", "username" ) ); + result->append( new TextInput( (QWidget*)vector->at( 1 ), i18n( "Password" ), TextInput::password, "", "password" ) ); + result->append( new CheckboxInput( (QWidget*)vector->at( 1 ), i18n( "Save password" ), "true", "savepassword" ) ); + QObject::connect( (QObject*)result->last()->rightWidget(), SIGNAL( toggled( bool ) ), + (QObject*)result->prev()->rightWidget(), SLOT( setEnabled( bool ) ) ); + result->last()->setValue( "false" ); + result->append( new ComboInput( (QWidget*)vector->at( 1 ), i18n( "Authentication" ), authList, "", "auth" ) ); +} + +void Pop3_Protocol::readEntries( QMap< QString, QString >* map, QMap< QString, QString > *metadata ) const +{ + if( map->contains( "ssl" ) && *map->find( "ssl" ) == "true" ) + map->insert( "encryption", "ssl" ); + if( metadata->contains( "tls" ) ) + map->insert( "encryption", QString( "tls=%1" ).arg( *metadata->find( "tls" ) ) ); + if( metadata->contains( "auth" ) ) + map->insert( "auth", QString( "auth=APOP" ) ); +} + +void Pop3_Protocol::writeEntries( QMap< QString, QString >* map ) const +{ + QString metadata; + if( map->contains( "encryption" ) ) + { + if( *map->find( "encryption" ) == "ssl" ) + map->insert( "ssl", "true" ); + else + { + map->insert( "ssl", "false" ); + metadata += *map->find( "encryption" ); + } + map->erase( "encryption" ); + } + + if( map->contains( "auth" ) ) + { + if( !metadata.isEmpty() && ! (*map->find( "auth" )).isEmpty() ) + metadata += ","; + metadata += *map->find( "auth" ); + map->erase( "auth" ); + } + + map->insert( "metadata", metadata ); + + clearFields( map, KIO_Protocol::mailbox ); +} + diff --git a/korn/pop3_proto.h b/korn/pop3_proto.h new file mode 100644 index 00000000..bf67896b --- /dev/null +++ b/korn/pop3_proto.h @@ -0,0 +1,58 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_POP3_PROTO_H +#define MK_POP3_PROTO_H + +#include "kio_proto.h" +#include + +class Pop3_Protocol : public KIO_Protocol +{ +public: + Pop3_Protocol() {} + virtual ~Pop3_Protocol() {} + + virtual KIO_Protocol * clone() const { return new Pop3_Protocol; } + + virtual bool connectionBased() const { return true; } + + virtual QString protocol( bool ssl ) const { return ssl ? "pop3s" : "pop3"; } + virtual QString configName() const { return "pop3"; } + virtual bool canReadSubjects() const { return true; } + virtual bool canDeleteMail() const { return true; } + virtual bool canReadMail() const { return true; } + + virtual unsigned short defaultPort( bool ssl ) const { return ssl?995:110; } + + virtual DeleteTypeEnum deleteFunction() const { return get; } + + virtual QStringList authList() const { return QStringList::split( '|', "Plain|APOP", false ); } + + virtual void readSubjectKURL( KURL & kurl, KIO::MetaData & ) const { kurl.setPath( kurl.path().replace( "/download/", "/headers/" ) ); } + virtual void deleteMailKURL ( KURL & kurl, KIO::MetaData & ) const { kurl.setPath( kurl.path().replace( "/download/", "/remove/" ) ); } + virtual bool commitDelete () const { return true; } + virtual void deleteCommitKURL(KURL & kurl, KIO::MetaData & ) const { kurl.setPath( "commit" ); } + + virtual void configFillGroupBoxes( QStringList* ) const; + virtual void configFields( QPtrVector< QWidget >* vector, const QObject*, QPtrList< AccountInput >* ) const; + virtual void readEntries( QMap< QString, QString >*, QMap< QString, QString >* ) const; + virtual void writeEntries( QMap< QString, QString >* ) const; +}; + +#endif diff --git a/korn/pop3s_proto.h b/korn/pop3s_proto.h new file mode 100644 index 00000000..32beb4a0 --- /dev/null +++ b/korn/pop3s_proto.h @@ -0,0 +1,40 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_POP3S_PROTO_H +#define MK_POP3S_PROTO_H + +//Looks very simulay to Pop3_Protocol, so I inherit it, and only overload the difference. + +#include "pop3_proto.h" + +class Pop3s_Protocol : public Pop3_Protocol +{ +public: + Pop3s_Protocol() {} + virtual ~Pop3s_Protocol() {} + + virtual KIO_Protocol * clone() const { return new Pop3s_Protocol; } + + virtual QString protocol() const { return "pop3s"; } + virtual QString configName() const { return "pop3s"; } + + virtual unsigned short defaultPort() const { return 995; } +}; + +#endif diff --git a/korn/process_proto.cpp b/korn/process_proto.cpp new file mode 100644 index 00000000..30cb6f4d --- /dev/null +++ b/korn/process_proto.cpp @@ -0,0 +1,47 @@ +/* + * Copyright (C) 2005, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + + +#include "process_proto.h" + +#include + +#include +#include +#include + +#include "account_input.h" + +void Process_Protocol::configFillGroupBoxes( QStringList* groupBoxes ) const +{ + groupBoxes->append( "Process" ); +} + +void Process_Protocol::configFields( QPtrVector< QWidget >* vector, const QObject*, QPtrList< AccountInput > *result ) const +{ + result->append( new URLInput( (QWidget*)vector->at( 0 ), i18n( "Program:" ), "", "mailbox" ) ); +} + +void Process_Protocol::readEntries( QMap< QString, QString >*, QMap< QString, QString >* ) const +{ +} + +void Process_Protocol::writeEntries( QMap< QString, QString >* map ) const +{ + clearFields( map, (KIO_Protocol::Fields)( server | port | username | password | save_password | metadata ) ); +} diff --git a/korn/process_proto.h b/korn/process_proto.h new file mode 100644 index 00000000..6275be2c --- /dev/null +++ b/korn/process_proto.h @@ -0,0 +1,48 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_PROCESS_PROTOCOL +#define MK_PROCESS_PROTOCOL + +#include "kio_proto.h" + +class Process_Protocol : public KIO_Protocol +{ +public: + Process_Protocol() { } + virtual ~Process_Protocol() { } + + virtual KIO_Protocol * clone() const { return new Process_Protocol; } + + virtual QString protocol() const { return "process"; } + virtual QString configName() const { return "process"; } + + virtual bool canReadSubjects() const { return false; } + virtual bool canDeleteMail() const { return false; } + virtual bool canReadMail() const { return false; } + virtual bool fullMessage() const { return false; } + + virtual QString mailboxName() const { return i18n("Program: "); } + + virtual void configFillGroupBoxes( QStringList* ) const; + virtual void configFields( QPtrVector< QWidget >* vector, const QObject*, QPtrList< AccountInput >* ) const; + virtual void readEntries( QMap< QString, QString >*, QMap< QString, QString >* ) const; + virtual void writeEntries( QMap< QString, QString >* ) const; +}; + +#endif diff --git a/korn/progress_dialog.ui b/korn/progress_dialog.ui new file mode 100644 index 00000000..6e6b53fa --- /dev/null +++ b/korn/progress_dialog.ui @@ -0,0 +1,120 @@ + +DoubleProgressDialog + + + DoubleProgressDialog + + + + 0 + 0 + 286 + 140 + + + + Progress + + + + unnamed + + + + lbText + + + + + + + + pbBoxes + + + + + pbProgress + + + + + layout1 + + + + unnamed + + + + spacer1 + + + Horizontal + + + Expanding + + + + 41 + 20 + + + + + + pbCancel + + + &Cancel + + + + + spacer2 + + + Horizontal + + + Expanding + + + + 41 + 31 + + + + + + + + + + pbCancel + clicked() + DoubleProgressDialog + cancelbutton() + + + + pbCancel + + + progress_dialog.ui.h + + + cancelPressed() + + + setText( const QString & str ) + setNumberOfBoxes( int number ) + setProgressOfBoxes( int number ) + setNumberOfSteps( int number ) + setProgress( int number ) + cancelbutton() + + + diff --git a/korn/progress_dialog.ui.h b/korn/progress_dialog.ui.h new file mode 100644 index 00000000..fc982b8a --- /dev/null +++ b/korn/progress_dialog.ui.h @@ -0,0 +1,67 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +/**************************************************************************** +** ui.h extension file, included from the uic-generated form implementation. +** +** If you want to add, delete, or rename functions or slots, use +** Qt Designer to update this file, preserving your code. +** +** You should not define a constructor or destructor in this file. +** Instead, write your code in functions called init() and destroy(). +** These will automatically be called by the form's constructor and +** destructor. +*****************************************************************************/ + + +void DoubleProgressDialog::setText( const QString & str ) +{ + lbText->setText( str ); +} + + +void DoubleProgressDialog::setNumberOfBoxes( int number ) +{ + pbBoxes->setTotalSteps( number ); + pbBoxes->setProgress( 0 ); +} + + +void DoubleProgressDialog::setProgressOfBoxes( int number ) +{ + pbBoxes->setProgress( number ); +} + + +void DoubleProgressDialog::setNumberOfSteps( int number ) +{ + pbProgress->setTotalSteps( number ); + pbProgress->setProgress( 0 ); +} + + +void DoubleProgressDialog::setProgress( int number ) +{ + pbProgress->setProgress( number ); +} + + +void DoubleProgressDialog::cancelbutton() +{ + emit cancelPressed(); +} diff --git a/korn/protocol.h b/korn/protocol.h new file mode 100644 index 00000000..75062b51 --- /dev/null +++ b/korn/protocol.h @@ -0,0 +1,63 @@ +/* + * Copyright (C) 2005, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + + +#ifndef PROTOCOL_H +#define PROTOCOL_H + +class AccountInput; +class KConfigGroup; +class KIO_Protocol; +class KMailDrop; + +class QGroupBox; +class QObject; +class QStringList; +class QWidget; + +template< class T> class QPtrList; +template< class T> class QPtrVector; +template< class T, class S> class QMap; + +#include + +class Protocol +{ +public: + Protocol() {} + virtual ~Protocol() {} + + virtual const Protocol* getProtocol( KConfigGroup* ) const = 0; + virtual KMailDrop* createMaildrop( KConfigGroup* ) const = 0; + virtual QMap< QString, QString > * createConfig( KConfigGroup* config, const QString& password ) const = 0; + virtual QString configName() const { return "not specified"; } + + virtual void configFillGroupBoxes( QStringList* ) const = 0; + virtual void configFields( QPtrVector< QWidget >* vector, const QObject*, QPtrList< AccountInput >* ) const = 0; + virtual void readEntries( QMap< QString, QString >* ) const = 0; + virtual void writeEntries( QMap< QString, QString >* ) const = 0; + + virtual unsigned short defaultPort( bool ) const { return 0; } + + //Functions that return a derived class. + //This way, no explicit cast is needed + virtual const KIO_Protocol* getKIOProtocol() const { return 0; } +}; + +#endif //PROTOCOL_H + diff --git a/korn/protocols.cpp b/korn/protocols.cpp new file mode 100644 index 00000000..60fac95a --- /dev/null +++ b/korn/protocols.cpp @@ -0,0 +1,87 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "protocols.h" + +#include "kio_proto.h" + +#include "imap_proto.h" +#include "mbox_proto.h" +#include "pop3_proto.h" +#include "process_proto.h" +//#include "imaps_proto.h" +#include "nntp_proto.h" +//#include "pop3s_proto.h" +#include "qmail_proto.h" +#include "dcop_proto.h" +#include "kmail_proto.h" + +#include +#include +#include + +QDict* Protocols::protocols = 0; + +const Protocol* Protocols::getProto( const QString& proto ) +{ + if( !protocols ) + fillProtocols(); + + return protocols->find( proto ); +} + +const Protocol* Protocols::firstProtocol() +{ + return getProto( "mbox" ); +} + +QStringList Protocols::getProtocols() +{ + QStringList output; + + if( !protocols ) + fillProtocols(); + + QDictIterator it( *protocols ); + for( ; it.current(); ++it ) + output.append( it.currentKey() ); + + output.sort(); + + return output; +} + +void Protocols::fillProtocols() +{ + protocols = new QDict< Protocol>; + protocols->setAutoDelete( true ); + addProtocol( new Imap_Protocol ); + addProtocol( new MBox_Protocol ); + addProtocol( new Pop3_Protocol ); + addProtocol( new Process_Protocol ); + addProtocol( new Nntp_Protocol ); + addProtocol( new QMail_Protocol ); + addProtocol( new DCOP_Protocol ); + addProtocol( new KMail_Protocol ); +} + +void Protocols::addProtocol( Protocol* proto ) +{ + protocols->insert( proto->configName(), proto ); +} + diff --git a/korn/protocols.h b/korn/protocols.h new file mode 100644 index 00000000..02492ce1 --- /dev/null +++ b/korn/protocols.h @@ -0,0 +1,46 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_PROTOCOLS_H +#define MK_PROTOCOLS_H + +class Protocol; + +template< class T > class QDict; +class QString; +class QStringList; + +class Protocols +{ +public: + Protocols() {} + ~Protocols() {} + + static const Protocol* getProto( const QString& ); + static const Protocol* firstProtocol(); + + static QStringList getProtocols(); + + static void fillProtocols(); +private: + static void addProtocol( Protocol* ); + + static QDict *protocols; +}; + +#endif //MK_PROTOCOLS_H diff --git a/korn/qmail_proto.cpp b/korn/qmail_proto.cpp new file mode 100644 index 00000000..8accfbdb --- /dev/null +++ b/korn/qmail_proto.cpp @@ -0,0 +1,49 @@ +/* + * Copyright (C) 2005, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + + +#include "qmail_proto.h" + +#include +#include + +#include +#include +#include + +#include "account_input.h" + +void QMail_Protocol::configFillGroupBoxes( QStringList* groupBoxes ) const +{ + groupBoxes->append( "Maildir" ); +} + +void QMail_Protocol::configFields( QPtrVector< QWidget >* vector, const QObject*, QPtrList< AccountInput > *result ) const +{ + result->append( new URLInput( (QWidget*)vector->at( 0 ), i18n( "Path:" ), "", "mailbox" ) ); + dynamic_cast(result->last()->rightWidget())->setMode( KFile::Directory ); +} + +void QMail_Protocol::readEntries( QMap< QString, QString >*, QMap< QString, QString >* ) const +{ +} + +void QMail_Protocol::writeEntries( QMap< QString, QString >* map ) const +{ + clearFields( map, (KIO_Protocol::Fields)( server | port | username | password | save_password | metadata ) ); +} diff --git a/korn/qmail_proto.h b/korn/qmail_proto.h new file mode 100644 index 00000000..90c1bc38 --- /dev/null +++ b/korn/qmail_proto.h @@ -0,0 +1,58 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_QMAIL_PROTO_H +#define MK_QMAIL_PROTO_H + +#include "kio_proto.h" + +class QMail_Protocol : public KIO_Protocol +{ +public: + QMail_Protocol() {} + virtual ~QMail_Protocol() {} + + virtual KIO_Protocol * clone() const { return new QMail_Protocol; } + + virtual bool connectionBased() const { return false; } + + virtual QString protocol() const { return "file"; } + virtual QString configName() const { return "qmail"; } + + virtual bool canReadSubjects() const { return true; } + virtual bool canDeleteMail() const { return true; } + virtual bool canReadMail() const { return true; } + virtual bool fullMessage() const { return true; } + + virtual void recheckKURL( KURL &kurl, KIO::MetaData& ) const + { if( kurl.path().right( 1 ) == "/" ) + kurl.setPath( kurl.path() + "new" ); + else + kurl.setPath( kurl.path() + "/new" ); + } + + + virtual QString mailboxName() const { return i18n( "Path:" ); } + + virtual void configFillGroupBoxes( QStringList* ) const; + virtual void configFields( QPtrVector< QWidget >* vector, const QObject*, QPtrList< AccountInput >* ) const; + virtual void readEntries( QMap< QString, QString >*, QMap< QString, QString >* ) const; + virtual void writeEntries( QMap< QString, QString >* ) const; +}; + +#endif diff --git a/korn/sortedmailsubject.cpp b/korn/sortedmailsubject.cpp new file mode 100644 index 00000000..5b9da297 --- /dev/null +++ b/korn/sortedmailsubject.cpp @@ -0,0 +1,33 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "sortedmailsubject.h" + +int SortedMailSubject::compareItems ( QPtrCollection::Item item1, QPtrCollection::Item item2 ) +{ + int date1, date2; + date1 = ( (KornMailSubject*)item1 )->getDate(); + date2 = ( (KornMailSubject*)item2 )->getDate(); + + if( date1 < date2 ) + return -1; + else if( date1 == date2 ) + return 0; + else + return 1; +} diff --git a/korn/sortedmailsubject.h b/korn/sortedmailsubject.h new file mode 100644 index 00000000..e0011c12 --- /dev/null +++ b/korn/sortedmailsubject.h @@ -0,0 +1,40 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_SORTEDMAILSUBJECT_H +#define MK_SORTEDMAILSUBJECT_H + +#include "mailsubject.h" +#include + +/* + * This class is a normal QPtrList with an overloaded function compareItems. + * This way, it is possible to sort this list on date. + */ + +class SortedMailSubject : public QPtrList< KornMailSubject > +{ +public: + SortedMailSubject() : QPtrList< KornMailSubject >() {} + SortedMailSubject( const SortedMailSubject& sms ) : QPtrList< KornMailSubject >( sms ) {} + ~SortedMailSubject() {} + + virtual int compareItems ( QPtrCollection::Item item1, QPtrCollection::Item item2 ); +}; + +#endif //MK_SORTEDMAILSUBJECT_H diff --git a/korn/stringid.cpp b/korn/stringid.cpp new file mode 100644 index 00000000..43f5ea4a --- /dev/null +++ b/korn/stringid.cpp @@ -0,0 +1,38 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +/* + * Implementation of KornStringId + * Author: Mart Kelder + */ + +#include "stringid.h" + +KornStringId::KornStringId( const QString & id ) : _id( id ) +{ +} + +KornStringId::KornStringId( const KornStringId & src ) : KornMailId(), _id( src._id ) +{ +} + +KornMailId * KornStringId::clone() const +{ + return ( new KornStringId( *this ) ); +} + diff --git a/korn/stringid.h b/korn/stringid.h new file mode 100644 index 00000000..871f97ec --- /dev/null +++ b/korn/stringid.h @@ -0,0 +1,46 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_STRINGID_H +#define MK_STRINGID_H + +/* + * This class provides a identification with string, + * because in KIO, I don't know if emails return in the same order. + * Author Mart Kelder + */ + +#include +#include"mailid.h" + +class KornStringId : public KornMailId +{ +private: + QString _id; +public: + KornStringId( const QString & id ); + KornStringId( const KornStringId & src ); + ~KornStringId() {} + + QString getId() const { return _id; } + virtual QString toString() const { return _id; } + + virtual KornMailId *clone() const; +}; + +#endif //MK_STRINGID_H diff --git a/korn/subjectsdlg.cpp b/korn/subjectsdlg.cpp new file mode 100644 index 00000000..9b675e0b --- /dev/null +++ b/korn/subjectsdlg.cpp @@ -0,0 +1,535 @@ +#include "subjectsdlg.h" +#include "maildrop.h" +#include +#include +#include +#include +#include +#include +#include "mailsubject.h" +#include +#include +#include +#include "maildlg.h" +#include "progress_dialog.h" + +KornSubjectsDlg::SubjectListViewItem::SubjectListViewItem( QListView *parent, KornMailSubject * item) + // set the column strings except column 2 (date) + : KListViewItem(parent, item->getSender(), item->getSubject(), "", KGlobal::locale()->formatNumber(item->getSize(), 0)) + , _mailSubject( new KornMailSubject( *item ) ) +{ + // convert the date according to the user settings and show it in column 2 + QDateTime date; + date.setTime_t(_mailSubject->getDate()); + setText(2, KGlobal::locale()->formatDateTime(date, true, true)); +} + +KornSubjectsDlg::SubjectListViewItem::~SubjectListViewItem() +{ + delete _mailSubject; +} + +int KornSubjectsDlg::SubjectListViewItem::compare( QListViewItem* item, int column, bool ascending ) const +{ + if ( column == 2 ) + { + // if column 2 was clicked, compare the dates. + QDateTime d, e; + d.setTime_t(_mailSubject->getDate()); + e.setTime_t(((SubjectListViewItem *)item)->_mailSubject->getDate()); + return e.secsTo( d ); + } + else if ( column == 3 ) + { + // if column 3 was clicked, compare the sizes. + int i1 = _mailSubject->getSize(); + int i2 = ((SubjectListViewItem *)item)->_mailSubject->getSize(); + return i1 - i2; + } + else + { + // otherwise call default handling (i.e. string compare) + return KListViewItem::compare( item, column, ascending ); + } +} + +KornSubjectsDlg::KornSubjectsDlg( QWidget *parent ) + : KDialogBase( parent, "urldialog", true, "test", Close, Close, true), _mailDrop( new QPtrList< KMailDrop > ), + _subjects(0), _delete(0), mailDlg(0), _canDeleteMaildrop( true ) +{ + _loadSubjectsCanceled = false; + setModal( true ); + + // The dialog contains a list view and several buttons. + // Two box layouts hol dthem. + QWidget * page = new QWidget( this ); + setMainWidget(page); + invertSelButton = new KPushButton(i18n("&Invert Selection"), page); + clearSelButton = new KPushButton(i18n("&Remove Selection"), page); + deleteButton = new KPushButton(i18n("&Delete"), page); + showButton = new KPushButton(i18n("&Show"), page); + deleteButton->setEnabled(false); + showButton->setEnabled(false); + QVBoxLayout * topLayout = new QVBoxLayout( page, 0, spacingHint() ); + QHBoxLayout * buttons = new QHBoxLayout(); + _list = new KListView(page); + topLayout->addWidget(_list, 10); + topLayout->addLayout(buttons, 0); + buttons->addWidget(invertSelButton, 0); + buttons->addWidget(clearSelButton, 0); + buttons->addWidget(deleteButton, 0); + buttons->addWidget(showButton, 0); + buttons->addStretch(10); + + // feed the list view with its colums + _list->setSelectionMode(QListView::Multi); + _list->addColumn(i18n("From")); + _list->addColumn(i18n("Subject")); + _list->addColumn(i18n("Date")); + _list->addColumn(i18n("Size (Bytes)")); + + // column 3 contains a number (change alignment) + _list->setColumnAlignment(3, Qt::AlignRight); + _list->setItemMargin(3); + + // connect the selection changed and double click events of the list view + connect(_list, SIGNAL(selectionChanged()), this, SLOT(listSelectionChanged())); + connect(_list, SIGNAL(executed(QListViewItem *)), this, SLOT(doubleClicked(QListViewItem *))); + + // connect the buttons + connect(invertSelButton, SIGNAL(clicked()), this, SLOT(invertSelection())); + connect(clearSelButton, SIGNAL(clicked()), this, SLOT(removeSelection())); + connect(showButton, SIGNAL(clicked()), this, SLOT(showMessage())); + connect(deleteButton, SIGNAL(clicked()), this, SLOT(deleteMessage())); + setInitialSize(QSize(QApplication::desktop()->width(), QApplication::desktop()->height())); +} + +void KornSubjectsDlg::clear() +{ + _mailDrop->clear(); +} + +void KornSubjectsDlg::addMailBox(KMailDrop* mailDrop) +{ + _mailDrop->append( mailDrop ); +} + +void KornSubjectsDlg::loadMessages() +{ + reloadSubjects(); + exec(); +} + +void KornSubjectsDlg::listSelectionChanged() +{ + QPtrList< QListViewItem > list( _list->selectedItems() ); + + if (!_mailDrop) + return; + int selected = list.count(); + bool enableDelete = selected > 0; + + if(enableDelete) + { + KornSubjectsDlg::SubjectListViewItem* current = (SubjectListViewItem*)list.first(); + KMailDrop *drop = current->getMailSubject()->getMailDrop(); + enableDelete = drop->canDeleteMails(); + + while( enableDelete && ( current = (SubjectListViewItem*)list.next() ) ) + enableDelete = current->getMailSubject()->getMailDrop()->canDeleteMails(); + } + + // eneable the show button if one is selected + showButton->setEnabled(selected == 1); + + // eneable the delete button if one or more items are selected + + deleteButton->setEnabled(enableDelete); +} + +void KornSubjectsDlg::doubleClicked(QListViewItem * item) +{ + // show the message + showMessage(item); +} + +KornSubjectsDlg::~KornSubjectsDlg() +{ + if (_subjects) + delete _subjects; + _subjects = 0; +} + +void KornSubjectsDlg::loadSubjectsCanceled() +{ + _loadSubjectsCanceled = true; +} + +void KornSubjectsDlg::invertSelection() +{ + _list->invertSelection(); +} + +void KornSubjectsDlg::removeSelection() +{ + _list->clearSelection(); +} + +void KornSubjectsDlg::showMessage() +{ + if (!_mailDrop) + return; + + // get selcted item + QPtrList messages = _list->selectedItems(); + QListViewItem * item = messages.first(); + + // and show it + showMessage(item); +} + +void KornSubjectsDlg::showMessage(QListViewItem * item ) +{ + if (!item) + return; + + // Create mail dialog if it has not been created so far. + if (!mailDlg) + mailDlg = new KornMailDlg (this); + + // Feed the mail dailog with data and show it (modal dialog) + mailDlg->setMailSubject( ( ( KornSubjectsDlg::SubjectListViewItem *)item )->getMailSubject() ); + mailDlg->exec(); +} + +void KornSubjectsDlg::showSubjectsDlg( const QString& name ) +{ + setCaption( i18n("Mails in Box: %1").arg( name ) ); + + // load the subjects + reloadSubjects(); + // if the load process was not cancled: show the dialog + if( this->isVisible() ) + exec(); +} + +void KornSubjectsDlg::closeDialog( ) +{ + disconnect( this, SIGNAL( finished() ), this, SLOT( closeDialog() ) ); +} + +//---------------------------- +// ALL FUNCTIONS WITH HAVE SOMETHING TO DO WITH FETCHING SUBJECTS +//---------------------------- + +//The public function +void KornSubjectsDlg::reloadSubjects() +{ + if( _subjects ) + return; //Already fetching + + makeSubjectsStruct(); + + _subjects->progress->setNumberOfBoxes( _mailDrop->count() ); + _subjects->progress->setProgressOfBoxes( 0 ); + _subjects->progress->setNumberOfSteps( 1 ); + _subjects->progress->setProgress( 0 ); + + _subjects->it->toFirst(); + + if( !_subjects->it->current() ) + return; //No maildrops available. + + _subjects->progress->show(); + + prepareStep1Subjects( _subjects->it->current() ); +} + +//Private help-functions +void KornSubjectsDlg::prepareStep1Subjects( KMailDrop *drop ) +{ + _subjects->progress->setText( i18n( "Rechecking box..." ) ); + _subjects->progress->setNumberOfSteps( 1 ); + _subjects->progress->setProgress( 0 ); + _subjects->atRechecking = true; + + connect( drop, SIGNAL( rechecked() ), this, SLOT( slotReloadRechecked() ) ); + drop->recheck(); +} + +void KornSubjectsDlg::removeStep1Subjects( KMailDrop *drop ) +{ + disconnect( drop, SIGNAL( rechecked() ), this, SLOT( slotReloadRechecked() ) ); +} + +void KornSubjectsDlg::prepareStep2Subjects( KMailDrop *drop ) +{ + _subjects->progress->setText( i18n( "Fetching messages..." ) ); + _subjects->atRechecking = false; + + connect( drop, SIGNAL( readSubject( KornMailSubject* ) ), this, SLOT( subjectAvailable( KornMailSubject* ) ) ); + connect( drop, SIGNAL( readSubjectsReady( bool ) ), this, SLOT( subjectsReady( bool ) ) ); + connect( drop, SIGNAL( readSubjectsTotalSteps( int ) ), _subjects->progress, SLOT( setNumberOfSteps( int ) ) ); + connect( drop, SIGNAL( readSubjectsProgress( int ) ), _subjects->progress, SLOT( setProgress( int ) ) ); + connect( _subjects->progress, SIGNAL( cancelPressed() ), drop, SLOT( readSubjectsCanceled() ) ); + + if( _subjects->it->current()->canReadSubjects() ) + _subjects->it->current()->readSubjects( 0 ); + else + subjectsReady( true ); +} + +void KornSubjectsDlg::removeStep2Subjects( KMailDrop *drop ) +{ + disconnect( drop, SIGNAL( readSubject( KornMailSubject* ) ), this, SLOT( subjectAvailable( KornMailSubject* ) ) ); + disconnect( drop, SIGNAL( readSubjectsReady( bool ) ), this, SLOT( subjectsReady( bool ) ) ); + disconnect( drop, SIGNAL( readSubjectsTotalSteps( int ) ), _subjects->progress, SLOT( setNumberOfSteps( int ) ) ); + disconnect( drop, SIGNAL( readSubjectsProgress( int ) ), _subjects->progress, SLOT( setProgress( int ) ) ); + disconnect( _subjects->progress, SIGNAL( cancelPressed() ), drop, SLOT( readSubjectsCanceled() ) ); +} + +bool KornSubjectsDlg::makeSubjectsStruct() +{ + if( _subjects ) //Subjects are already being checked + return false; + + _subjects = new SubjectsData; + _subjects->it = new QPtrListIterator< KMailDrop >( *_mailDrop ); + _subjects->subjects = new QValueVector< KornMailSubject >; + _subjects->progress = new DoubleProgressDialog( this, "progress" ); + _subjects->atRechecking = true; + + connect( _subjects->progress, SIGNAL( cancelPressed() ), this, SLOT( slotSubjectsCanceled() ) ); + + return true; +} + +void KornSubjectsDlg::deleteSubjectsStruct() +{ + if( !_subjects ) + return; + + disconnect( _subjects->progress, SIGNAL( cancelPressed() ), this, SLOT( slotSubjectsCanceled() ) ); + + this->unsetCursor(); + + delete _subjects->progress; + delete _subjects->subjects; + delete _subjects->it; + delete _subjects; _subjects = 0; +} + +//Slots +void KornSubjectsDlg::slotReloadRechecked() +{ + _subjects->progress->setText( i18n( "Downloading subjects..." ) ); //Progress message when fetching messages + + removeStep1Subjects( _subjects->it->current() ); + _subjects->subjects->reserve( _subjects->it->current()->count() ); //enlarge QValueVector to speed adding up. + prepareStep2Subjects( _subjects->it->current() ); +} + +void KornSubjectsDlg::slotSubjectsCanceled() +{ + if( !_subjects ) + return; //Nothing to do + + if( _subjects->atRechecking ) + removeStep1Subjects( _subjects->it->current() ); + else + removeStep2Subjects( _subjects->it->current() ); + + deleteSubjectsStruct(); +} + +void KornSubjectsDlg::subjectAvailable( KornMailSubject * subject ) +{ + if( _subjects ) + _subjects->subjects->push_back( *subject ); + + delete subject; + +} + +void KornSubjectsDlg::subjectsReady( bool success ) +{ + static int progress; + + if( !_subjects ) + return; + + if( _subjects->it->atFirst() ) + progress = 0; + + removeStep2Subjects( _subjects->it->current() ); + + //Goto next drop + ++(*_subjects->it); + ++progress; + + _subjects->progress->setProgressOfBoxes( progress ); + + if( _subjects->it->current() ) + { + prepareStep1Subjects( _subjects->it->current() ); + } else { + //Clear list first + _list->clear(); + + //All subjects downloaded + for( QValueVector::iterator it = _subjects->subjects->begin(); it != _subjects->subjects->end(); + ++it ) + { //Draw entry's + new SubjectListViewItem(_list, &(*it)); + } + + if( _subjects->subjects->capacity() != _subjects->subjects->count() ) + _subjects->subjects->resize( _subjects->subjects->count() ); + + deleteSubjectsStruct(); + //If windows isn't visible already, shows it. + if( !isVisible() && success ) + show(); + } +} +//--------------------------------- +//Here comes all functions with have to do something with deleting messages +//--------------------------------- + + +//Main function +void KornSubjectsDlg::deleteMessage() +{ + if ( _delete ) + return; //A delete action is already pending + + makeDeleteStruct(); + + fillDeleteMessageList(); + + if ( _delete->messages->count() == 0 ) + { + deleteDeleteStruct(); + return; //No messages to delete + } else { + _delete->totalNumberOfMessages = _delete->messages->count(); + } + + QString confirmation = i18n( "Do you really want to delete %n message?", + "Do you really want to delete %n messages?", _delete->messages->count() ); + + if( KMessageBox::questionYesNo( this, confirmation, i18n( "Confirmation" ), KStdGuiItem::del(), KStdGuiItem::cancel() ) != KMessageBox::Yes ) + { + deleteDeleteStruct(); + return; //Not excepted + } + + _delete->progress->setLabelText( i18n( "Deleting mail; please wait...." ) ); + _delete->progress->setTotalSteps( _delete->totalNumberOfMessages ); + _delete->progress->setProgress( 0 ); + _delete->progress->show(); + + deleteNextMessage(); +} + +//Private help functions +void KornSubjectsDlg::makeDeleteStruct() +{ + _delete = new DeleteData; + _delete->messages = new QPtrList< KornMailSubject >; + _delete->ids = new QPtrList< const KornMailId >; + _delete->progress = new QProgressDialog( this, "progress" ); + _delete->totalNumberOfMessages = 0; + + connect( _delete->progress, SIGNAL( canceled() ), this, SLOT( slotDeleteCanceled() ) ); +} + +void KornSubjectsDlg::deleteDeleteStruct() +{ + disconnect( _delete->progress, SIGNAL( canceled() ), this, SLOT( slotDeleteCanceled() ) ); + + delete _delete->messages; + delete _delete->ids; + delete _delete->progress; + delete _delete; _delete = 0; +} + +void KornSubjectsDlg::fillDeleteMessageList() +{ + QListViewItem *current; + QPtrList< QListViewItem > list( _list->selectedItems() ); + + for( current = list.first(); current; current = list.next() ) + _delete->messages->append( ( ( KornSubjectsDlg::SubjectListViewItem * ) current )->getMailSubject() ); +} + +void KornSubjectsDlg::fillDeleteIdList( KMailDrop *drop ) +{ + _delete->ids->clear(); + KornMailSubject *current; + + for( current = _delete->messages->first(); current; ) + { + if( current->getMailDrop() == drop ) + { + _delete->ids->append( current->getId() ); + if( _delete->messages->remove( current ) ) + current = _delete->messages->current(); //If successfull, current() is already the next message + else + current = _delete->messages->next(); // If removal failed, goto the next item + } else { + current = _delete->messages->next(); //Goto next item + } + } +} + +void KornSubjectsDlg::deleteNextMessage() +{ + if( _delete->messages->count() == 0 ) //No more messages to delete + { + QTimer::singleShot( 100, this, SLOT( reloadSubjects() ) ); + deleteDeleteStruct(); + //reloadSubjects(); //Reload all subjects again + return; + } + + _delete->ids = new QPtrList< const KornMailId >; + _delete->drop = _delete->messages->getFirst()->getMailDrop(); + + fillDeleteIdList( _delete->drop ); + + // Connect the progress bar signals of the mail box + connect( _delete->drop, SIGNAL( deleteMailsTotalSteps( int ) ), _delete->progress, SLOT( setTotalSteps( int ) ) ); + connect( _delete->drop, SIGNAL( deleteMailsProgress( int ) ), _delete->progress, SLOT( setProgress( int ) ) ); + connect( _delete->drop, SIGNAL( deleteMailsReady( bool ) ), this, SLOT( deleteMailsReady( bool ) ) ); + + // connect the cancel button of the progress bar + connect( _delete->progress, SIGNAL( canceled() ), _delete->drop, SLOT( deleteMailsCanceled() ) ); + + // delete the mails + _delete->drop->deleteMails( _delete->ids, 0 ); +} + +void KornSubjectsDlg::deleteMailsReady( bool /*success*/ ) +{ + if( !_delete ) + return; + + disconnect( _delete->drop, SIGNAL( deleteMailsTotalSteps( int ) ), _delete->progress, SLOT( setTotalSteps( int ) ) ); + disconnect( _delete->drop, SIGNAL( deleteMailsProgress( int ) ), _delete->progress, SLOT( setProgress( int ) ) ); + disconnect( _delete->drop, SIGNAL( deleteMailsReady( bool ) ), this, SLOT( deleteMailsReady( bool ) ) ); + + // disconnect the cancel button of the progress bar + disconnect( _delete->progress, SIGNAL( canceled() ), _delete->drop, SLOT( deleteMailsCanceled() ) ); + + deleteNextMessage(); +} + +void KornSubjectsDlg::slotDeleteCanceled() +{ + deleteDeleteStruct(); + reloadSubjects(); +} + +#include "subjectsdlg.moc" + diff --git a/korn/subjectsdlg.h b/korn/subjectsdlg.h new file mode 100644 index 00000000..064b6c8e --- /dev/null +++ b/korn/subjectsdlg.h @@ -0,0 +1,202 @@ +#ifndef KornSubjectsDlg_h +#define KornSubjectsDlg_h + +#include +#include +#include +#include + +class KMailDrop; +class KornMailSubject; +class KornMailId; +class KListView; +class KornMailDlg; +class QProgressDialog; +class DoubleProgressDialog; + +template< class T > class QPtrList; + +/** + * KornSubjectsDlg loads all mail subjects and shows them in a list control. + * Buttons allow the user to select several mails, delete them or to show one + * of the mails. + */ +class KornSubjectsDlg: public KDialogBase +{ + Q_OBJECT + + /** + * SubjectListViewItem is a helper class representing one line in the list view. + * It stores the mail subject the line represents and controls the sorting. + */ + class SubjectListViewItem : public KListViewItem + { + KornMailSubject * _mailSubject; + public: + /** + * SubjectListViewItem Constructor + * @param parent list view + * @param item KornMailSubject this item should represent. It is NOT deleted + * if SubjectListViewItem is deleted. + */ + SubjectListViewItem( QListView *parent, KornMailSubject * item); + + /** + * SubjectListViewItem Destructor + */ + ~SubjectListViewItem(); + + /** + * Compare to list view item. Called if the sort header are clicked. + * @param item item to compare this with + * @param column column to compare + * @param ascending search order + */ + int compare( QListViewItem* item, int column, bool ascending ) const; + + /** + * Return the mail subject. + * @return the mail subject + */ + KornMailSubject * getMailSubject() const {return _mailSubject;} + }; + + QPtrList< KMailDrop > *_mailDrop; + struct SubjectsData + { + QPtrListIterator< KMailDrop > *it; + QValueVector< KornMailSubject > *subjects; + DoubleProgressDialog *progress; + bool atRechecking; + } *_subjects; + + struct DeleteData + { + QPtrList< KornMailSubject > *messages; + QPtrList< const KornMailId > *ids; + QProgressDialog *progress; + KMailDrop *drop; + int totalNumberOfMessages; + } *_delete; + + KListView * _list; + KPushButton * invertSelButton; + KPushButton * clearSelButton; + KPushButton * deleteButton; + KPushButton * showButton; + KornMailDlg * mailDlg; + + bool _loadSubjectsCanceled, _deleteMailsCanceled; + bool _canDeleteMaildrop; + + /** + * Load the mails subjects and refresh the list view. + * @return false if the load process was cancled (close the dialog!), true otherwise + */ + //bool reload(); + + /** + * Show a message in a separate dialog + * @param item message to show + */ + void showMessage(QListViewItem * item); +public: + /** + * KornSubjectsDlg Constructor + * @param parent parent widget + */ + KornSubjectsDlg( QWidget *parent=0 ); + + /** + * This functions clears all available KMailDrop's. + */ + void clear(); + + /** + * This function adds a maildrop to the list. + * @param mailDrop The maildrop which have to be added. + */ + void addMailBox(KMailDrop* mailDrop); + + /** + * This method loads the messages and shows the dialog. + */ + void loadMessages(); + + /** + * Show the KornSubjectsDlg as a modal dialog. + * @param name The name of the box + */ + void showSubjectsDlg( const QString& name ); + + /** + * KornSubjectsDlg Destructor + */ + virtual ~KornSubjectsDlg(); + +private slots: + + /** + * called if the cancel button was clicked while loadind the subjects + */ + void loadSubjectsCanceled(); + + /** + * called if the selction of the list view was changed + */ + void listSelectionChanged(); + + /** + * called if the "Invert Selection" button was clicked + */ + void invertSelection(); + + /** + * called if the "Remove Selection" button was clicked + */ + void removeSelection(); + + /** + * called if the "Show" button was clicked + */ + void showMessage(); + + /** + * called if a list view item was double clicked + */ + void doubleClicked ( QListViewItem *item ); + + void closeDialog(); + + //Functions for the subjects +public slots: + void reloadSubjects(); +private: + void prepareStep1Subjects( KMailDrop* ); + void removeStep1Subjects( KMailDrop* ); + void prepareStep2Subjects( KMailDrop* ); + void removeStep2Subjects( KMailDrop* ); + bool makeSubjectsStruct(); + void deleteSubjectsStruct(); +private slots: + void slotReloadRechecked(); + void slotSubjectsCanceled(); + void subjectAvailable( KornMailSubject* ); + void subjectsReady( bool ); + + //Functions neccesairy for delete +public slots: + void deleteMessage(); +private: + void makeDeleteStruct(); + void deleteDeleteStruct(); + void fillDeleteMessageList(); + void fillDeleteIdList( KMailDrop *drop ); + void deleteNextMessage(); +private slots: + void deleteMailsReady( bool ); + void slotDeleteCanceled(); + +}; + +#endif diff --git a/korn/systemtray.cpp b/korn/systemtray.cpp new file mode 100644 index 00000000..f3681d55 --- /dev/null +++ b/korn/systemtray.cpp @@ -0,0 +1,42 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#include "systemtray.h" + +#include +#include +#include + +#include + +SystemTray::SystemTray( QWidget * parent, const char * name ) + : KSystemTray( parent, name ) +{ +} + +SystemTray::~SystemTray() +{ +} + +void SystemTray::mousePressEvent( QMouseEvent* ee ) +{ + //Use the general function to determe what must be done + emit mouseButtonPressed( ee->button() ); +} + +#include "systemtray.moc" diff --git a/korn/systemtray.h b/korn/systemtray.h new file mode 100644 index 00000000..4b8aa616 --- /dev/null +++ b/korn/systemtray.h @@ -0,0 +1,58 @@ +/* + * Copyright (C) 2004, Mart Kelder (mart.kde@hccnet.nl) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +#ifndef MK_SYSTEMTRAY_H +#define MK_SYSTEMTRAY_H + +#include + +class QWidget; + +/** + * This class is an implementation of a KSystemTray class. + * It uses different handling of button-clicks. + * + * @author Mart Kelder + */ +class SystemTray : public KSystemTray +{ Q_OBJECT +public: + /** + * This contructor gives all it parameters to its parents. + * @param parant The parent window + * @param name The name of the QObject's parents. + */ + SystemTray( QWidget * parent = 0, const char * name = 0 ); + /** + * Empty destructor; does nothing at the moment + */ + ~SystemTray(); + +protected: + /** + * Reimplementation because in the reimplementation of KSystray it popup's of restores. + * In this implemention, the action depends on the settings. + * @param me An object which contains the mousebutton which is pressed. + */ + virtual void mousePressEvent( QMouseEvent* me ); + +signals: + void mouseButtonPressed( Qt::ButtonState ); +}; + +#endif //MK_SYSTEMTRAY_H diff --git a/korn/uninstall.desktop b/korn/uninstall.desktop new file mode 100644 index 00000000..e1e3e173 --- /dev/null +++ b/korn/uninstall.desktop @@ -0,0 +1,2 @@ +[Desktop Entry] +Hidden=true diff --git a/korn/utils.h b/korn/utils.h new file mode 100644 index 00000000..4dc27955 --- /dev/null +++ b/korn/utils.h @@ -0,0 +1,5 @@ +#ifndef KORN_UTILS_H +#define KORN_UTILS_H +#include +inline QString fu(const char * s) { return QString::fromUtf8(s); } +#endif -- cgit v1.2.3